|
|
|
|
|
|
About AnaSpec |
Company Profile |
Testimonials |
AnaSpec News |
Scientific Conferences |
Careers |
|
| Ordering & Shipping |
General Info |
Create New Account |
Order by Quotation |
Order by Catalog # |
|
| Technical Notes |
FAQ's, Product Literature |
Peptide Synthesis Notes |
Antibody Production Notes |
Chemical References |
Publications |
|
| Contact Us |
Contact Us |
|
| Products |
Amino Acids | Amino Acid Cartridges | | Amino Alcohols | (R)-1-Boc-2-azetidinemethanol | (R)-1-Boc-2-azetidinemethanol | (R)-1-Fmoc-2-azetidinemethanol | (R)-1-Fmoc-2-azetidinemethanol | (S)-1-Boc-2-azetidinemethanol | (S)-1-Boc-2-azetidinemethanol | (S)-1-Fmoc-2-azetidinemethanol | (S)-1-Fmoc-2-azetidinemethanol | Boc-α-(1-aminoethyl)-4-hydroxy-benzyl alcohol | Boc-α-(1-aminoethyl)-4-hydroxy-benzyl alcohol | Boc-α-aminomethyl-3-hydroxy-benzyl alcohol | Boc-α-aminomethyl-3-hydroxy-benzyl alcohol | Boc-α-aminomethyl-4-hydroxy-3-methoxybenzyl alcohol | Boc-α-aminomethyl-4-hydroxy-3-methoxybenzyl alcohol | Boc-α-aminomethyl-4-hydroxy-benzyl alcohol | Boc-α-aminomethyl-4-hydroxy-benzyl alcohol | Boc-β-cyclohexyl-L-alaninol | Boc-β-cyclohexyl-L-alaninol | Boc-(±)-cis-2-aminocyclohexanol | Boc-(±)-cis-2-aminocyclohexanol | Boc-(±)-cis-2-aminomethyl-cyclooctanol | Boc-(±)-cis-2-aminomethyl-cyclooctanol | Boc-(±)-cis-2-aminomethylcyclo-heptanol | Boc-(±)-cis-2-aminomethylcyclo-heptanol | Boc-(±)-cis-2-aminomethylcyclohexanol | Boc-(±)-cis-2-aminomethylcyclohexanol | Boc-(±)-cis-2-hydroxymethyl-1-cyclohexylamine | Boc-(±)-cis-2-hydroxymethyl-1-cyclohexylamine | Boc-(±)-cis-2-hydroxymethyl-4-cyclohexenyl-1-amine | Boc-(±)-cis-2-hydroxymethyl-4-cyclohexenyl-1-amine | Boc-(±)-cis-2-hydroxymethyl-trans-4-phenyl-1-cyclohexylamine | Boc-(±)-cis-2-hydroxymethyl-trans-4-phenyl-1-cyclohexylamine | Boc-(±)-trans-2-aminocyclohexanol | Boc-(±)-trans-2-aminocyclohexanol | Boc-(±)-trans-2-aminomethylcyclo-hexanol | Boc-(±)-trans-2-aminomethylcyclo-hexanol | Boc-(±)-trans-2-hydroxymethyl-1-cyclohexylamine | Boc-(±)-trans-2-hydroxymethyl-1-cyclohexylamine | Boc-(1R,2R)-(+)-2-amino-1,2-diphenylethanol | Boc-(1R,2R)-(+)-2-amino-1,2-diphenylethanol | Boc-(1R,2R)-(-)-2-amino-1-(4-nitrophenyl)-1,3-propanediol | Boc-(1R,2R)-(-)-2-amino-1-(4-nitrophenyl)-1,3-propanediol | Boc-(1R,2R)-(-)-2-amino-1-phenyl-1,3-propanediol | Boc-(1R,2R)-(-)-2-amino-1-phenyl-1,3-propanediol | Boc-(1R,2S)-(+)-cis-1-amino-2-indanol | Boc-(1R,2S)-(+)-cis-1-amino-2-indanol | Boc-(1R,2S)-(-)-2-amino-1,2-diphenylethanol | Boc-(1R,2S)-(-)-2-amino-1,2-diphenylethanol | Boc-(1R,2S)-(-)-norephedrine | Boc-(1R,2S)-(-)-norephedrine | Boc-(1S,2R)-(+)-2-amino-1,2-diphenylethanol | Boc-(1S,2R)-(+)-2-amino-1,2-diphenylethanol | Boc-(1S,2R)-(+)-norephedrine | Boc-(1S,2R)-(+)-norephedrine | Boc-(1S,2R)-(-)-cis-1-amino-2-indanol | Boc-(1S,2R)-(-)-cis-1-amino-2-indanol | Boc-(1S,2S)-(+)-2-amino-1-(4-nitrophenyl)-1,3-propanediol | Boc-(1S,2S)-(+)-2-amino-1-(4-nitrophenyl)-1,3-propanediol | Boc-(1S,2S)-(+)-2-amino-1-phenyl-1,3-propanediol | Boc-(1S,2S)-(+)-2-amino-1-phenyl-1,3-propanediol | Boc-(1S,2S)-(+)-2-amino-3-methoxy-1-phenylpropanol | Boc-(1S,2S)-(+)-2-amino-3-methoxy-1-phenylpropanol | Boc-(R)-(-)-1-amino-2-propanol | Boc-(R)-(-)-1-amino-2-propanol | Boc-(R)-(-)-2-amino-1-phenylethanol | Boc-(R)-(-)-2-amino-1-phenylethanol | Boc-(R)-(-)-2-aminobutanol | Boc-(R)-(-)-2-aminobutanol | Boc-(R)-(-)-3-pyrrolidinol | Boc-(R)-(-)-3-pyrrolidinol | Boc-(RS)-3-amino-1,2-propanediol | Boc-(RS)-3-amino-1,2-propanediol | Boc-(S)-(+)-1-amino-2-propanol | Boc-(S)-(+)-1-amino-2-propanol | Boc-(S)-(+)-2-amino-1-phenylethanol | Boc-(S)-(+)-2-amino-1-phenylethanol | Boc-(S)-(+)-2-aminobutanol | Boc-(S)-(+)-2-aminobutanol | Boc-(S)-(+)-3-amino-1,2-propanediol | Boc-(S)-(+)-3-amino-1,2-propanediol | Boc-[1-(2-(aminomethyl)phenyl)-4-piperidinyl]methanol | Boc-[1-(2-(aminomethyl)phenyl)-4-piperidinyl]methanol | Boc-1,1-diphenyl-L-alaninol | Boc-1,1-diphenyl-L-alaninol | Boc-1-amino-3-phenoxy-2-propanol | Boc-1-amino-3-phenoxy-2-propanol | Boc-1-amino-3-phenylpropan-2-ol | Boc-1-amino-3-phenylpropan-2-ol | Boc-1-amino-4-(2-hydroxyethyl)-piperazine | Boc-1-amino-4-(2-hydroxyethyl)-piperazine | Boc-1-aminomethylcyclohexanol | Boc-1-aminomethylcyclohexanol | Boc-1-hydroxyethylethoxypiperazine | Boc-1-hydroxyethylethoxypiperazine | Boc-2-(2-aminoethoxy)ethanol | Boc-2-(2-aminoethoxy)ethanol | Boc-2-(2-aminophenyl)ethanol | Boc-2-(2-aminophenyl)ethanol | Boc-2-(2-piperidyl)-ethanol | Boc-2-(2-piperidyl)-ethanol | Boc-2-(4-aminophenyl)ethanol | Boc-2-(4-aminophenyl)ethanol | Boc-2-(4-piperidyl)-ethanol | Boc-2-(4-piperidyl)-ethanol | Boc-2-amino-1-(2-naphthyl)-1-ethanol | Boc-2-amino-1-(2-naphthyl)-1-ethanol | Boc-2-amino-2-ethyl- 1,3-propanediol | Boc-2-amino-2-ethyl-1,3-propanediol | Boc-2-amino-2-methyl-1,3-propanediol | Boc-2-amino-2-methyl-1,3-propanediol | Boc-2-amino-2-methylpropanol | Boc-2-amino-2-methylpropanol | Boc-2-amino-5-chlorobenzylalcohol | Boc-2-amino-5-chlorobenzylalcohol | Boc-2-aminobenzylalcohol | Boc-2-aminobenzylalcohol | Boc-2-aminocyclopentanol | Boc-2-aminocyclopentanol | Boc-2-hydroxy-2-(2-chlorophenyl)-ethylamine | Boc-2-hydroxy-2-(2-chlorophenyl)-ethylamine | Boc-2-hydroxy-2-(2-methoxyphenyl)-ethylamine | Boc-2-hydroxy-2-(2-methoxyphenyl)-ethylamine | Boc-2-hydroxy-2-(2-methylphenyl)-ethylamine | Boc-2-hydroxy-2-(2-methylphenyl)-ethylamine | Boc-2-hydroxy-2-(3,4-dichlorophenyl)-ethylamine | Boc-2-hydroxy-2-(3,4-dichlorophenyl)-ethylamine | Boc-2-hydroxy-2-(3,5-dichlorophenyl)-ethylamine | Boc-2-hydroxy-2-(3,5-dichlorophenyl)-ethylamine | Boc-2-hydroxy-2-(3,5-dimethoxy-phenyl)ethylamine | Boc-2-hydroxy-2-(3,5-dimethoxy-phenyl)ethylamine | Boc-2-hydroxy-2-(4-(trifluoromethyl)-phenyl)ethylamine | Boc-2-hydroxy-2-(4-(trifluoromethyl)-phenyl)ethylamine | Boc-2-hydroxy-2-(4-chlorophenyl)-ethylamine | Boc-2-hydroxy-2-(4-chlorophenyl)-ethylamine | Boc-2-hydroxy-2-(4-fluorophenyl)-ethylamine | Boc-2-hydroxy-2-(4-fluorophenyl)-ethylamine | Boc-2-hydroxy-2-(4-methoxyphenyl)-ethylamine | Boc-2-hydroxy-2-(4-methoxyphenyl)-ethylamine | Boc-2-hydroxy-2-(4-methylphenyl)-ethylamine | Boc-2-hydroxy-2-(4-methylphenyl)-ethylamine | Boc-2-hydroxy-2-phenylethylamine | Boc-2-hydroxy-2-phenylethylamine | Boc-2-hydroxy-2-pyridylethylamine | Boc-2-hydroxy-2-pyridylethylamine | Boc-2-hydroxy-3-pyridylethylamine | Boc-2-hydroxy-3-pyridylethylamine | Boc-2-hydroxy-4-pyridylethylamine | Boc-2-hydroxy-4-pyridylethylamine | Boc-2-piperidylmethanol | Boc-2-piperidylmethanol | Boc-3-amino-1,1,1-trifluoro-2-propanol | Boc-3-amino-1,1,1-trifluoro-2-propanol | Boc-3-amino-1-propanol | Boc-3-amino-1-propanol | Boc-3-amino-3-phenylpropanol | Boc-3-amino-3-phenylpropanol | Boc-3-aminobenzylalcohol | Boc-3-aminobenzylalcohol | Boc-3-endo-hydroxymethylbicyclo-[2.2.1]hept-5-enyl-2-endo-amine | Boc-3-endo-hydroxymethylbicyclo-[2.2.1]hept-5-enyl-2-endo-amine | Boc-3-endo-hydroxymethylbicyclo-[2.2.1]heptyl-2-endo-amine | Boc-3-endo-hydroxymethylbicyclo-[2.2.1]heptyl-2-endo-amine | Boc-3-exo-hydroxymethylbicyclo-[2.2.1]hept-5-enyl-2-exo-amine | Boc-3-exo-hydroxymethylbicyclo-[2.2.1]hept-5-enyl-2-exo-amine | Boc-3-hydroxypiperidine | Boc-3-hydroxypiperidine | Boc-4-amino-2-butanol | Boc-4-amino-2-butanol | Boc-4-aminobenzylalcohol | Boc-4-aminobenzylalcohol | Boc-4-aminobutanol | Boc-4-aminobutanol | Boc-4-hydroxypiperidine | Boc-4-hydroxypiperidine | Boc-4-piperidylmethanol | Boc-4-piperidylmethanol | Boc-5-aminopentanol | Boc-5-aminopentanol | Boc-6-(aminomethyl)-2-pyridinemethanol | Boc-6-(aminomethyl)-2-pyridinemethanol | Boc-6-amino-2-methyl-2-heptanol | Boc-6-amino-2-methyl-2-heptanol | Boc-6-aminohexanol | Boc-6-aminohexanol | Boc-D-alaninol | Boc-D-alaninol | Boc-D-asparaginol | Boc-D-asparaginol | Boc-D-aspartimol β-benzyl ester | Boc-D-aspartimol β-benzyl ester | Boc-D-leucinol | Boc-D-leucinol | Boc-D-methioninol | Boc-D-methioninol | Boc-D-phenylalaninol | Boc-D-phenylalaninol | Boc-D-phenylglycinol | Boc-D-phenylglycinol | Boc-D-prolinol | Boc-D-prolinol | Boc-D-tryptophanol | Boc-D-tryptophanol | Boc-D-valinol | Boc-D-valinol | Boc-DL-4-chlorophenylalaninol | Boc-DL-4-chlorophenylalaninol | Boc-ethanolamine | Boc-ethanolamine | Boc-L-alaninol | Boc-L-alaninol | Boc-L-asparaginol | Boc-L-asparaginol | Boc-L-aspartimol β-benzyl ester | Boc-L-aspartimol β-benzyl ester | Boc-L-glutaminol | Boc-L-glutaminol | Boc-L-glutamol γ-benzyl ester | Boc-L-glutamol γ-benzyl ester | Boc-L-isoleucinol | Boc-L-isoleucinol | Boc-L-leucinol | Boc-L-leucinol | Boc-L-methioninol | Boc-L-methioninol | Boc-L-norleucinol | Boc-L-norleucinol | Boc-L-norvalinol | Boc-L-norvalinol | Boc-L-phenylalaninol | Boc-L-phenylalaninol | Boc-L-phenylglycinol | Boc-L-phenylglycinol | Boc-L-prolinol | Boc-L-prolinol | Boc-L-tert-leucinol | Boc-L-tert-leucinol | Boc-L-tryptophanol | Boc-L-tryptophanol | Boc-L-valinol | Boc-L-valinol | Boc-Nε-2-chlorobenzyloxycarbonyl-D-lysinol | Boc-Nε-2-chlorobenzyloxycarbonyl-D-lysinol | Boc-Nε-2-chlorobenzyloxycarbonyl-L-lysinol | Boc-Nε-2-chlorobenzyloxycarbonyl-L-lysinol | Boc-Nε-benzyloxycarbonyl-D-lysinol | Boc-Nε-benzyloxycarbonyl-D-lysinol | Boc-Nε-benzyloxycarbonyl-L-lysinol | Boc-Nε-benzyloxycarbonyl-L-lysinol | Boc-Nε-Fmoc-D-lysinol | Boc-Nε-Fmoc-D-lysinol | Boc-Nε-Fmoc-L-lysinol | Boc-Nε-Fmoc-L-lysinol | Boc-Nω-tosyl-L-argininol | Boc-Nω-tosyl-L-argininol | Boc-N-(2-hydroxyethyl)piperazine | Boc-N-(2-hydroxyethyl)piperazine | Boc-N-(3-hydroxypropyl)piperazine | Boc-N-(3-hydroxypropyl)piperazine | Boc-O-benzyl-D-serinol | Boc-O-benzyl-D-serinol | Boc-O-benzyl-D-threoninol | Boc-O-benzyl-D-threoninol | Boc-O-benzyl-D-tyrosinol | Boc-O-benzyl-D-tyrosinol | Boc-O-benzyl-L-serinol | Boc-O-benzyl-L-serinol | Boc-O-benzyl-L-threoninol | Boc-O-benzyl-L-threoninol | Boc-O-benzyl-L-tyrosinol | Boc-O-benzyl-L-tyrosinol | Boc-S-4-methylbenzyl-L-cysteinol | Boc-S-4-methylbenzyl-L-cysteinol | Boc-S-benzyl-D-cysteinol | Boc-S-benzyl-D-cysteinol | Boc-S-benzyl-L-cysteinol | Boc-S-benzyl-L-cysteinol | Boc-trans-2-aminocyclopentanol | Boc-trans-2-aminocyclopentanol | Boc-trans-4-aminocyclohexanol | Boc-trans-4-aminocyclohexanol | Di-Boc-1-N-(2-hydroxyethyl)-1,3-propanediamine | Di-Boc-1-N-(2-hydroxyethyl)-1,3-propanediamine | Di-Boc-2-(2-aminoethylamino) ethanol | Di-Boc-2-(2-aminoethylamino) ethanol | Di-Fmoc-1-N-(2-hydroxyethyl)-1,3-propanediamine | Di-Fmoc-1-N-(2-hydroxyethyl)-1,3-propanediamine | Di-Fmoc-2-(2-aminoethylamino) ethanol | Di-Fmoc-2-(2-aminoethylamino) ethanol | Fmoc-α-(1-aminoethyl)-4-hydroxy-benzyl alcohol | Fmoc-α-(1-aminoethyl)-4-hydroxy-benzyl alcohol | Fmoc-α-aminomethyl-3-hydroxy-benzyl alcohol | Fmoc-α-aminomethyl-3-hydroxy-benzyl alcohol | Fmoc-α-aminomethyl-4-hydroxy-3-methoxybenzyl alcohol | Fmoc-α-aminomethyl-4-hydroxy-3-methoxybenzyl alcohol | Fmoc-α-aminomethyl-4-hydroxy-benzyl alcohol | Fmoc-α-aminomethyl-4-hydroxy-benzyl alcohol | Fmoc-β-cyclohexyl-L-alaninol | Fmoc-β-cyclohexyl-L-alaninol | Fmoc-(±)-cis-2-aminocyclohexanol | Fmoc-(±)-cis-2-aminocyclohexanol | Fmoc-(±)-cis-2-aminomethyl-cyclooctanol | Fmoc-(±)-cis-2-aminomethyl-cyclooctanol | Fmoc-(±)-cis-2-aminomethylcyclo-heptanol | Fmoc-(±)-cis-2-aminomethylcyclo-heptanol | Fmoc-(±)-cis-2-aminomethylcyclo-hexanol | Fmoc-(±)-cis-2-aminomethylcyclo-hexanol | Fmoc-(±)-cis-2-hydroxymethyl-1-cyclohexylamine | Fmoc-(±)-cis-2-hydroxymethyl-1-cyclohexylamine | Fmoc-(±)-cis-2-hydroxymethyl-4-cyclohexenyl-1-amine | Fmoc-(±)-cis-2-hydroxymethyl-4-cyclohexenyl-1-amine | Fmoc-(±)-cis-2-hydroxymethyl-trans-4-phenyl-1-cyclohexylamine | Fmoc-(±)-cis-2-hydroxymethyl-trans-4-phenyl-1-cyclohexylamine | Fmoc-(±)-trans-2-aminocyclohexanol | Fmoc-(±)-trans-2-aminocyclohexanol | Fmoc-(±)-trans-2-aminomethylcyclo-hexanol | Fmoc-(±)-trans-2-aminomethylcyclo-hexanol | Fmoc-(±)-trans-2-hydroxymethyl-1-cyclohexylamine | Fmoc-(±)-trans-2-hydroxymethyl-1-cyclohexylamine | Fmoc-(1R,2R)-(+)-2-amino-1,2-diphenylethanol | Fmoc-(1R,2R)-(+)-2-amino-1,2-diphenylethanol | Fmoc-(1R,2R)-(-)-2-amino-1-(4-nitrophenyl)-1,3-propanediol | Fmoc-(1R,2R)-(-)-2-amino-1-(4-nitrophenyl)-1,3-propanediol | Fmoc-(1R,2R)-(-)-2-amino-1-phenyl-1,3-propanediol | Fmoc-(1R,2R)-(-)-2-amino-1-phenyl-1,3-propanediol | Fmoc-(1R,2S)-(+)-cis-1-amino-2-indanol | Fmoc-(1R,2S)-(+)-cis-1-amino-2-indanol | Fmoc-(1R,2S)-(-)-2-amino-1,2-diphenylethanol | Fmoc-(1R,2S)-(-)-2-amino-1,2-diphenylethanol | Fmoc-(1R,2S)-(-)-norephedrine | Fmoc-(1R,2S)-(-)-norephedrine | Fmoc-(1S,2R)-(+)-2-amino-1,2-diphenylethanol | Fmoc-(1S,2R)-(+)-2-amino-1,2-diphenylethanol | Fmoc-(1S,2R)-(+)-norephedrine | Fmoc-(1S,2R)-(+)-norephedrine | Fmoc-(1S,2R)-(-)-cis-1-amino-2-indanol | Fmoc-(1S,2R)-(-)-cis-1-amino-2-indanol | Fmoc-(1S,2S)-(+)-2-amino-1-(4-nitrophenyl)-1,3-propanediol | Fmoc-(1S,2S)-(+)-2-amino-1-(4-nitrophenyl)-1,3-propanediol | Fmoc-(1S,2S)-(+)-2-amino-1-phenyl-1,3-propanediol | Fmoc-(1S,2S)-(+)-2-amino-1-phenyl-1,3-propanediol | Fmoc-(1S,2S)-(+)-2-amino-3-methoxy-1-phenylpropanol | Fmoc-(1S,2S)-(+)-2-amino-3-methoxy-1-phenylpropanol | Fmoc-(R)-(-)-1-amino-2-propanol | Fmoc-(R)-(-)-1-amino-2-propanol | Fmoc-(R)-(-)-2-amino-1-phenylethanol | Fmoc-(R)-(-)-2-amino-1-phenylethanol | Fmoc-(R)-(-)-2-aminobutanol | Fmoc-(R)-(-)-2-aminobutanol | Fmoc-(R)-(-)-3-pyrrolidinol | Fmoc-(R)-(-)-3-pyrrolidinol | Fmoc-(RS)-3-amino-1,2-propanediol | Fmoc-(RS)-3-amino-1,2-propanediol | Fmoc-(S)-(+)-1-amino-2-propanol | Fmoc-(S)-(+)-1-amino-2-propanol | Fmoc-(S)-(+)-2-amino-1-phenylethanol | Fmoc-(S)-(+)-2-amino-1-phenylethanol | Fmoc-(S)-(+)-2-aminobutanol | Fmoc-(S)-(+)-2-aminobutanol | Fmoc-(S)-(+)-3-amino-1,2-propanediol | Fmoc-(S)-(+)-3-amino-1,2-propanediol | Fmoc-[1-(2-(aminomethyl)phenyl)-4-piperidinyl]methanol | Fmoc-[1-(2-(aminomethyl)phenyl)-4-piperidinyl]methanol | Fmoc-1,1-diphenyl-L-alaninol | Fmoc-1,1-diphenyl-L-alaninol | Fmoc-1-amino-3-phenoxy-2-propanol | Fmoc-1-amino-3-phenoxy-2-propanol | Fmoc-1-amino-3-phenylpropan-2-ol | Fmoc-1-amino-3-phenylpropan-2-ol | Fmoc-1-amino-4-(2-hydroxyethyl)-piperazine | Fmoc-1-amino-4-(2-hydroxyethyl)-piperazine | Fmoc-1-aminomethylcyclohexanol | Fmoc-1-aminomethylcyclohexanol | Fmoc-1-hydroxyethylethoxypiperazine | Fmoc-1-hydroxyethylethoxypiperazine | Fmoc-2-(2-aminoethoxy)ethanol | Fmoc-2-(2-aminoethoxy)ethanol | Fmoc-2-(2-aminophenyl)ethanol | Fmoc-2-(2-aminophenyl)ethanol | Fmoc-2-(2-piperidyl)-ethanol | Fmoc-2-(2-piperidyl)-ethanol | Fmoc-2-(4-aminophenyl)ethanol | Fmoc-2-(4-aminophenyl)ethanol | Fmoc-2-(4-piperidyl)-ethanol | Fmoc-2-(4-piperidyl)-ethanol | Fmoc-2-amino-1-(2-naphthyl)-1-ethanol | Fmoc-2-amino-1-(2-naphthyl)-1-ethanol | Fmoc-2-amino-2-ethyl-1,3-propanediol | Fmoc-2-amino-2-ethyl-1,3-propanediol | Fmoc-2-amino-2-methyl-1,3-propanediol | Fmoc-2-amino-2-methyl-1,3-propanediol | Fmoc-2-amino-2-methylpropanol | Fmoc-2-amino-2-methylpropanol | Fmoc-2-amino-5-chlorobenzylalcohol | Fmoc-2-amino-5-chlorobenzylalcohol | Fmoc-2-aminobenzylalcohol | Fmoc-2-aminobenzylalcohol | Fmoc-2-aminocyclopentanol | Fmoc-2-aminocyclopentanol | Fmoc-2-hydroxy-2-(2-chlorophenyl)-ethylamine | Fmoc-2-hydroxy-2-(2-chlorophenyl)-ethylamine | Fmoc-2-hydroxy-2-(2-methoxyphenyl)-ethylamine | Fmoc-2-hydroxy-2-(2-methoxyphenyl)-ethylamine | Fmoc-2-hydroxy-2-(2-methylphenyl)-ethylamine | Fmoc-2-hydroxy-2-(2-methylphenyl)-ethylamine | Fmoc-2-hydroxy-2-(3,4-dichlorophenyl)-ethylamine | Fmoc-2-hydroxy-2-(3,4-dichlorophenyl)-ethylamine | Fmoc-2-hydroxy-2-(3,5-dichlorophenyl)-ethylamine | Fmoc-2-hydroxy-2-(3,5-dichlorophenyl)-ethylamine | Fmoc-2-hydroxy-2-(3,5-dimethoxy-phenyl)ethylamine | Fmoc-2-hydroxy-2-(3,5-dimethoxy-phenyl)ethylamine | Fmoc-2-hydroxy-2-(4-(trifluoromethyl)-phenyl)ethylamine | Fmoc-2-hydroxy-2-(4-(trifluoromethyl)-phenyl)ethylamine | Fmoc-2-hydroxy-2-(4-chlorophenyl)-ethylamine | Fmoc-2-hydroxy-2-(4-chlorophenyl)-ethylamine | Fmoc-2-hydroxy-2-(4-fluorophenyl)-ethylamine | Fmoc-2-hydroxy-2-(4-fluorophenyl)-ethylamine | Fmoc-2-hydroxy-2-(4-methoxyphenyl)-ethylamine | Fmoc-2-hydroxy-2-(4-methoxyphenyl)-ethylamine | Fmoc-2-hydroxy-2-(4-methylphenyl)-ethylamine | Fmoc-2-hydroxy-2-(4-methylphenyl)-ethylamine | Fmoc-2-hydroxy-2-phenylethylamine | Fmoc-2-hydroxy-2-phenylethylamine | Fmoc-2-hydroxy-2-pyridylethylamine | Fmoc-2-hydroxy-2-pyridylethylamine | Fmoc-2-hydroxy-3-pyridylethylamine | Fmoc-2-hydroxy-3-pyridylethylamine | Fmoc-2-hydroxy-4-pyridylethylamine | Fmoc-2-hydroxy-4-pyridylethylamine | Fmoc-2-piperidylmethanol | Fmoc-2-piperidylmethanol | Fmoc-3-amino-1,1,1-trifluoro-2-propanol | Fmoc-3-amino-1,1,1-trifluoro-2-propanol | Fmoc-3-amino-1-propanol | Fmoc-3-amino-1-propanol | Fmoc-3-amino-3-phenylpropanol | Fmoc-3-amino-3-phenylpropanol | Fmoc-3-aminobenzylalcohol | Fmoc-3-aminobenzylalcohol | Fmoc-3-endo-hydroxymethylbicyclo-[2.2.1]hept-5-enyl-2-endo-amine | Fmoc-3-endo-hydroxymethylbicyclo-[2.2.1]hept-5-enyl-2-endo-amine | Fmoc-3-endo-hydroxymethylbicyclo-[2.2.1]heptyl-2-endo-amine | Fmoc-3-endo-hydroxymethylbicyclo-[2.2.1]heptyl-2-endo-amine | Fmoc-3-exo-hydroxymethylbicyclo-[2.2.1]hept-5-enyl-2-exo-amine | Fmoc-3-exo-hydroxymethylbicyclo-[2.2.1]hept-5-enyl-2-exo-amine | Fmoc-3-hydroxypiperidine | Fmoc-3-hydroxypiperidine | Fmoc-4-amino-2-butanol | Fmoc-4-amino-2-butanol | Fmoc-4-aminobenzylalcohol | Fmoc-4-aminobenzylalcohol | Fmoc-4-aminobutanol | Fmoc-4-aminobutanol | Fmoc-4-hydroxypiperidine | Fmoc-4-hydroxypiperidine | Fmoc-4-piperidylmethanol | Fmoc-4-piperidylmethanol | Fmoc-5-aminopentanol | Fmoc-5-aminopentanol | Fmoc-6-(aminomethyl)-2-pyridinemethanol | Fmoc-6-(aminomethyl)-2-pyridinemethanol | Fmoc-6-amino-2-methyl-2-heptanol | Fmoc-6-amino-2-methyl-2-heptanol | Fmoc-6-aminohexanol | Fmoc-6-aminohexanol | Fmoc-Arg(Pmc)-ol | Fmoc-Arg(Pmc)-ol | Fmoc-Arg(Tos)-ol | Fmoc-Arg(Tos)-ol | Fmoc-Cys(Acm)-ol | Fmoc-Cys(Acm)-ol | Fmoc-D-alaninol | Fmoc-D-alaninol | Fmoc-D-asparaginol | Fmoc-D-asparaginol | Fmoc-D-aspartimol β-t-butyl ester | Fmoc-D-aspartimol β-t-butyl ester | Fmoc-D-leucinol | Fmoc-D-leucinol | Fmoc-D-methioninol | Fmoc-D-methioninol | Fmoc-D-phenylalaninol | Fmoc-D-phenylalaninol | Fmoc-D-phenylglycinol | Fmoc-D-phenylglycinol | Fmoc-D-prolinol | Fmoc-D-prolinol | Fmoc-D-tryptophanol | Fmoc-D-tryptophanol | Fmoc-D-valinol | Fmoc-D-valinol | Fmoc-DL-4-chlorophenylalaninol | Fmoc-DL-4-chlorophenylalaninol | Fmoc-ethanolamine | Fmoc-ethanolamine | Fmoc-L-alaninol | Fmoc-L-alaninol | Fmoc-L-asparaginol | Fmoc-L-asparaginol | Fmoc-L-aspartimol β-benzyl ester | Fmoc-L-aspartimol β-benzyl ester | Fmoc-L-aspartimol β-t-butyl ester | Fmoc-L-aspartimol β-t-butyl ester | Fmoc-L-glutaminol | Fmoc-L-glutaminol | Fmoc-L-glutamol γ-benzyl ester | Fmoc-L-glutamol γ-benzyl ester | Fmoc-L-glutamol γ-t-butyl ester | Fmoc-L-glutamol γ-t-butyl ester | Fmoc-L-isoleucinol | Fmoc-L-isoleucinol | Fmoc-L-leucinol | Fmoc-L-leucinol | Fmoc-L-methioninol | Fmoc-L-methioninol | Fmoc-L-norleucinol | Fmoc-L-norleucinol | Fmoc-L-norvalinol | Fmoc-L-norvalinol | Fmoc-L-phenylalaninol | Fmoc-L-phenylalaninol | Fmoc-L-phenylglycinol | Fmoc-L-phenylglycinol | Fmoc-L-prolinol | Fmoc-L-prolinol | Fmoc-L-tert-leucinol | Fmoc-L-tert-leucinol | Fmoc-L-tryptophanol | Fmoc-L-tryptophanol | Fmoc-L-valinol | Fmoc-L-valinol | Fmoc-Nβ-trityl-D-asparaginol | Fmoc-Nβ-trityl-D-asparaginol | Fmoc-Nβ-trityl-L-asparaginol | Fmoc-Nβ-trityl-L-asparaginol | Fmoc-Nε-t-Boc-D-lysinol | Fmoc-Nε-t-Boc-D-lysinol | Fmoc-Nε-t-Boc-L-lysinol | Fmoc-Nε-t-Boc-L-lysinol | Fmoc-Nε-t-Fmoc-L-lysinol | Fmoc-Nε-t-Fmoc-L-lysinol | Fmoc-Nω-2,2,4,6,7-pentamethyldi-hydrobenzofuran-5-sulfonyl-L-argininol | Fmoc-Nω-2,2,4,6,7-pentamethyldi-hydrobenzofuran-5-sulfonyl-L-argininol | Fmoc-N-γ-trityl-L-glutaminol | Fmoc-N-γ-trityl-L-glutaminol | Fmoc-N-(2-hydroxyethyl)piperazine | Fmoc-N-(2-hydroxyethyl)piperazine | Fmoc-N-(3-hydroxypropyl)piperazine | Fmoc-N-(3-hydroxypropyl)piperazine | Fmoc-N-im-benzyl-L-histidinol | Fmoc-N-im-benzyl-L-histidinol | Fmoc-N-im-t-Boc-L-histidinol | Fmoc-N-im-t-Boc-L-histidinol | Fmoc-N-im-trityl-L-histidinol | Fmoc-N-im-trityl-L-histidinol | Fmoc-O-benzyl-D-serinol | Fmoc-O-benzyl-D-serinol | Fmoc-O-benzyl-D-tyrosinol | Fmoc-O-benzyl-D-tyrosinol | Fmoc-O-benzyl-L-serinol | Fmoc-O-benzyl-L-serinol | Fmoc-O-benzyl-L-tyrosinol | Fmoc-O-benzyl-L-tyrosinol | Fmoc-O-t-butyl-D-serinol | Fmoc-O-t-butyl-D-serinol | Fmoc-O-t-butyl-D-threoninol | Fmoc-O-t-butyl-D-threoninol | Fmoc-O-t-butyl-L-serinol | Fmoc-O-t-butyl-L-serinol | Fmoc-O-t-butyl-L-threoninol | Fmoc-O-t-butyl-L-threoninol | Fmoc-O-t-butyl-L-tyrosinol | Fmoc-O-t-butyl-L-tyrosinol | Fmoc-S-4-methoxybenzyl-L-cysteinol | Fmoc-S-4-methoxybenzyl-L-cysteinol | Fmoc-S-benzyl-L-cysteinol | Fmoc-S-benzyl-L-cysteinol | Fmoc-S-t-butyl-D-cysteinol | Fmoc-S-t-butyl-D-cysteinol | Fmoc-S-t-butyl-L-cysteinol | Fmoc-S-t-butyl-L-cysteinol | Fmoc-S-trityl-L-cysteinol | Fmoc-S-trityl-L-cysteinol | Fmoc-trans-2-aminocyclopentanol | Fmoc-trans-2-aminocyclopentanol | Fmoc-trans-4-aminocyclohexanol | Fmoc-trans-4-aminocyclohexanol | N-α-t-Boc-S-4-methoxybenzyl-L-cysteinol | N-α-t-Boc-S-4-methoxybenzyl-L-cysteinol |
| ClearPoint™-Heavy Isotope Labeled Amino Acids and Resins | Fmoc-Ala-OH (1-13C) | Fmoc-Ala-OH (1-13C) | Fmoc-Ala-OH (15N) | Fmoc-Ala-OH (15N) | Fmoc-Ala-OH (2-13C) | Fmoc-Ala-OH (2-13C) | Fmoc-Ala-OH (2-13C) | Fmoc-Ala-OH (3-13C) | Fmoc-Ala-OH (3-13C) | Fmoc-Ala-OH (U-13C3, U-15N) | Fmoc-Ala-OH (U-13C3, U-15N) | Fmoc-Arg(Pbf)-HMP resin, U-13C6, U-15N4 labeled | Fmoc-Asn(Trt)-OH (U-13C4, U-15N2) | Fmoc-Asn(Trt)-OH (U-13C4, U-15N2) | Fmoc-Asp(OtBu)-OH (U-13 C4, 15N) | Fmoc-Asp(OtBu)-OH (U-13C4, 15N) | Fmoc-Cys(Trt)-OH (U-13C3, 15N) | Fmoc-Cys(Trt)-OH (U-13C3, 15N) | Fmoc-Gln(Trt)-OH (U-13C5, U-15N2) | Fmoc-Gln(Trt)-OH (U-13C5, U-15N2) | Fmoc-Glu(OtBu)-OH (U-13C5, 15N) | Fmoc-Glu(OtBu)-OH (U-13C5, 15N) | Fmoc-Gly-OH (1-13C) | Fmoc-Gly-OH (1-13C) | Fmoc-Gly-OH (15N) | Fmoc-Gly-OH (15N) | Fmoc-Gly-OH (2-13C) | Fmoc-Gly-OH (2-13C) | Fmoc-Gly-OH (U-13C2, 15N) | Fmoc-Gly-OH (U-13C2, 15N) | Fmoc-Ile-OH (1-13C) | Fmoc-Ile-OH (1-13C) | Fmoc-Ile-OH (15N) | Fmoc-Ile-OH (15N) | Fmoc-Ile-OH (U-13 C6) | Fmoc-Ile-OH (U-13C6) | Fmoc-Ile-OH (U-13C6, 15N) | Fmoc-Ile-OH (U-13C6, 15N) | Fmoc-Leu-OH (1-13C) | Fmoc-Leu-OH (1-13C) | Fmoc-Leu-OH (15N) | Fmoc-Leu-OH (15N) | Fmoc-Leu-OH (2-13C) | Fmoc-Leu-OH (2-13C) | Fmoc-Leu-OH (2-13C) | Fmoc-Leu-OH (U-13C6 , 15N) | Fmoc-Leu-OH (U-13C6) | Fmoc-Leu-OH (U-13C6) | Fmoc-Lys(Boc)-HMP resin, U-13C6, U-15N2 labeled | Fmoc-Lys(Boc)-OH (1-13C) | Fmoc-Lys(Boc)-OH (1-13C) | Fmoc-Lys(Boc)-OH (Alpha-15N) | Fmoc-Lys(Boc)-OH (Alpha-15N) | Fmoc-Lys(Boc)-OH (U-13C6) | Fmoc-Lys(Boc)-OH (U-13C6) | Fmoc-Lys(Boc)-OH (U-13C6, U-15N2) | Fmoc-Met-OH (1-13C) | Fmoc-Met-OH (1-13C) | Fmoc-Met-OH (1-13C) | Fmoc-Met-OH (15N) | Fmoc-Met-OH (15N) | Fmoc-Met-OH (15N) | Fmoc-Met-OH (U-13C5 ) | Fmoc-Met-OH (U-13C5) | Fmoc-Met-OH (U-13C5, 15N) | Fmoc-Phe-OH (1-13C) | Fmoc-Phe-OH (1-13C) | Fmoc-Phe-OH (1-13C) | Fmoc-Phe-OH (15N) | Fmoc-Phe-OH (15N) | Fmoc-Phe-OH (2-13C) | Fmoc-Phe-OH (2-13C) | Fmoc-Phe-OH (2-13C) | Fmoc-Phe-OH (3-13C) | Fmoc-Phe-OH (3-13C) | Fmoc-Phe-OH (3-13C) | Fmoc-Phe-OH (Ring-13C6) | Fmoc-Phe-OH (Ring-13C6) | Fmoc-Phe-OH (Ring-13C6) | Fmoc-Phe-OH (U-13C9) | Fmoc-Phe-OH (U-13C9) | Fmoc-Phe-OH (U-13C9) | Fmoc-Phe-OH (U-13C9,15N) | Fmoc-Phe-OH (U-13C9,15N) | Fmoc-Pro-OH (1-13C) | Fmoc-Pro-OH (1-13C) | Fmoc-Pro-OH (15 N) | Fmoc-Pro-OH (15 N) | Fmoc-Pro-OH (U-13C5) | Fmoc-Pro-OH (U-13C5) | Fmoc-Pro-OH (U-13C5, 15N) | Fmoc-Ser(OtBu)-OH (1-13C) | Fmoc-Ser(OtBu)-OH (1-13C) | Fmoc-Ser(OtBu)-OH (15N) | Fmoc-Ser(OtBu)-OH (15N) | Fmoc-Ser(OtBu)-OH (2-13C) | Fmoc-Ser(OtBu)-OH (2-13C) | Fmoc-Ser(OtBu)-OH (3-13C) | Fmoc-Ser(OtBu)-OH (3-13C) | Fmoc-Ser(OtBu)-OH (U-13C3, 15N) | Fmoc-Ser(OtBu)-OH (U-13C3, 15N) | Fmoc-Thr(OtBu)-OH (15N) | Fmoc-Thr(OtBu)-OH (U-13C4 , 15N) | Fmoc-Tyr(tBu)-OH (U-13C9, 15N) | Fmoc-Val-OH (1-13C) | Fmoc-Val-OH (1-13C) | Fmoc-Val-OH (15N) | Fmoc-Val-OH (15N) | Fmoc-Val-OH (D8) | Fmoc-Val-OH (D8) | Fmoc-Val-OH (D8, 15N) | Fmoc-Val-OH (D8, 15N) | Fmoc-Val-OH (U-13C5) | Fmoc-Val-OH (U-13C5) | Fmoc-Val-OH (U-13C5, 15N) |
| Standard Amino Acids | Amino Acids - Ala | Boc-Ala-OH | Boc-Ala-OH | Boc-Ala-OH | Boc-D-Ala-OH | Boc-D-Ala-OH | Boc-D-Ala-OH | Fmoc-Ala-OH | Fmoc-Ala-OH | Fmoc-Ala-OH | Fmoc-Ala-OH | Fmoc-Ala-OH | Fmoc-Ala-OH (1-13C) | Fmoc-Ala-OH (1-13C) | Fmoc-Ala-OH (15N) | Fmoc-Ala-OH (15N) | Fmoc-Ala-OH (2,3,3,3-D4) | Fmoc-Ala-OH (2,3,3,3-D4) | Fmoc-Ala-OH (2-13C) | Fmoc-Ala-OH (2-13C) | Fmoc-Ala-OH (2-13C) | Fmoc-Ala-OH (3,3,3-D3) | Fmoc-Ala-OH (3,3,3-D3) | Fmoc-Ala-OH (3-13C) | Fmoc-Ala-OH (3-13C) | Fmoc-Ala-OH (U-13C3, U-15N) | Fmoc-Ala-OH (U-13C3, U-15N) | Fmoc-D-Ala-OH | Fmoc-D-Ala-OH | H-Ala-OH | H-Ala-OH | H-D-Ala-OH | H-D-Ala-OH | H-D-Ala-OH |
| Amino Acids - Arg | | Amino Acids - Asn | | Amino Acids - Asp | | Amino Acids - Cys | | Amino Acids - Gln | | Amino Acids - Glu | | Amino Acids - Gly | | Amino Acids - His | | Amino Acids - Ile | | Amino Acids - Leu | | Amino Acids - Lys | | Amino Acids - Met | | Amino Acids - Phe | | Amino Acids - Pro | | Amino Acids - Ser | | Amino Acids - Thr | | Amino Acids - Trp | | Amino Acids - Tyr | | Amino Acids - Val | | ClearPoint™-Heavy Isotope Labeled Amino Acids | Fmoc-Ala-OH (1-13C) | Fmoc-Ala-OH (1-13C) | Fmoc-Ala-OH (15N) | Fmoc-Ala-OH (15N) | Fmoc-Ala-OH (2-13C) | Fmoc-Ala-OH (2-13C) | Fmoc-Ala-OH (2-13C) | Fmoc-Ala-OH (3-13C) | Fmoc-Ala-OH (3-13C) | Fmoc-Ala-OH (U-13C3, U-15N) | Fmoc-Ala-OH (U-13C3, U-15N) | Fmoc-Asn(Trt)-OH (U-13C4, U-15N2) | Fmoc-Asn(Trt)-OH (U-13C4, U-15N2) | Fmoc-Asp(OtBu)-OH (U-13 C4, 15N) | Fmoc-Asp(OtBu)-OH (U-13C4, 15N) | Fmoc-Cys(Trt)-OH (U-13C3, 15N) | Fmoc-Cys(Trt)-OH (U-13C3, 15N) | Fmoc-Gln(Trt)-OH (U-13C5, U-15N2) | Fmoc-Gln(Trt)-OH (U-13C5, U-15N2) | Fmoc-Glu(OtBu)-OH (U-13C5, 15N) | Fmoc-Glu(OtBu)-OH (U-13C5, 15N) | Fmoc-Ile-OH (1-13C) | Fmoc-Ile-OH (1-13C) | Fmoc-Ile-OH (15N) | Fmoc-Ile-OH (15N) | Fmoc-Ile-OH (U-13 C6) | Fmoc-Ile-OH (U-13C6) | Fmoc-Ile-OH (U-13C6, 15N) | Fmoc-Ile-OH (U-13C6, 15N) | Fmoc-Leu-OH (1-13C) | Fmoc-Leu-OH (1-13C) | Fmoc-Leu-OH (15N) | Fmoc-Leu-OH (15N) | Fmoc-Leu-OH (2-13C) | Fmoc-Leu-OH (2-13C) | Fmoc-Leu-OH (2-13C) | Fmoc-Leu-OH (U-13C6 , 15N) | Fmoc-Leu-OH (U-13C6) | Fmoc-Leu-OH (U-13C6) | Fmoc-Lys(Boc)-OH (1-13C) | Fmoc-Lys(Boc)-OH (1-13C) | Fmoc-Lys(Boc)-OH (Alpha-15N) | Fmoc-Lys(Boc)-OH (Alpha-15N) | Fmoc-Lys(Boc)-OH (U-13C6) | Fmoc-Lys(Boc)-OH (U-13C6) | Fmoc-Lys(Boc)-OH (U-13C6, U-15N2) | Fmoc-Met-OH (1-13C) | Fmoc-Met-OH (1-13C) | Fmoc-Met-OH (1-13C) | Fmoc-Met-OH (15N) | Fmoc-Met-OH (15N) | Fmoc-Met-OH (15N) | Fmoc-Met-OH (U-13C5 ) | Fmoc-Met-OH (U-13C5) | Fmoc-Met-OH (U-13C5, 15N) | Fmoc-Phe-OH (1-13C) | Fmoc-Phe-OH (1-13C) | Fmoc-Phe-OH (1-13C) | Fmoc-Phe-OH (15N) | Fmoc-Phe-OH (15N) | Fmoc-Phe-OH (2-13C) | Fmoc-Phe-OH (2-13C) | Fmoc-Phe-OH (2-13C) | Fmoc-Phe-OH (3-13C) | Fmoc-Phe-OH (3-13C) | Fmoc-Phe-OH (3-13C) | Fmoc-Phe-OH (Ring-13C6) | Fmoc-Phe-OH (Ring-13C6) | Fmoc-Phe-OH (Ring-13C6) | Fmoc-Phe-OH (U-13C9) | Fmoc-Phe-OH (U-13C9) | Fmoc-Phe-OH (U-13C9) | Fmoc-Phe-OH (U-13C9,15N) | Fmoc-Phe-OH (U-13C9,15N) | Fmoc-Pro-OH (1-13C) | Fmoc-Pro-OH (1-13C) | Fmoc-Pro-OH (15 N) | Fmoc-Pro-OH (15 N) | Fmoc-Pro-OH (U-13C5) | Fmoc-Pro-OH (U-13C5) | Fmoc-Pro-OH (U-13C5, 15N) | Fmoc-Ser(OtBu)-OH (1-13C) | Fmoc-Ser(OtBu)-OH (1-13C) | Fmoc-Ser(OtBu)-OH (15N) | Fmoc-Ser(OtBu)-OH (15N) | Fmoc-Ser(OtBu)-OH (2-13C) | Fmoc-Ser(OtBu)-OH (2-13C) | Fmoc-Ser(OtBu)-OH (3-13C) | Fmoc-Ser(OtBu)-OH (3-13C) | Fmoc-Ser(OtBu)-OH (U-13C3, 15N) | Fmoc-Ser(OtBu)-OH (U-13C3, 15N) | Fmoc-Thr(OtBu)-OH (15N) | Fmoc-Thr(OtBu)-OH (U-13C4 , 15N) | Fmoc-Tyr(tBu)-OH (U-13C9, 15N) | Fmoc-Val-OH (1-13C) | Fmoc-Val-OH (1-13C) | Fmoc-Val-OH (15N) | Fmoc-Val-OH (15N) | Fmoc-Val-OH (D8) | Fmoc-Val-OH (D8) | Fmoc-Val-OH (D8, 15N) | Fmoc-Val-OH (D8, 15N) | Fmoc-Val-OH (U-13C5) | Fmoc-Val-OH (U-13C5) | Fmoc-Val-OH (U-13C5, 15N) |
|
| Unusual Amino Acids | β-Amino Acids | Boc-β -alanine | Boc-β -alanine | Boc-(R)-β-phenylalanine | Boc-(R)-β-phenylalanine | Boc-(R)-1,2,3,4-tetrahydro-isoquinoline-3-acetic acid | Boc-(R)-1,2,3,4-tetrahydro-isoquinoline-3-acetic acid | Boc-(R)-3-amino-4-(1-naphthyl)-butyric acid | Boc-(R)-3-amino-4-(1-naphthyl)-butyric acid | Boc-(R)-3-amino-4-(2,4-dichlorophenyl)butyric acid | Boc-(R)-3-amino-4-(2,4-dichlorophenyl)butyric acid | Boc-(R)-3-amino-4-(2-chlorophenyl)-butyric acid | Boc-(R)-3-amino-4-(2-chlorophenyl)-butyric acid | Boc-(R)-3-amino-4-(2-cyanophenyl)-butyric acid | Boc-(R)-3-amino-4-(2-cyanophenyl)-butyric acid | Boc-(R)-3-amino-4-(2-fluorophenyl)-butyric acid | Boc-(R)-3-amino-4-(2-fluorophenyl)-butyric acid | Boc-(R)-3-amino-4-(2-furyl)-butyric acid | Boc-(R)-3-amino-4-(2-furyl)-butyric acid | Boc-(R)-3-amino-4-(2-methylphenyl)-butyric acid | Boc-(R)-3-amino-4-(2-methylphenyl)-butyric acid | Boc-(R)-3-amino-4-(2-naphthyl)-butyric acid | Boc-(R)-3-amino-4-(2-naphthyl)-butyric acid | Boc-(R)-3-amino-4-(2-thienyl)-butyric acid | Boc-(R)-3-amino-4-(2-thienyl)-butyric acid | Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid | Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid | Boc-(R)-3-amino-4-(3,4-dichlorophenyl)butyric acid | Boc-(R)-3-amino-4-(3,4-dichlorophenyl)butyric acid | Boc-(R)-3-amino-4-(3,4-difluorophenyl)butyric acid | Boc-(R)-3-amino-4-(3,4-difluorophenyl)butyric acid | Boc-(R)-3-amino-4-(3-benzothienyl)-butyric acid | Boc-(R)-3-amino-4-(3-benzothienyl)-butyric acid | Boc-(R)-3-amino-4-(3-chlorophenyl)-butyric acid | Boc-(R)-3-amino-4-(3-chlorophenyl)-butyric acid | Boc-(R)-3-amino-4-(3-cyanophenyl)-butyric acid | Boc-(R)-3-amino-4-(3-cyanophenyl)-butyric acid | Boc-(R)-3-amino-4-(3-fluorophenyl)-butyric acid | Boc-(R)-3-amino-4-(3-fluorophenyl)-butyric acid | Boc-(R)-3-amino-4-(3-methylphenyl)-butyric acid | Boc-(R)-3-amino-4-(3-methylphenyl)-butyric acid | Boc-(R)-3-amino-4-(3-pyridyl)-butyric acid | Boc-(R)-3-amino-4-(3-pyridyl)-butyric acid | Boc-(R)-3-amino-4-(3-thienyl)-butyric acid | Boc-(R)-3-amino-4-(3-thienyl)-butyric acid | Boc-(R)-3-amino-4-(3-trifluoromethylphenyl)-butyric acid | Boc-(R)-3-amino-4-(3-trifluoromethylphenyl)-butyric acid | Boc-(R)-3-amino-4-(4-bromophenyl)-butyric acid | Boc-(R)-3-amino-4-(4-bromophenyl)-butyric acid | Boc-(R)-3-amino-4-(4-chlorophenyl)-butyric acid | Boc-(R)-3-amino-4-(4-chlorophenyl)-butyric acid | Boc-(R)-3-amino-4-(4-cyanophenyl)-butyric acid | Boc-(R)-3-amino-4-(4-cyanophenyl)-butyric acid | Boc-(R)-3-amino-4-(4-fluorophenyl)-butyric acid | Boc-(R)-3-amino-4-(4-fluorophenyl)-butyric acid | Boc-(R)-3-amino-4-(4-iodophenyl)-butyric acid | Boc-(R)-3-amino-4-(4-iodophenyl)-butyric acid | Boc-(R)-3-amino-4-(4-methylphenyl)-butyric acid | Boc-(R)-3-amino-4-(4-methylphenyl)-butyric acid | Boc-(R)-3-amino-4-(4-nitrophenyl)-butyric acid | Boc-(R)-3-amino-4-(4-nitrophenyl)-butyric acid | Boc-(R)-3-amino-4-(4-pyridyl)-butyric acid | Boc-(R)-3-amino-4-(4-pyridyl)-butyric acid | Boc-(R)-3-amino-4-(4-trifluoromethylphenyl)-butyric acid | Boc-(R)-3-amino-4-(4-trifluoromethylphenyl)-butyric acid | Boc-(R)-3-amino-4-pentafluoro-phenylbutyric acid | Boc-(R)-3-amino-4-pentafluoro-phenylbutyric acid | Boc-(R)-3-amino-5-hexenoic acid | Boc-(R)-3-amino-5-hexenoic acid | Boc-(R)-3-amino-5-hexynoic acid | Boc-(R)-3-amino-5-hexynoic acid | Boc-(R)-3-amino-5-phenylpentanoic acid | Boc-(R)-3-amino-5-phenylpentanoic acid | Boc-(R)-3-amino-6-phenyl-5-hexenoic acid | Boc-(R)-3-amino-6-phenyl-5-hexenoic acid | Boc-(S)-1,2,3,4-tetrahydro-isoquinoline-3-acetic acid | Boc-(S)-1,2,3,4-tetrahydro-isoquinoline-3-acetic acid | Boc-(S)-3-amino-4-(1-naphthyl)-butyric acid | Boc-(S)-3-amino-4-(1-naphthyl)-butyric acid | Boc-(S)-3-amino-4-(2,4-dichlorophenyl)butyric acid | Boc-(S)-3-amino-4-(2,4-dichlorophenyl)butyric acid | Boc-(S)-3-amino-4-(2-chlorophenyl)-butyric acid | Boc-(S)-3-amino-4-(2-chlorophenyl)-butyric acid | Boc-(S)-3-amino-4-(2-cyanophenyl)-butyric acid | Boc-(S)-3-amino-4-(2-cyanophenyl)-butyric acid | Boc-(S)-3-amino-4-(2-fluorophenyl)-butyric acid | Boc-(S)-3-amino-4-(2-fluorophenyl)-butyric acid | Boc-(S)-3-amino-4-(2-furyl)-butyric acid | Boc-(S)-3-amino-4-(2-furyl)-butyric acid | Boc-(S)-3-amino-4-(2-methylphenyl)-butyric acid | Boc-(S)-3-amino-4-(2-methylphenyl)-butyric acid | Boc-(S)-3-amino-4-(2-naphthyl)-butyric acid | Boc-(S)-3-amino-4-(2-naphthyl)-butyric acid | Boc-(S)-3-amino-4-(2-thienyl)-butyric acid | Boc-(S)-3-amino-4-(2-thienyl)-butyric acid | Boc-(S)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid | Boc-(S)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid | Boc-(S)-3-amino-4-(3,4-dichlorophenyl)butyric acid | Boc-(S)-3-amino-4-(3,4-dichlorophenyl)butyric acid | Boc-(S)-3-amino-4-(3,4-difluorophenyl)butyric acid | Boc-(S)-3-amino-4-(3,4-difluorophenyl)butyric acid | Boc-(S)-3-amino-4-(3-benzothienyl)-butyric acid | Boc-(S)-3-amino-4-(3-benzothienyl)-butyric acid | Boc-(S)-3-amino-4-(3-chlorophenyl)-butyric acid | Boc-(S)-3-amino-4-(3-chlorophenyl)-butyric acid | Boc-(S)-3-amino-4-(3-cyanophenyl)-butyric acid | Boc-(S)-3-amino-4-(3-cyanophenyl)-butyric acid | Boc-(S)-3-amino-4-(3-fluorophenyl)-butyric acid | Boc-(S)-3-amino-4-(3-fluorophenyl)-butyric acid | Boc-(S)-3-amino-4-(3-methylphenyl)-butyric acid | Boc-(S)-3-amino-4-(3-methylphenyl)-butyric acid | Boc-(S)-3-amino-4-(3-pyridyl)-butyric acid | Boc-(S)-3-amino-4-(3-pyridyl)-butyric acid | Boc-(S)-3-amino-4-(3-thienyl)-butyric acid | Boc-(S)-3-amino-4-(3-thienyl)-butyric acid | Boc-(S)-3-amino-4-(3-trifluoromethylphenyl)-butyric acid | Boc-(S)-3-amino-4-(3-trifluoromethylphenyl)-butyric acid | Boc-(S)-3-amino-4-(4-bromophenyl)-butyric acid | Boc-(S)-3-amino-4-(4-bromophenyl)-butyric acid | Boc-(S)-3-amino-4-(4-chlorophenyl)-butyric acid | Boc-(S)-3-amino-4-(4-chlorophenyl)-butyric acid | Boc-(S)-3-amino-4-(4-cyanophenyl)-butyric acid | Boc-(S)-3-amino-4-(4-cyanophenyl)-butyric acid | Boc-(S)-3-amino-4-(4-fluorophenyl)-butyric acid | Boc-(S)-3-amino-4-(4-fluorophenyl)-butyric acid | Boc-(S)-3-amino-4-(4-iodophenyl)-butyric acid | Boc-(S)-3-amino-4-(4-iodophenyl)-butyric acid | Boc-(S)-3-amino-4-(4-methylphenyl)-butyric acid | Boc-(S)-3-amino-4-(4-methylphenyl)-butyric acid | Boc-(S)-3-amino-4-(4-nitrophenyl)-butyric acid | Boc-(S)-3-amino-4-(4-nitrophenyl)-butyric acid | Boc-(S)-3-amino-4-(4-pyridyl)-butyric acid | Boc-(S)-3-amino-4-(4-pyridyl)-butyric acid | Boc-(S)-3-amino-4-(4-trifluoromethylphenyl)-butyric acid | Boc-(S)-3-amino-4-(4-trifluoromethylphenyl)-butyric acid | Boc-(S)-3-amino-4-pentafluoro-phenylbutyric acid | Boc-(S)-3-amino-4-pentafluoro-phenylbutyric acid | Boc-(S)-3-amino-5-hexenoic acid | Boc-(S)-3-amino-5-hexenoic acid | Boc-(S)-3-amino-5-hexynoic acid | Boc-(S)-3-amino-5-hexynoic acid | Boc-(S)-3-amino-5-phenylpentanoic acid | Boc-(S)-3-amino-5-phenylpentanoic acid | Boc-(S)-3-amino-6-phenyl-5-hexenoic acid | Boc-(S)-3-amino-6-phenyl-5-hexenoic acid | Boc-1,2,5,6-tetrahydropyridine-3-carboxylic acid | Boc-1,2,5,6-tetrahydropyridine-3-carboxylic acid | Boc-1,2,5,6-tetrahydropyridine-4-carboxylic acid | Boc-1,2,5,6-tetrahydropyridine-4-carboxylic acid | Boc-3-amino-3-(2-chlorophenyl)-propionic acid | Boc-3-amino-3-(2-chlorophenyl)-propionic acid | Boc-3-amino-3-(2-thienyl)-propionic acid | Boc-3-amino-3-(2-thienyl)-propionic acid | Boc-3-amino-3-(3-bromophenyl)-propionic acid | Boc-3-amino-3-(3-bromophenyl)-propionic acid | Boc-3-amino-3-(4-chlorophenyl)-propionic acid | Boc-3-amino-3-(4-chlorophenyl)-propionic acid | Boc-3-amino-3-(4-methoxyphenyl)-propionic acid | Boc-3-amino-3-(4-methoxyphenyl)-propionic acid | Boc-3-amino-4,4,4-trifluoro-butyric acid | Boc-3-amino-4,4,4-trifluoro-butyric acid | Boc-3-amino-4,4,4-trifluoro-butyric acid | Boc-3-aminoadipic acid | Boc-3-aminoadipic acid | Boc-D-β-phenylalanine | Boc-D-β-phenylalanine | Boc-DL-β-leucine | Boc-DL-β-leucine | Boc-L-β-homoalanine | Boc-L-β-homoalanine | Boc-L-β-homoaspartic acid γ-benzyl ester | Boc-L-β-homoaspartic acid γ-benzyl ester | Boc-L-β-homoglutamic acid δ-benzyl ester | Boc-L-β-homoglutamic acid δ-benzyl ester | Boc-L-β-homoisoleucine | Boc-L-β-homoisoleucine | Boc-L-β-homoleucine | Boc-L-β-homoleucine | Boc-L-β-homomethionine | Boc-L-β-homomethionine | Boc-L-β-homophenylalanine | Boc-L-β-homophenylalanine | Boc-L-β-homoproline | Boc-L-β-homoproline | Boc-L-β-homotryptophan | Boc-L-β-homotryptophan | Boc-L-β-homovaline | Boc-L-β-homovaline | Boc-L-Nω-benzyloxycarbonyl-β-homolysine | Boc-L-Nω-benzyloxycarbonyl-β-homolysine | Boc-Nω-tosyl-L-β-homoarginine | Boc-Nω-tosyl-L-β-homoarginine | Boc-O-benzyl-L-β-homohydroxyproline | Boc-O-benzyl-L-β-homohydroxyproline | Boc-O-benzyl-L-β-homoserine | Boc-O-benzyl-L-β-homoserine | Boc-O-benzyl-L-β-homothreonine | Boc-O-benzyl-L-β-homothreonine | Boc-O-benzyl-L-β-homotyrosine | Boc-O-benzyl-L-β-homotyrosine | Fmoc-β-alanine | Fmoc-β-alanine | Fmoc-β-alanine | Fmoc-γ-trityl-L-β-homoasparagine | Fmoc-γ-trityl-L-β-homoasparagine | Fmoc-(R)-β-phenylalanine | Fmoc-(R)-β-phenylalanine | Fmoc-(R)-1,2,3,4-tetrahydro-isoquinoline-3-acetic acid | Fmoc-(R)-1,2,3,4-tetrahydro-isoquinoline-3-acetic acid | Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid | Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid | Fmoc-(R)-3-amino-4-(2,4-dichlorophenyl)butyric acid | Fmoc-(R)-3-amino-4-(2,4-dichlorophenyl)butyric acid | Fmoc-(R)-3-amino-4-(2-chlorophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(2-chlorophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(2-cyanophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(2-cyanophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(2-fluorophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(2-fluorophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(2-furyl)-butyric acid | Fmoc-(R)-3-amino-4-(2-furyl)-butyric acid | Fmoc-(R)-3-amino-4-(2-methylphenyl)-butyric acid | Fmoc-(R)-3-amino-4-(2-methylphenyl)-butyric acid | Fmoc-(R)-3-amino-4-(2-naphthyl)-butyric acid | Fmoc-(R)-3-amino-4-(2-naphthyl)-butyric acid | Fmoc-(R)-3-amino-4-(2-thienyl)-butyric acid | Fmoc-(R)-3-amino-4-(2-thienyl)-butyric acid | Fmoc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid | Fmoc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid | Fmoc-(R)-3-amino-4-(3,4-dichlorophenyl)butyric acid | Fmoc-(R)-3-amino-4-(3,4-dichlorophenyl)butyric acid | Fmoc-(R)-3-amino-4-(3,4-difluorophenyl)butyric acid | Fmoc-(R)-3-amino-4-(3,4-difluorophenyl)butyric acid | Fmoc-(R)-3-amino-4-(3-benzothienyl)-butyric acid | Fmoc-(R)-3-amino-4-(3-benzothienyl)-butyric acid | Fmoc-(R)-3-amino-4-(3-chlorophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(3-chlorophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(3-cyanophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(3-cyanophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(3-fluorophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(3-fluorophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(3-methylphenyl)-butyric acid | Fmoc-(R)-3-amino-4-(3-methylphenyl)-butyric acid | Fmoc-(R)-3-amino-4-(3-pyridyl)-butyric acid | Fmoc-(R)-3-amino-4-(3-pyridyl)-butyric acid | Fmoc-(R)-3-amino-4-(3-thienyl)-butyric acid | Fmoc-(R)-3-amino-4-(3-thienyl)-butyric acid | Fmoc-(R)-3-amino-4-(3-trifluoromethylphenyl)-butyric acid | Fmoc-(R)-3-amino-4-(3-trifluoromethylphenyl)-butyric acid | Fmoc-(R)-3-amino-4-(4-bromophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(4-bromophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(4-chlorophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(4-chlorophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(4-cyanophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(4-cyanophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(4-fluorophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(4-fluorophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(4-iodophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(4-iodophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(4-methylphenyl)-butyric acid | Fmoc-(R)-3-amino-4-(4-methylphenyl)-butyric acid | Fmoc-(R)-3-amino-4-(4-nitrophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(4-nitrophenyl)-butyric acid | Fmoc-(R)-3-amino-4-(4-pyridyl)-butyric acid | Fmoc-(R)-3-amino-4-(4-pyridyl)-butyric acid | Fmoc-(R)-3-amino-4-(4-trifluoromethylphenyl)-butyric acid | Fmoc-(R)-3-amino-4-(4-trifluoromethylphenyl)-butyric acid | Fmoc-(R)-3-amino-4-pentafluoro-phenylbutyric acid | Fmoc-(R)-3-amino-4-pentafluoro-phenylbutyric acid | Fmoc-(R)-3-amino-5-hexenoic acid | Fmoc-(R)-3-amino-5-hexenoic acid | Fmoc-(R)-3-amino-5-hexynoic acid | Fmoc-(R)-3-amino-5-hexynoic acid | Fmoc-(R)-3-amino-5-phenylpentanoic acid | Fmoc-(R)-3-amino-5-phenylpentanoic acid | Fmoc-(R)-3-amino-6-phenyl-5-hexenoic acid | Fmoc-(R)-3-amino-6-phenyl-5-hexenoic acid | Fmoc-(S)-1,2,3,4-tetrahydro-isoquinoline-3-acetic acid | Fmoc-(S)-1,2,3,4-tetrahydro-isoquinoline-3-acetic acid | Fmoc-(S)-3-amino-4-(1-naphthyl)-butyric acid | Fmoc-(S)-3-amino-4-(1-naphthyl)-butyric acid | Fmoc-(S)-3-amino-4-(2,4-dichlorophenyl)butyric acid | Fmoc-(S)-3-amino-4-(2,4-dichlorophenyl)butyric acid | Fmoc-(S)-3-amino-4-(2-chlorophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(2-chlorophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(2-cyanophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(2-cyanophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(2-fluorophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(2-fluorophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(2-furyl)-butyric acid | Fmoc-(S)-3-amino-4-(2-furyl)-butyric acid | Fmoc-(S)-3-amino-4-(2-methylphenyl)-butyric acid | Fmoc-(S)-3-amino-4-(2-methylphenyl)-butyric acid | Fmoc-(S)-3-amino-4-(2-naphthyl)-butyric acid | Fmoc-(S)-3-amino-4-(2-naphthyl)-butyric acid | Fmoc-(S)-3-amino-4-(2-thienyl)-butyric acid | Fmoc-(S)-3-amino-4-(2-thienyl)-butyric acid | Fmoc-(S)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid | Fmoc-(S)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid | Fmoc-(S)-3-amino-4-(3,4-dichlorophenyl)butyric acid | Fmoc-(S)-3-amino-4-(3,4-dichlorophenyl)butyric acid | Fmoc-(S)-3-amino-4-(3,4-difluorophenyl)butyric acid | Fmoc-(S)-3-amino-4-(3,4-difluorophenyl)butyric acid | Fmoc-(S)-3-amino-4-(3-benzothienyl)-butyric acid | Fmoc-(S)-3-amino-4-(3-benzothienyl)-butyric acid | Fmoc-(S)-3-amino-4-(3-chlorophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(3-chlorophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(3-cyanophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(3-cyanophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(3-fluorophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(3-fluorophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(3-methylphenyl)-butyric acid | Fmoc-(S)-3-amino-4-(3-methylphenyl)-butyric acid | Fmoc-(S)-3-amino-4-(3-pyridyl)-butyric acid | Fmoc-(S)-3-amino-4-(3-pyridyl)-butyric acid | Fmoc-(S)-3-amino-4-(3-thienyl)-butyric acid | Fmoc-(S)-3-amino-4-(3-thienyl)-butyric acid | Fmoc-(S)-3-amino-4-(3-trifluoromethylphenyl)-butyric acid | Fmoc-(S)-3-amino-4-(3-trifluoromethylphenyl)-butyric acid | Fmoc-(S)-3-amino-4-(4-bromophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(4-bromophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(4-chlorophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(4-chlorophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(4-cyanophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(4-cyanophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(4-fluorophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(4-fluorophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(4-iodophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(4-iodophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(4-methylphenyl)-butyric acid | Fmoc-(S)-3-amino-4-(4-methylphenyl)-butyric acid | Fmoc-(S)-3-amino-4-(4-nitrophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(4-nitrophenyl)-butyric acid | Fmoc-(S)-3-amino-4-(4-pyridyl)-butyric acid | Fmoc-(S)-3-amino-4-(4-pyridyl)-butyric acid | Fmoc-(S)-3-amino-4-(4-trifluoromethylphenyl)-butyric acid | Fmoc-(S)-3-amino-4-(4-trifluoromethylphenyl)-butyric acid | Fmoc-(S)-3-amino-4-pentafluoro-phenylbutyric acid | Fmoc-(S)-3-amino-4-pentafluoro-phenylbutyric acid | Fmoc-(S)-3-amino-5-hexenoic acid | Fmoc-(S)-3-amino-5-hexenoic acid | Fmoc-(S)-3-amino-5-hexynoic acid | Fmoc-(S)-3-amino-5-hexynoic acid | Fmoc-(S)-3-amino-5-phenylpentanoic acid | Fmoc-(S)-3-amino-5-phenylpentanoic acid | Fmoc-(S)-3-amino-6-phenyl-5-hexenoic acid | Fmoc-(S)-3-amino-6-phenyl-5-hexenoic acid | Fmoc-1,2,5,6-tetrahydropyridine-3-carboxylic acid | Fmoc-1,2,5,6-tetrahydropyridine-3-carboxylic acid | Fmoc-1,2,5,6-tetrahydropyridine-4-carboxylic acid | Fmoc-1,2,5,6-tetrahydropyridine-4-carboxylic acid | Fmoc-3-amino-3-(2-chlorophenyl)-propionic acid | Fmoc-3-amino-3-(2-chlorophenyl)-propionic acid | Fmoc-3-amino-3-(2-thienyl)-propionic acid | Fmoc-3-amino-3-(2-thienyl)-propionic acid | Fmoc-3-amino-3-(3-bromophenyl)-propionic acid | Fmoc-3-amino-3-(3-bromophenyl)-propionic acid | Fmoc-3-amino-3-(4-chlorophenyl)-propionic acid | Fmoc-3-amino-3-(4-chlorophenyl)-propionic acid | Fmoc-3-amino-3-(4-methoxyphenyl)-propionic acid | Fmoc-3-amino-3-(4-methoxyphenyl)-propionic acid | Fmoc-3-amino-4,4,4-trifluoro-butyric acid | Fmoc-3-amino-4,4,4-trifluoro-butyric acid | Fmoc-3-amino-4,4,4-trifluorobutyric acid | Fmoc-3-aminoadipic acid | Fmoc-3-aminoadipic acid | Fmoc-D-β-phenylalanine | Fmoc-D-β-phenylalanine | Fmoc-DL-β-leucine | Fmoc-DL-β-leucine | Fmoc-L-β -homoalanine | Fmoc-L-β-homoalanine | Fmoc-L-β-homoaspartic acid γ-t-butyl ester | Fmoc-L-β-homoaspartic acid γ-t-butyl ester | Fmoc-L-β-homoglutamic acid δ-t-butyl ester | Fmoc-L-β-homoglutamic acid δ-t-butyl ester | Fmoc-L-β-homoisoleucine | Fmoc-L-β-homoisoleucine | Fmoc-L-β-homoleucine | Fmoc-L-β-homoleucine | Fmoc-L-β-homomethionine | Fmoc-L-β-homomethionine | Fmoc-L-β-homophenylalanine | Fmoc-L-β-homophenylalanine | Fmoc-L-β-homoproline | Fmoc-L-β-homoproline | Fmoc-L-β-homotryptophan | Fmoc-L-β-homotryptophan | Fmoc-L-β-homovaline | Fmoc-L-β-homovaline | Fmoc-L-Nω-Boc-β-homolysine | Fmoc-L-Nω-Boc-β-homolysine | Fmoc-Nδ-trityl-L-β-homoglutamine | Fmoc-Nδ-trityl-L-β-homoglutamine | Fmoc-Nω-2,2,4,6,7-pentamethyl-dihydrobenzofuran-5-sulfonyl-L-β-homoarginine | Fmoc-Nω-2,2,4,6,7-pentamethyl-dihydrobenzofuran-5-sulfonyl-L-β-homoarginine | Fmoc-O-t-butyl-L-β-homohydroxy-proline | Fmoc-O-t-butyl-L-β-homohydroxy-proline | Fmoc-O-t-butyl-L-β-homoserine | Fmoc-O-t-butyl-L-β-homoserine | Fmoc-O-t-butyl-L-β-homothreonine | Fmoc-O-t-butyl-L-β-homothreonine | Fmoc-O-t-butyl-L-β-homotyrosine | Fmoc-O-t-butyl-L-β-homotyrosine |
| Aliphatic Amino Acids | (1R,2R)-Boc-2-aminocyclopentane carboxylic acid | (1R,2R)-Boc-2-aminocyclopentane carboxylic acid | (1R,2R)-Fmoc-2-aminocyclopentane carboxylic acid | (1R,2R)-Fmoc-2-aminocyclopentane carboxylic acid | (1R,2S)-Boc-2-amino-1-cyclopentanecarboxylic acid | (1R,2S)-Boc-2-aminocyclo-heptanecarboxylic acid | (1R,2S)-Boc-2-aminocyclohex-3-ene-carboxylic acid | (1R,2S)-Boc-2-aminocyclohex-4-ene-carboxylic acid | (1R,2S)-Boc-2-aminocyclohexane carboxylic acid | (1R,2S)-Boc-2-aminocyclohexane carboxylic acid | (1R,2S)-Fmoc-2-amino-1-cyclopentanecarboxylic acid | (1R,2S)-Fmoc-2-aminocyclo-heptanecarboxylic acid | (1R,2S)-Fmoc-2-aminocyclohex-3-ene-carboxylic acid | (1R,2S)-Fmoc-2-aminocyclohex-4-ene-carboxylic acid | (1R,2S)-Fmoc-2-aminocyclohexane carboxylic acid | (1R,2S)-Fmoc-2-aminocyclohexane carboxylic acid | (1R,3S)-Boc-3-aminocyclopentane-1 carboxylic acid | (1R,3S)-Boc-3-aminocyclopentane-1 carboxylic acid | (1R,3S)-Fmoc-3-aminocyclopentane-1 carboxylic acid | (1R,3S)-Fmoc-3-aminocyclopentane-1 carboxylic acid | (1R,4S)-Boc-4-aminocyclopent-2-ene-carboxylic acid | (1R,4S)-Boc-4-aminocyclopent-2-ene-carboxylic acid | (1R,4S)-Fmoc-4-aminocyclopent-2-ene-carboxylic acid | (1R,4S)-Fmoc-4-aminocyclopent-2-ene-carboxylic acid | (1S,2R)-Boc-2-amino-1-cyclopentanecarboxylic acid | (1S,2R)-Boc-2-aminocyclohex-3-ene-carboxylic acid | (1S,2R)-Fmoc-2-amino-1-cyclopentanecarboxylic acid | (1S,2R)-Fmoc-2-aminocyclohex-3-ene-carboxylic acid | (1S,2S)-Boc-2-amino-1-cyclopentane carboxylic acid | (1S,2S)-Boc-2-amino-1-cyclopentane carboxylic acid | (1S,2S)-Boc-2-aminocyclohexane carboxylic acid | (1S,2S)-Boc-2-aminocyclohexane carboxylic acid | (1S,2S)-Fmoc-2-amino-1-cyclopentane carboxylic acid | (1S,2S)-Fmoc-2-amino-1-cyclopentane carboxylic acid | (1S,2S)-Fmoc-2-aminocyclohexane carboxylic acid | (1S,2S)-Fmoc-2-aminocyclohexane carboxylic acid | (1S,3R)-Boc-3-aminocyclopentane-1 carboxylic acid | (1S,3R)-Boc-3-aminocyclopentane-1 carboxylic acid | (1S,3R)-Fmoc-3-aminocyclopentane-1 carboxylic acid | (1S,3R)-Fmoc-3-aminocyclopentane-1 carboxylic acid | (1S,4R)-Boc-4-aminocyclopent-2-ene-carboxylic acid | (1S,4R)-Boc-4-aminocyclopent-2-ene-carboxylic acid | (1S,4R)-Fmoc-4-aminocyclopent-2-ene-carboxylic acid | (1S,4R)-Fmoc-4-aminocyclopent-2-ene-carboxylic acid | Bis-Boc-aminooxyacetic acid | Bis-Boc-aminooxyacetic acid | Boc-(±)-3-aminocyclohexane-1-carboxylic acid | Boc-(±)-3-aminocyclohexane-1-carboxylic acid | Boc-(±)-cis-2-aminocyclohexane-1-carboxylic acid | Boc-(±)-cis-2-aminocyclohexane-1-carboxylic acid | Boc-(±)-trans-2-aminocyclohexane-1-carboxylic acid | Boc-(±)-trans-2-aminocyclohexane-1-carboxylic acid | Boc-(1R,2S)-(-)-2-aminocyclohex-4-ene-carboxylic acid | Boc-(1S,2R)-(+)-2-aminocyclohex-4-ene-carboxylic acid | Boc-(2S,3S)-2-amino-3-methoxybutanoic acid | Boc-(2S,3S)-2-amino-3-methoxybutanoic acid | Boc-1-aminocyclobutane-1-carboxylic acid | Boc-1-aminocyclobutane-1-carboxylic acid | Boc-1-aminocyclohexane-1-carboxylic acid | Boc-1-aminocyclohexane-1-carboxylic acid | Boc-1-aminocyclopentane-1-carboxylic acid | Boc-1-aminocyclopentane-1-carboxylic acid | Boc-1-aminocyclopropane-1-carboxylic acid | Boc-1-aminocyclopropane-1-carboxylic acid | Boc-11-aminoundecanoic acid | Boc-11-aminoundecanoic acid | Boc-2-(aminooxy)acetic acid | Boc-2-(aminooxy)acetic acid | Boc-2-amino-2-indancarboxylic acid | Boc-2-amino-2-indancarboxylic acid | Boc-2-aminobicyclo[2.2.1]heptane-2-carboxylic acid (mixture of isomers) | Boc-2-aminobicyclo[2.2.1]heptane-2-carboxylic acid (mixture of isomers) | Boc-2-aminoheptanoic acid | Boc-2-aminoheptanoic acid | Boc-2-aminooctanoic acid | Boc-2-aminooctanoic acid | Boc-2-aminotetralin-2-carboxylic acid | Boc-2-aminotetralin-2-carboxylic acid | Boc-3-endo-aminobicyclo[2.2.1]-hept-5-ene-2-endo-carboxylic acid | Boc-3-endo-aminobicyclo[2.2.1]-hept-5-ene-2-endo-carboxylic acid | Boc-3-endo-aminobicyclo[2.2.1]-hept-5-ene-2-endo-carboxylic acid | Boc-3-endo-aminobicyclo[2.2.1]-heptane-2-endo-carboxylic acid | Boc-3-endo-aminobicyclo[2.2.1]-heptane-2-endo-carboxylic acid | Boc-3-exo-aminobicyclo[2.2.1]-hept-5-ene-2-exo-carboxylic acid | Boc-3-exo-aminobicyclo[2.2.1]-hept-5-ene-2-exo-carboxylic acid | Boc-3-exo-aminobicyclo[2.2.1]-hept-5-ene-2-exo-carboxylic acid | Boc-3-exo-aminobicyclo[2.2.1]-heptane-2-exo-carboxylic acid | Boc-3-exo-aminobicyclo[2.2.1]-heptane-2-exo-carboxylic acid | Boc-3-exo-aminobicyclo[2.2.1]-heptane-2-exo-carboxylic acid | Boc-5-amino-1,3-cyclohexadiene-1-carboxylic acid | Boc-5-amino-1,3-cyclohexadiene-1-carboxylic acid | Boc-5-aminolevulinic acid | Boc-5-aminolevulinic acid | Boc-5-aminopentanoic acid | Boc-5-aminopentanoic acid | Boc-6-aminohexanoic acid | Boc-6-aminohexanoic acid | Boc-7-aminoheptanoic acid | Boc-7-aminoheptanoic acid | Boc-8-aminooctanoic acid | Boc-8-aminooctanoic acid | Boc-cis-4-aminocyclohexane acetic acid | Boc-cis-4-aminocyclohexane acetic acid | Boc-cis-4-aminocyclohexane-1-carboxylic acid | Boc-cis-4-aminocyclohexane-1-carboxylic acid | Boc-DL-1-aminoindan-1-carboxylic acid | Boc-DL-2-amino-1,3-dihydro-phenalene-2-carboxylic acid | Boc-DL-2-amino-1,3-dihydro-phenalene-2-carboxylic acid | Boc-L-2-amino-6-(O,O'-diethyl-phosphono)hexanoic acid | Boc-L-2-amino-6-(O,O'-diethyl-phosphono)hexanoic acid | Boc-trans-4-(aminomethyl)-cyclohexane-1-carboxylic acid | Boc-trans-4-(aminomethyl)-cyclohexane-1-carboxylic acid | Boc-trans-4-aminocyclohexane acetic acid | Boc-trans-4-aminocyclohexane acetic acid | Boc-trans-4-aminocyclohexane-1-carboxylic acid | Boc-trans-4-aminocyclohexane-1-carboxylic acid | Fmoc-(±)-3-aminocyclohexane-1-carboxylic acid | Fmoc-(±)-3-aminocyclohexane-1-carboxylic acid | Fmoc-(±)-cis-2-aminocyclohexane-1-carboxylic acid | Fmoc-(±)-cis-2-aminocyclohexane-1-carboxylic acid | Fmoc-(±)-trans-2-aminocyclohexane-1-carboxylic acid | Fmoc-(±)-trans-2-aminocyclohexane-1-carboxylic acid | Fmoc-(1R,2S)-(-)-2-aminocyclohex-4-ene-carboxylic acid | Fmoc-(1S,2R)-(+)-2-aminocyclohex-4-ene-carboxylic acid | Fmoc-(2S,3S)-2-amino-3-methoxybutanoic acid | Fmoc-(2S,3S)-2-amino-3-methoxybutanoic acid | Fmoc-1-aminocyclobutane-1-carboxylic acid | Fmoc-1-aminocyclobutane-1-carboxylic acid | Fmoc-1-aminocyclohexane-1-carboxylic acid | Fmoc-1-aminocyclohexane-1-carboxylic acid | Fmoc-1-aminocyclopentane-1-carboxylic acid | Fmoc-1-aminocyclopentane-1-carboxylic acid | Fmoc-1-aminocyclopropane-1-carboxylic acid | Fmoc-1-aminocyclopropane-1-carboxylic acid | Fmoc-11-aminoundecanoic acid | Fmoc-11-aminoundecanoic acid | Fmoc-2-(aminooxy)acetic acid | Fmoc-2-(aminooxy)acetic acid | Fmoc-2-amino-2-indancarboxylic acid | Fmoc-2-amino-2-indancarboxylic acid | Fmoc-2-aminobicyclo[2.2.1]heptane-2-carboxylic acid (mixture of isomers) | Fmoc-2-aminobicyclo[2.2.1]heptane-2-carboxylic acid (mixture of isomers) | Fmoc-2-aminoheptanoic acid | Fmoc-2-aminoheptanoic acid | Fmoc-2-aminooctanoic acid | Fmoc-2-aminooctanoic acid | Fmoc-2-aminotetralin-2-carboxylic acid | Fmoc-2-aminotetralin-2-carboxylic acid | Fmoc-3-endo-aminobicyclo[2.2.1]-hept-5-ene-2-endo-carboxylic acid | Fmoc-3-endo-aminobicyclo[2.2.1]-hept-5-ene-2-endo-carboxylic acid | Fmoc-3-endo-aminobicyclo[2.2.1]-hept-5-ene-2-endo-carboxylic acid | Fmoc-3-endo-aminobicyclo[2.2.1]-heptane-2-endo-carboxylic acid | Fmoc-3-endo-aminobicyclo[2.2.1]-heptane-2-endo-carboxylic acid | Fmoc-3-exo-aminobicyclo[2.2.1]-hept-5-ene-2-exo-carboxylic acid | Fmoc-3-exo-aminobicyclo[2.2.1]-hept-5-ene-2-exo-carboxylic acid | Fmoc-3-exo-aminobicyclo[2.2.1]-hept-5-ene-2-exo-carboxylic acid | Fmoc-3-exo-aminobicyclo[2.2.1]-heptane-2-exo-carboxylic acid | Fmoc-3-exo-aminobicyclo[2.2.1]-heptane-2-exo-carboxylic acid | Fmoc-3-exo-aminobicyclo[2.2.1]-heptane-2-exo-carboxylic acid | Fmoc-4-amino-tetrahydropyran-4-carboxylic acid | Fmoc-4-amino-tetrahydropyran-4-carboxylic acid | Fmoc-4-amino-tetrahydrothiopyran-4-carboxylic acid | Fmoc-4-amino-tetrahydrothiopyran-4-carboxylic acid | Fmoc-5-amino-1,3-cyclohexadiene-1-carboxylic acid | Fmoc-5-amino-1,3-cyclohexadiene-1-carboxylic acid | Fmoc-5-aminolevulinic acid | Fmoc-5-aminolevulinic acid | Fmoc-5-aminopentanoic acid | Fmoc-5-aminopentanoic acid | Fmoc-6-Ahx-OH | Fmoc-6-Ahx-OH | Fmoc-7-aminoheptanoic acid | Fmoc-7-aminoheptanoic acid | Fmoc-8-aminooctanoic acid | Fmoc-8-aminooctanoic acid | Fmoc-AEEAc-OH | Fmoc-AEEAc-OH | Fmoc-cis-4-aminocyclohexane acetic acid | Fmoc-cis-4-aminocyclohexane acetic acid | Fmoc-cis-4-aminocyclohexane-1-carboxylic acid | Fmoc-cis-4-aminocyclohexane-1-carboxylic acid | Fmoc-DL-1-aminoindan-1-carboxylic acid | Fmoc-DL-1-aminoindan-1-carboxylic acid | Fmoc-DL-2-amino-1,3-dihydro-phenalene-2-carboxylic acid | Fmoc-DL-2-amino-1,3-dihydro-phenalene-2-carboxylic acid | Fmoc-L-2-amino-6-(O,O'-diethyl-phosphono)hexanoic acid | Fmoc-L-2-amino-6-(O,O'-diethyl-phosphono)hexanoic acid | Fmoc-trans-4-(aminomethyl)-cyclohexane-1-carboxylic acid | Fmoc-trans-4-(aminomethyl)-cyclohexane-1-carboxylic acid | Fmoc-trans-4-aminocyclohexane acetic acid | Fmoc-trans-4-aminocyclohexane acetic acid | Fmoc-trans-4-aminocyclohexane-1-carboxylic acid | Fmoc-trans-4-aminocyclohexane-1-carboxylic acid |
| Analogs of Alanine, Glycine, Valine, and Leucine | (RS)-Fmoc-α-methoxyglycine | (RS)-Fmoc-α-methoxyglycine | Boc-α-allyl-L-alanine | Boc-α-allyl-L-alanine | Boc-α-aminoisobutyric acid | Boc-α-aminoisobutyric acid | Boc-α-methyl-DL-leucine | Boc-α-methyl-DL-leucine | Boc-β-(1-naphthyl)-D-alanine | Boc-β-(1-naphthyl)-D-alanine | Boc-β-(1-naphthyl)-L-alanine | Boc-β-(1-naphthyl)-L-alanine | Boc-β-(2-naphthyl)-D-alanine | Boc-β-(2-naphthyl)-D-alanine | Boc-β-(2-naphthyl)-L-alanine | Boc-β-(2-naphthyl)-L-alanine | Boc-β-(2-pyridyl)-D-alanine | Boc-β-(2-pyridyl)-D-alanine | Boc-β-(2-pyridyl)-L-alanine | Boc-β-(2-pyridyl)-L-alanine | Boc-β-(2-thienyl)-D-alanine | Boc-β-(2-thienyl)-D-alanine | Boc-β-(2-thienyl)-L-alanine | Boc-β-(2-thienyl)-L-alanine | Boc-β-(3-benzothienyl)-D-alanine | Boc-β-(3-benzothienyl)-D-alanine | Boc-β-(3-benzothienyl)-L-alanine | Boc-β-(3-benzothienyl)-L-alanine | Boc-β-(3-pyridyl)-D-alanine | Boc-β-(3-pyridyl)-D-alanine | Boc-β-(3-pyridyl)-L-alanine | Boc-β-(3-pyridyl)-L-alanine | Boc-β-(4-pyridyl)-D-alanine | Boc-β-(4-pyridyl)-D-alanine | Boc-β-(4-pyridyl)-L-alanine | Boc-β-(4-pyridyl)-L-alanine | Boc-β-chloro-L-alanine | Boc-β-chloro-L-alanine | Boc-β-cyano-L-alanine | Boc-β-cyano-L-alanine | Boc-β-cyclohexyl-D-alanine | Boc-β-cyclohexyl-D-alanine | Boc-β-cyclohexyl-L-alanine | Boc-β-cyclohexyl-L-alanine | Boc-β-cyclopenten-1-yl-DL-alanine | Boc-β-cyclopenten-1-yl-DL-alanine | Boc-β-cyclopentyl-DL-alanine | Boc-β-cyclopentyl-DL-alanine | Boc-β-cyclopropyl-L-Ala-OH•DCHA | Boc-β-cyclopropyl-L-Ala-OH•DCHA | Boc-β-t-butyl-D-alanine | Boc-β-t-butyl-D-alanine | Boc-β-t-butyl-L-alanine | Boc-β-t-butyl-L-alanine | Boc-γ-aminobutyric acid | Boc-γ-aminobutyric acid | Boc-(N-β-Fmoc)-L-α,β-diaminopropionic acid | Boc-(N-β-Fmoc)-L-α,β-diaminopropionic acid | Boc-2,4-dinitro-DL-phenylglycine | Boc-2,4-dinitro-DL-phenylglycine | Boc-2,5-dihydro-D-phenylglycine | Boc-2,5-dihydro-D-phenylglycine | Boc-2-amino-4,4,4-trifluorobutyric acid | Boc-2-amino-4,4,4-trifluorobutyric acid | Boc-2-fluoro-DL-phenylglycine | Boc-2-fluoro-DL-phenylglycine | Boc-3-amino-4,4,4-trifluoro-butyric acid | Boc-3-amino-4,4,4-trifluoro-butyric acid | Boc-3-amino-4,4,4-trifluoro-butyric acid | Boc-3-fluoro-DL-valine | Boc-3-fluoro-DL-valine | Boc-4,4,4-trifluoro-DL-valine | Boc-4,4,4-trifluoro-DL-valine | Boc-4,5-dehydro-L-leu-OH•DCHA | Boc-4,5-dehydro-L-leu-OH•DCHA | Boc-4-fluoro-D-phenylglycine | Boc-4-fluoro-D-phenylglycine | Boc-4-fluoro-L-phenylglycine | Boc-4-fluoro-L-phenylglycine | Boc-4-hydroxy-D-phenylglycine | Boc-4-hydroxy-D-phenylglycine | Boc-5,5,5-trifluoro-DL-leucine | Boc-5,5,5-trifluoro-DL-leucine | Boc-6-aminohexanoic acid | Boc-6-aminohexanoic acid | Boc-cyclopentyl-D-Gly-OH•DCHA | Boc-cyclopentyl-D-Gly-OH•DCHA | Boc-cyclopentyl-Gly-OH•DCHA | Boc-cyclopentyl-Gly-OH•DCHA | Boc-D-α,β-diaminopropionic acid | Boc-D-α,β-diaminopropionic acid | Boc-D-α-aminobutyric acid | Boc-D-α-aminobutyric acid | Boc-D-α-t-butylglycine | Boc-D-α-t-butylglycine | Boc-D-(2-thienyl)glycine | Boc-D-(2-thienyl)glycine | Boc-D-(3-thienyl)glycine | Boc-D-(3-thienyl)glycine | Boc-D-2-aminocaproic acid | Boc-D-2-aminocaproic acid | Boc-D-2-indanylglycine | Boc-D-2-indanylglycine | Boc-D-allylglycine•DCHA | Boc-D-allylglycine•DCHA | Boc-D-cyclohexylglycine | Boc-D-cyclohexylglycine | Boc-D-Nva-OH | Boc-D-Nva-OH | Boc-D-phenylglycine | Boc-D-phenylglycine | Boc-DL-β-aminobutyric acid | Boc-DL-β-aminobutyric acid | Boc-DL-β-aminoisobutyric acid | Boc-DL-β-aminoisobutyric acid | Boc-DL-(2-bromophenyl)glycine | Boc-DL-(2-bromophenyl)glycine | Boc-DL-(2-methoxyphenyl)glycine | Boc-DL-(2-methoxyphenyl)glycine | Boc-DL-(2-methylphenyl)glycine | Boc-DL-(2-methylphenyl)glycine | Boc-DL-(2-thiazoyl)glycine | Boc-DL-(2-thiazoyl)glycine | Boc-DL-(2-thienyl)glycine | Boc-DL-(2-thienyl)glycine | Boc-DL-2-amino-3-(dimethylamino)-propionic acid | Boc-DL-2-amino-3-(dimethylamino)-propionic acid | Boc-L-α,β-diaminopropionic acid | Boc-L-α,β-diaminopropionic acid | Boc-L-α-aminobutyric acid | Boc-L-α-aminobutyric acid | Boc-L-α-t-butylglycine | Boc-L-α-t-butylglycine | Boc-L-(3-thienyl)glycine | Boc-L-(3-thienyl)glycine | Boc-L-2-amino-3-(dimethylamino)-propionic acid | Boc-L-2-amino-3-(dimethylamino)-propionic acid | Boc-L-2-aminocaproic acid dicyclohexyl-ammonium salt | Boc-L-2-aminocaproic acid dicyclohexyl-ammonium salt | Boc-L-2-indanylglycine | Boc-L-2-indanylglycine | Boc-L-allylglycine•DCHA | Boc-L-allylglycine•DCHA | Boc-L-cyclohexylglycine | Boc-L-cyclohexylglycine | Boc-L-phenylglycine | Boc-L-phenylglycine | Boc-L-propargylglycine | Boc-L-propargylglycine | Boc-Nva-OH Boc-L-norvaline | Boc-Nva-OH Boc-L-norvaline | Di-Boc-N-α-aminomethyl-L-alanine | Di-Boc-N-α-aminomethyl-L-alanine | Di-Fmoc-D-α,β-diaminopropionic acid | Di-Fmoc-D-α,β-diaminopropionic acid | Di-Fmoc-D-α,γ-diaminobutyric acid | Di-Fmoc-D-α,γ-diaminobutyric acid | Di-Fmoc-L-α,β-diaminopropionic acid | Di-Fmoc-L-α,β-diaminopropionic acid | Di-Fmoc-L-α,γ-diaminobutyric acid | Di-Fmoc-L-α,γ-diaminobutyric acid | Di-Fmoc-N-α-aminomethyl-L-alanine | Di-Fmoc-N-α-aminomethyl-L-alanine | Fmoc-α-allyl-L-alanine | Fmoc-α-allyl-L-alanine | Fmoc-α-aminoisobutyric acid | Fmoc-α-aminoisobutyric acid | Fmoc-α-methyl-DL-leucine | Fmoc-α-methyl-DL-leucine | Fmoc-β-(1-naphthyl)-D-alanine | Fmoc-β-(1-naphthyl)-D-alanine | Fmoc-β-(1-naphthyl)-L-alanine | Fmoc-β-(1-naphthyl)-L-alanine | Fmoc-β-(2-naphthyl)-D-alanine | Fmoc-β-(2-naphthyl)-D-alanine | Fmoc-β-(2-naphthyl)-L-alanine | Fmoc-β-(2-naphthyl)-L-alanine | Fmoc-β-(2-pyridyl)-D-alanine | Fmoc-β-(2-pyridyl)-D-alanine | Fmoc-β-(2-pyridyl)-L-alanine | Fmoc-β-(2-pyridyl)-L-alanine | Fmoc-β-(2-thienyl)-D-alanine | Fmoc-β-(2-thienyl)-D-alanine | Fmoc-β-(2-thienyl)-L-alanine | Fmoc-β-(2-thienyl)-L-alanine | Fmoc-β-(3-benzothienyl)-D-alanine | Fmoc-β-(3-benzothienyl)-D-alanine | Fmoc-β-(3-benzothienyl)-L-alanine | Fmoc-β-(3-benzothienyl)-L-alanine | Fmoc-β-(3-pyridyl)-D-alanine | Fmoc-β-(3-pyridyl)-D-alanine | Fmoc-β-(3-pyridyl)-L-alanine | Fmoc-β-(3-pyridyl)-L-alanine | Fmoc-β-(4-pyridyl)-D-alanine | Fmoc-β-(4-pyridyl)-D-alanine | Fmoc-β-(4-pyridyl)-L-alanine | Fmoc-β-(4-pyridyl)-L-alanine | Fmoc-β-chloro-L-alanine | Fmoc-β-chloro-L-alanine | Fmoc-β-cyano-L-alanine | Fmoc-β-cyano-L-alanine | Fmoc-β-cyclohexyl-D-alanine | Fmoc-β-cyclohexyl-D-alanine | Fmoc-β-cyclohexyl-L-alanine | Fmoc-β-cyclohexyl-L-alanine | Fmoc-β-cyclohexyl-L-alanine | Fmoc-β-cyclopenten-1-yl-DL-alanine | Fmoc-β-cyclopenten-1-yl-DL-alanine | Fmoc-β-cyclopentyl-DL-alanine | Fmoc-β-cyclopentyl-DL-alanine | Fmoc-β-cyclopropyl-L-alanine | Fmoc-β-cyclopropyl-L-alanine | Fmoc-β-t-butyl-D-alanine | Fmoc-β-t-butyl-D-alanine | Fmoc-β-t-butyl-L-alanine | Fmoc-β-t-butyl-L-alanine | Fmoc-γ-aminobutyric acid | Fmoc-γ-aminobutyric acid | Fmoc-(N-β-(2,4-dinitrophenyl))-L-α,β-diaminopropionic acid | Fmoc-(N-β-(2,4-dinitrophenyl))-L-α,β-diaminopropionic acid | Fmoc-(N-β-1-(4,4-dimethyl-2,6-dioxocyclohex-1-ylidene)ethyl)-D-α,β-diaminopropionic acid | Fmoc-(N-β-1-(4,4-dimethyl-2,6-dioxocyclohex-1-ylidene)ethyl)-D-α,β-diaminopropionic acid | Fmoc-(N-β-1-(4,4-dimethyl-2,6-dioxocyclohex-1-ylidene)ethyl)-L-α,β-diaminopropionic acid | Fmoc-(N-β-1-(4,4-dimethyl-2,6-dioxocyclohex-1-ylidene)ethyl)-L-α,β-diaminopropionic acid | Fmoc-(N-β-4-methyltrityl)-L-α,β-diaminopropionic acid | Fmoc-(N-β-4-methyltrityl)-L-α,β-diaminopropionic acid | Fmoc-(N-β-allyloxycarbonyl)-L-α,β-diaminopropionic acid | Fmoc-(N-β-allyloxycarbonyl)-L-α,β-diaminopropionic acid | Fmoc-(N-β-Boc)-D-α,β-diaminopropionic acid | Fmoc-(N-β-Boc)-D-α,β-diaminopropionic acid | Fmoc-(N-β-Boc)-L-α,β-diaminopropionic acid | Fmoc-(N-β-Boc)-L-α,β-diaminopropionic acid | Fmoc-(N-γ-1-(4,4-dimethyl-2,6-dioxocyclohex-1-ylidene)ethyl)-D-α,γ-diaminobutyric acid | Fmoc-(N-γ-1-(4,4-dimethyl-2,6-dioxocyclohex-1-ylidene)ethyl)-D-α,γ-diaminobutyric acid | Fmoc-(N-γ-1-(4,4-dimethyl-2,6-dioxocyclohex-1-ylidene)ethyl)-L-α,γ-diaminobutyric acid | Fmoc-(N-γ-1-(4,4-dimethyl-2,6-dioxocyclohex-1-ylidene)ethyl)-L-α,γ-diaminobutyric acid | Fmoc-(N-γ-4-methyltrityl)-D-α,γ-diaminobutyric acid | Fmoc-(N-γ-4-methyltrityl)-D-α,γ-diaminobutyric acid | Fmoc-(N-γ-4-methyltrityl)-L-α,γ-diaminobutyric acid | Fmoc-(N-γ-4-methyltrityl)-L-α,γ-diaminobutyric acid | Fmoc-(N-γ-allyloxycarbonyl)-L-α,γ-diaminobutyric acid | Fmoc-(N-γ-allyloxycarbonyl)-L-α,γ-diaminobutyric acid | Fmoc-(N-γ-Boc)-D-α,γ-diaminobutyric acid | Fmoc-(N-γ-Boc)-D-α,γ-diaminobutyric acid | Fmoc-(N-γ-Boc)-L-α,γ-diaminobutyric acid | Fmoc-(N-γ-Boc)-L-α,γ-diaminobutyric acid | Fmoc-2,4-dinitro-DL-phenylglycine | Fmoc-2,4-dinitro-DL-phenylglycine | Fmoc-2,5-dihydro-D-phenylglycine | Fmoc-2,5-dihydro-D-phenylglycine | Fmoc-2-amino-4,4,4-trifluorobutyric acid | Fmoc-2-amino-4,4,4-trifluorobutyric acid | Fmoc-2-fluoro-DL-phenylglycine | Fmoc-2-fluoro-DL-phenylglycine | Fmoc-3-amino-4,4,4-trifluoro-butyric acid | Fmoc-3-amino-4,4,4-trifluoro-butyric acid | Fmoc-3-amino-4,4,4-trifluorobutyric acid | Fmoc-3-fluoro-DL-valine | Fmoc-3-fluoro-DL-valine | Fmoc-4,4,4-trifluoro-DL-valine | Fmoc-4,4,4-trifluoro-DL-valine | Fmoc-4,5-dehydro-L-leucine | Fmoc-4,5-dehydro-L-leucine | Fmoc-4-fluoro-D-phenylglycine | Fmoc-4-fluoro-D-phenylglycine | Fmoc-4-fluoro-L-phenylglycine | Fmoc-4-fluoro-L-phenylglycine | Fmoc-4-hydroxy-D-phenylglycine | Fmoc-4-hydroxy-D-phenylglycine | Fmoc-5,5,5-trifluoro-DL-leucine | Fmoc-5,5,5-trifluoro-DL-leucine | Fmoc-6-Ahx-OH | Fmoc-6-Ahx-OH | Fmoc-cyclopentyl-D-Gly-OH | Fmoc-cyclopentyl-D-Gly-OH | Fmoc-cyclopentyl-Gly-OH | Fmoc-cyclopentyl-Gly-OH | Fmoc-D-α,β-diaminopropionic acid | Fmoc-D-α,β-diaminopropionic acid | Fmoc-D-α,γ-diaminobutyric acid | Fmoc-D-α,γ-diaminobutyric acid | Fmoc-D-α-aminobutyric acid | Fmoc-D-α-aminobutyric acid | Fmoc-D-α-t-butylglycine | Fmoc-D-α-t-butylglycine | Fmoc-D-(2-thienyl)glycine | Fmoc-D-(2-thienyl)glycine | Fmoc-D-(3-thienyl)glycine | Fmoc-D-(3-thienyl)glycine | Fmoc-D-2-aminocaproic acid | Fmoc-D-2-aminocaproic acid | Fmoc-D-2-indanylglycine | Fmoc-D-2-indanylglycine | Fmoc-D-allylglycine | Fmoc-D-allylglycine | Fmoc-D-cyclohexylglycine | Fmoc-D-cyclohexylglycine | Fmoc-D-homocyclohexylalanine | Fmoc-D-homocyclohexylalanine | Fmoc-D-Nva-OH | Fmoc-D-Nva-OH | Fmoc-D-phenylglycine | Fmoc-D-phenylglycine | Fmoc-DL-β-aminobutyric acid | Fmoc-DL-β-aminobutyric acid | Fmoc-DL-β-aminoisobutyric acid | Fmoc-DL-β-aminoisobutyric acid | Fmoc-DL-(2-bromophenyl)glycine | Fmoc-DL-(2-bromophenyl)glycine | Fmoc-DL-(2-methoxyphenyl)glycine | Fmoc-DL-(2-methoxyphenyl)glycine | Fmoc-DL-(2-methylphenyl)glycine | Fmoc-DL-(2-methylphenyl)glycine | Fmoc-DL-(2-thiazoyl)glycine | Fmoc-DL-(2-thiazoyl)glycine | Fmoc-DL-(2-thienyl)glycine | Fmoc-DL-(2-thienyl)glycine | Fmoc-DL-2-amino-3-(dimethylamino)-propionic acid | Fmoc-DL-2-amino-3-(dimethylamino)-propionic acid | Fmoc-L-α,β-diaminopropionic acid | Fmoc-L-α,β-diaminopropionic acid | Fmoc-L-α,γ-diaminobutyric acid | Fmoc-L-α,γ-diaminobutyric acid | Fmoc-L-α-aminobutyric acid | Fmoc-L-α-aminobutyric acid | Fmoc-L-α-t-butylglycine | Fmoc-L-α-t-butylglycine | Fmoc-L-(3-thienyl)glycine | Fmoc-L-(3-thienyl)glycine | Fmoc-L-1-pyrenylalanine | Fmoc-L-1-pyrenylalanine | Fmoc-L-2-amino-3-(dimethylamino)-propionic acid | Fmoc-L-2-amino-3-(dimethylamino)-propionic acid | Fmoc-L-2-aminocaproic acid | Fmoc-L-2-aminocaproic acid | Fmoc-L-2-indanylglycine | Fmoc-L-2-indanylglycine | Fmoc-L-allylglycine | Fmoc-L-allylglycine | Fmoc-L-cyclohexylglycine | Fmoc-L-cyclohexylglycine | Fmoc-L-homocyclohexylalanine | Fmoc-L-homocyclohexylalanine | Fmoc-L-phenylglycine | Fmoc-L-phenylglycine | Fmoc-N-(Hmb)-Gly-OH | Fmoc-N-(Hmb)-Gly-OH | Fmoc-Nva-OH Fmoc-L-norvaline | Fmoc-Nva-OH Fmoc-L-norvaline |
| Analogs of Arginine and Lysine | Boc-DL-citrulline | Boc-DL-citrulline | Boc-L-2-amino-3-guanidinopropionic acid | Boc-L-2-amino-3-guanidinopropionic acid | Boc-L-citrulline | Boc-L-citrulline | Boc-Lys(Ac)-OH | Boc-Lys(Ac)-OH | Boc-Lys(Me)2-OH | Boc-Lys(Me)2-OH | Boc-Lys(N3)-OH | Boc-Lys(N3)-OH | Boc-Nδ-benzyloxycarbonyl-L-ornithine | Boc-Nδ-benzyloxycarbonyl-L-ornithine | Boc-Nω-nitro-D-arginine | Boc-Nω-nitro-D-arginine | Boc-Nω-nitro-L-arginine | Boc-Nω-nitro-L-arginine | Di-Boc-α-methyl-DL-ornithine | Di-Boc-α-methyl-DL-ornithine | Di-Boc-2,6-diaminoheptanedioic acid (mixture of isomers) | Di-Boc-2,6-diaminoheptanedioic acid (mixture of isomers) | Di-Fmoc-α-methyl-DL-ornithine | Di-Fmoc-α-methyl-DL-ornithine | Di-Fmoc-2,6-diaminoheptanedioic acid (mixture of isomers) | Di-Fmoc-2,6-diaminoheptanedioic acid (mixture of isomers) | Di-Fmoc-L-ornithine | Di-Fmoc-L-ornithine | Fmoc-(Nδ-1-(4,4-dimethyl-2,6-dioxo-cyclohex-1-ylidene)ethyl)-D-ornithine | Fmoc-(Nδ-1-(4,4-dimethyl-2,6-dioxo-cyclohex-1-ylidene)ethyl)-D-ornithine | Fmoc-(Nδ-1-(4,4-dimethyl-2,6-dioxo-cyclohex-1-ylidene)ethyl)-L-ornithine | Fmoc-(Nδ-1-(4,4-dimethyl-2,6-dioxo-cyclohex-1-ylidene)ethyl)-L-ornithine | Fmoc-(Nδ-4-methyltrityl)-D-ornithine | Fmoc-(Nδ-4-methyltrityl)-D-ornithine | Fmoc-(Nδ-4-methyltrityl)-L-ornithine | Fmoc-(Nδ-4-methyltrityl)-L-ornithine | Fmoc-(Nδ-Boc)-D-ornithine | Fmoc-(Nδ-Boc)-D-ornithine | Fmoc-(Nδ-Boc)-D-ornithine | Fmoc-(Nδ-Boc)-L-ornithine | Fmoc-(Nδ-Boc)-L-ornithine | Fmoc-Arg(Me)(Pbf)-OH | Fmoc-Arg(Me)(Pbf)-OH | Fmoc-Arg(Me)2-OH (asymmetrical) | Fmoc-Arg(Me)2-OH (asymmetrical) | Fmoc-Arg(Me)2-OH (symmetrical) | Fmoc-Arg(Me)2-OH (symmetrical) | Fmoc-DL-citrulline | Fmoc-DL-citrulline | Fmoc-L-2-amino-3-guanidinopropionic acid | Fmoc-L-2-amino-3-guanidinopropionic acid | Fmoc-L-citrulline | Fmoc-L-citrulline | Fmoc-Lys(Ac)-OH | Fmoc-Lys(Ac)-OH | Fmoc-Lys(ivDde)-OH | Fmoc-Lys(ivDde)-OH | Fmoc-Lys(Me)2-OH • HCl | Fmoc-Lys(Me)2-OH • HCl | Fmoc-Lys(Me, Boc)-OH | Fmoc-Lys(Me, Boc)-OH | Fmoc-Lys(Me, Boc)-OH | Fmoc-Lys(Me3)-OH chloride | Fmoc-Lys(Me3)-OH chloride | Fmoc-Lys(Me3)-OH chloride | Fmoc-Nω-nitro-D-arginine | Fmoc-Nω-nitro-D-arginine | Fmoc-Nω-nitro-L-arginine | Fmoc-Nω-nitro-L-arginine |
| Analogs of Aspartic and Glutamic Acids | | Analogs of Benzoic Acid | | Analogs of Cysteine and Methionine | | Analogs of Phenylalanine and Tyrosine | (2R, 3R)-Boc-β-methyl-phenylalanine | (2R, 3R)-Boc-β-methyl-phenylalanine | (2R, 3R)/(2S, 3S)-Racemic-Boc-β-methyl-phenylalanine | (2R, 3R)/(2S, 3S)-Racemic-Boc-β-methyl-phenylalanine | (2R, 3S)/(2S, 3R)-Racemic Boc-β-hydroxyphenylalanine | (2R, 3S)/(2S, 3R)-Racemic Boc-β-hydroxyphenylalanine | (2R, 3S)/(2S, 3R)-Racemic Fmoc-β-hydroxyphenylalanine | (2R, 3S)/(2S, 3R)-Racemic Fmoc-β-hydroxyphenylalanine | (2S, 3S)-Boc-β-methyl-phenylalanine | (2S, 3S)-Boc-β-methyl-phenylalanine | Boc-α-methyl-3-methoxy-DL-phenylalanine | Boc-α-methyl-3-methoxy-DL-phenylalanine | Boc-α-methyl-D-phenylalanine | Boc-α-methyl-D-phenylalanine | Boc-α-methyl-D-phenylalanine | Boc-α-methyl-L-phenylalanine | Boc-α-methyl-L-phenylalanine | Boc-β-methyl-DL-phenylalanine | Boc-β-methyl-DL-phenylalanine | Boc-(R)-1,2,3,4-tetrahydroisoquino-line-3-carboxylic acid | Boc-(R)-1,2,3,4-tetrahydroisoquino-line-3-carboxylic acid | Boc-(S)-1,2,3,4-tetrahydroisoquinoline-line-3-carboxylic acid | Boc-(S)-1,2,3,4-tetrahydroisoquinoline-line-3-carboxylic acid | Boc-2,4-dichloro-D-phenylalanine | Boc-2,4-dichloro-D-phenylalanine | Boc-2,4-dichloro-L-phenylalanine | Boc-2,4-dichloro-L-phenylalanine | Boc-2-(trifluoromethyl)-D-phenylalanine | Boc-2-(trifluoromethyl)-D-phenylalanine | Boc-2-(trifluoromethyl)-L-phenylalanine | Boc-2-(trifluoromethyl)-L-phenylalanine | Boc-2-bromo-D-phenylalanine | Boc-2-bromo-D-phenylalanine | Boc-2-bromo-L-phenylalanine | Boc-2-bromo-L-phenylalanine | Boc-2-chloro-D-phenylalanine | Boc-2-chloro-D-phenylalanine | Boc-2-chloro-L-phenylalanine | Boc-2-chloro-L-phenylalanine | Boc-2-cyano-D-phenylalanine | Boc-2-cyano-D-phenylalanine | Boc-2-cyano-L-phenylalanine | Boc-2-cyano-L-phenylalanine | Boc-2-fluoro-D-phenylalanine | Boc-2-fluoro-D-phenylalanine | Boc-2-fluoro-L-phenylalanine | Boc-2-fluoro-L-phenylalanine | Boc-2-methyl-D-phenylalanine | Boc-2-methyl-D-phenylalanine | Boc-2-methyl-L-phenylalanine | Boc-2-methyl-L-phenylalanine | Boc-2-nitro-D-phenylalanine | Boc-2-nitro-D-phenylalanine | Boc-2-nitro-L-phenylalanine | Boc-2-nitro-L-phenylalanine | Boc-2;4;5-trihydroxy-DL-phenylalanine | Boc-2;4;5-trihydroxy-DL-phenylalanine | Boc-3,4,5-trifluoro-D-phenylalanine | Boc-3,4,5-trifluoro-D-phenylalanine | Boc-3,4,5-trifluoro-L-phenylalanine | Boc-3,4,5-trifluoro-L-phenylalanine | Boc-3,4-dichloro-D-phenylalanine | Boc-3,4-dichloro-D-phenylalanine | Boc-3,4-dichloro-L-phenylalanine | Boc-3,4-dichloro-L-phenylalanine | Boc-3,4-difluoro-D-phenylalanine | Boc-3,4-difluoro-D-phenylalanine | Boc-3,4-difluoro-L-phenylalanine | Boc-3,4-difluoro-L-phenylalanine | Boc-3,4-dihydroxy-L-phenylalanine | Boc-3,4-dihydroxy-L-phenylalanine | Boc-3,4-dimethoxy-L-phenylalanine | Boc-3,4-dimethoxy-L-phenylalanine | Boc-3,5,3’-triiodo-L-thyronine | Boc-3,5,3’-triiodo-L-thyronine | Boc-3,5-diiodo-D-tyrosine | Boc-3,5-diiodo-D-tyrosine | Boc-3,5-diiodo-L-thyronine | Boc-3,5-diiodo-L-thyronine | Boc-3,5-diiodo-L-tyrosine | Boc-3,5-diiodo-L-tyrosine | Boc-3-(trifluoromethyl)-D-phenylalanine | Boc-3-(trifluoromethyl)-D-phenylalanine | Boc-3-(trifluoromethyl)-L-phenylalanine | Boc-3-(trifluoromethyl)-L-phenylalanine | Boc-3-amino-L-tyrosine | Boc-3-amino-L-tyrosine | Boc-3-bromo-D-phenylalanine | Boc-3-bromo-D-phenylalanine | Boc-3-bromo-L-phenylalanine | Boc-3-bromo-L-phenylalanine | Boc-3-chloro-D-phenylalanine | Boc-3-chloro-D-phenylalanine | Boc-3-chloro-L-phenylalanine | Boc-3-chloro-L-phenylalanine | Boc-3-chloro-L-tyrosine | Boc-3-chloro-L-tyrosine | Boc-3-cyano-D-phenylalanine | Boc-3-cyano-D-phenylalanine | Boc-3-cyano-L-phenylalanine | Boc-3-cyano-L-phenylalanine | Boc-3-fluoro-D-phenylalanine | Boc-3-fluoro-D-phenylalanine | Boc-3-fluoro-DL-tyrosine | Boc-3-fluoro-DL-tyrosine | Boc-3-fluoro-L-phenylalanine | Boc-3-fluoro-L-phenylalanine | Boc-3-iodo-D-phenylalanine | Boc-3-iodo-D-phenylalanine | Boc-3-iodo-L-phenylalanine | Boc-3-iodo-L-phenylalanine | Boc-3-iodo-L-tyrosine | Boc-3-iodo-L-tyrosine | Boc-3-methyl-D-phenylalanine | Boc-3-methyl-D-phenylalanine | Boc-3-methyl-L-phenylalanine | Boc-3-methyl-L-phenylalanine | Boc-3-nitro-D-phenylalanine | Boc-3-nitro-D-phenylalanine | Boc-3-nitro-L-phenylalanine | Boc-3-nitro-L-phenylalanine | Boc-3-nitro-L-tyrosine | Boc-3-nitro-L-tyrosine | Boc-4-(Fmoc-aminomethyl)-D-phenylalanine | Boc-4-(Fmoc-aminomethyl)-D-phenylalanine | Boc-4-(Fmoc-aminomethyl)-L-phenylalanine | Boc-4-(Fmoc-aminomethyl)-L-phenylalanine | Boc-4-(trifluoromethyl)-D-phenylalanine | Boc-4-(trifluoromethyl)-D-phenylalanine | Boc-4-(trifluoromethyl)-L-phenylalanine | Boc-4-(trifluoromethyl)-L-phenylalanine | Boc-4-amino-D-phenylalanine | Boc-4-amino-D-phenylalanine | Boc-4-amino-L-phenylalanine | Boc-4-amino-L-phenylalanine | Boc-4-benzoyl-D-phenylalanine | Boc-4-benzoyl-D-phenylalanine | Boc-4-benzoyl-L-phenylalanine | Boc-4-benzoyl-L-phenylalanine | Boc-4-bis(2-chloroethyl)amino-L-phenylalanine | Boc-4-bis(2-chloroethyl)amino-L-phenylalanine | Boc-4-bromo-D-phenylalanine | Boc-4-bromo-D-phenylalanine | Boc-4-bromo-L-phenylalanine | Boc-4-bromo-L-phenylalanine | Boc-4-chloro-D-phenylalanine | Boc-4-chloro-D-phenylalanine | Boc-4-chloro-L-phenylalanine | Boc-4-chloro-L-phenylalanine | Boc-4-cyano-D-phenylalanine | Boc-4-cyano-D-phenylalanine | Boc-4-cyano-L-phenylalanine | Boc-4-cyano-L-phenylalanine | Boc-4-fluoro-D-phenylalanine | Boc-4-fluoro-D-phenylalanine | Boc-4-fluoro-L-phenylalanine | Boc-4-fluoro-L-phenylalanine | Boc-4-iodo-D-phenylalanine | Boc-4-iodo-D-phenylalanine | Boc-4-iodo-L-phenylalanine | Boc-4-iodo-L-phenylalanine | Boc-4-methyl-D-phenylalanine | Boc-4-methyl-D-phenylalanine | Boc-4-methyl-L-phenylalanine | Boc-4-methyl-L-phenylalanine | Boc-4-nitro-D-phenylalanine | Boc-4-nitro-D-phenylalanine | Boc-4-nitro-L-phenylalanine | Boc-4-nitro-L-phenylalanine | Boc-5-bromo-2-methoxy-D-phenylalanine | Boc-5-bromo-2-methoxy-D-phenylalanine | Boc-5-bromo-2-methoxy-L-phenylalanine | Boc-5-bromo-2-methoxy-L-phenylalanine | Boc-7-hydroxy-(R)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid | Boc-7-hydroxy-(R)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid | Boc-7-hydroxy-(S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid | Boc-7-hydroxy-(S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid | Boc-D-3,3-diphenylalanine | Boc-D-3,3-diphenylalanine | Boc-D-homophenylalanine | Boc-D-homophenylalanine | Boc-D-pentafluorophenylalanine | Boc-D-pentafluorophenylalanine | Boc-D-thyroxine | Boc-D-thyroxine | Boc-DL-m-tyrosine | Boc-DL-m-tyrosine | Boc-DL-o-tyrosine | Boc-DL-o-tyrosine | Boc-DL-thyronine | Boc-DL-thyronine | Boc-L-3,3-diphenylalanine | Boc-L-3,3-diphenylalanine | Boc-L-homophenylalanine | Boc-L-homophenylalanine | Boc-L-pentafluorophenylalanine | Boc-L-pentafluorophenylalanine | Boc-L-thyronine | Boc-L-thyronine | Boc-L-thyroxine | Boc-L-thyroxine | Boc-O-ethyl-D-tyrosine | Boc-O-ethyl-D-tyrosine | Boc-O-ethyl-L-tyrosine | Boc-O-ethyl-L-tyrosine | Boc-O-methyl-D-tyrosine | Boc-O-methyl-D-tyrosine | Boc-O-methyl-L-tyrosine | Boc-O-methyl-L-tyrosine | Fmoc-α-methyl-3-methoxy-DL-phenylalanine | Fmoc-α-methyl-3-methoxy-DL-phenylalanine | Fmoc-α-methyl-D-phenylalanine | Fmoc-α-methyl-D-phenylalanine | Fmoc-α-methyl-D-phenylalanine | Fmoc-α-methyl-L-phenylalanine | Fmoc-α-methyl-L-phenylalanine | Fmoc-β-methyl-DL-phenylalanine | Fmoc-β-methyl-DL-phenylalanine | Fmoc-(R)-1,2,3,4-tetrahydroisoquino- | Fmoc-(R)-1,2,3,4-tetrahydroisoquino- | Fmoc-(S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid | Fmoc-(S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid | Fmoc-2,4-dichloro-D-phenylalanine | Fmoc-2,4-dichloro-D-phenylalanine | Fmoc-2,4-dichloro-L-phenylalanine | Fmoc-2,4-dichloro-L-phenylalanine | Fmoc-2-(trifluoromethyl)-D-phenylalanine | Fmoc-2-(trifluoromethyl)-D-phenylalanine | Fmoc-2-(trifluoromethyl)-L-phenylalanine | Fmoc-2-(trifluoromethyl)-L-phenylalanine | Fmoc-2-bromo-D-phenylalanine | Fmoc-2-bromo-D-phenylalanine | Fmoc-2-bromo-L-phenylalanine | Fmoc-2-bromo-L-phenylalanine | Fmoc-2-chloro-D-phenylalanine | Fmoc-2-chloro-D-phenylalanine | Fmoc-2-chloro-L-phenylalanine | Fmoc-2-chloro-L-phenylalanine | Fmoc-2-cyano-D-phenylalanine | Fmoc-2-cyano-D-phenylalanine | Fmoc-2-cyano-L-phenylalanine | Fmoc-2-cyano-L-phenylalanine | Fmoc-2-fluoro-D-phenylalanine | Fmoc-2-fluoro-D-phenylalanine | Fmoc-2-fluoro-L-phenylalanine | Fmoc-2-fluoro-L-phenylalanine | Fmoc-2-methyl-D-phenylalanine | Fmoc-2-methyl-D-phenylalanine | Fmoc-2-methyl-L-phenylalanine | Fmoc-2-methyl-L-phenylalanine | Fmoc-2-nitro-D-phenylalanine | Fmoc-2-nitro-D-phenylalanine | Fmoc-2-nitro-L-phenylalanine | Fmoc-2-nitro-L-phenylalanine | Fmoc-2;4;5-trihydroxy-DL-phenylalanine | Fmoc-2;4;5-trihydroxy-DL-phenylalanine | Fmoc-3,4,5-trifluoro-D-phenylalanine | Fmoc-3,4,5-trifluoro-D-phenylalanine | Fmoc-3,4,5-trifluoro-L-phenylalanine | Fmoc-3,4,5-trifluoro-L-phenylalanine | Fmoc-3,4-dichloro-D-phenylalanine | Fmoc-3,4-dichloro-D-phenylalanine | Fmoc-3,4-dichloro-L-phenylalanine | Fmoc-3,4-dichloro-L-phenylalanine | Fmoc-3,4-difluoro-D-phenylalanine | Fmoc-3,4-difluoro-D-phenylalanine | Fmoc-3,4-difluoro-L-phenylalanine | Fmoc-3,4-difluoro-L-phenylalanine | Fmoc-3,4-dihydroxy-L-phenylalanine | Fmoc-3,4-dihydroxy-L-phenylalanine | Fmoc-3,4-dihydroxy-phenylalanine, acetonide protected | Fmoc-3,4-dihydroxy-phenylalanine, acetonide protected | Fmoc-3,4-dihydroxy-phenylalanine, acetonide protected | Fmoc-3,4-dimethoxy-L-phenylalanine | Fmoc-3,4-dimethoxy-L-phenylalanine | Fmoc-3,5,3’-triiodo-L-thyronine | Fmoc-3,5,3’-triiodo-L-thyronine | Fmoc-3,5-diiodo-D-tyrosine | Fmoc-3,5-diiodo-D-tyrosine | Fmoc-3,5-diiodo-L-thyronine | Fmoc-3,5-diiodo-L-thyronine | Fmoc-3,5-diiodo-L-tyrosine | Fmoc-3,5-diiodo-L-tyrosine | Fmoc-3-(trifluoromethyl)-D-phenylalanine | Fmoc-3-(trifluoromethyl)-D-phenylalanine | Fmoc-3-(trifluoromethyl)-L-phenylalanine | Fmoc-3-(trifluoromethyl)-L-phenylalanine | Fmoc-3-amino-L-tyrosine | Fmoc-3-amino-L-tyrosine | Fmoc-3-bromo-D-phenylalanine | Fmoc-3-bromo-D-phenylalanine | Fmoc-3-bromo-L-phenylalanine | Fmoc-3-bromo-L-phenylalanine | Fmoc-3-chloro-D-phenylalanine | Fmoc-3-chloro-D-phenylalanine | Fmoc-3-chloro-L-phenylalanine | Fmoc-3-chloro-L-phenylalanine | Fmoc-3-chloro-L-tyrosine | Fmoc-3-chloro-L-tyrosine | Fmoc-3-cyano-D-phenylalanine | Fmoc-3-cyano-D-phenylalanine | Fmoc-3-cyano-L-phenylalanine | Fmoc-3-cyano-L-phenylalanine | Fmoc-3-fluoro-D-phenylalanine | Fmoc-3-fluoro-D-phenylalanine | Fmoc-3-fluoro-DL-tyrosine | Fmoc-3-fluoro-DL-tyrosine | Fmoc-3-fluoro-L-phenylalanine | Fmoc-3-fluoro-L-phenylalanine | Fmoc-3-iodo-D-phenylalanine | Fmoc-3-iodo-D-phenylalanine | Fmoc-3-iodo-L-phenylalanine | Fmoc-3-iodo-L-phenylalanine | Fmoc-3-iodo-L-tyrosine | Fmoc-3-iodo-L-tyrosine | Fmoc-3-methyl-D-phenylalanine | Fmoc-3-methyl-D-phenylalanine | Fmoc-3-methyl-L-phenylalanine | Fmoc-3-methyl-L-phenylalanine | Fmoc-3-nitro-D-phenylalanine | Fmoc-3-nitro-D-phenylalanine | Fmoc-3-nitro-L-phenylalanine | Fmoc-3-nitro-L-phenylalanine | Fmoc-3-nitro-L-tyrosine | Fmoc-3-nitro-L-tyrosine | Fmoc-4-(Boc-amino)-D-phenylalanine | Fmoc-4-(Boc-amino)-D-phenylalanine | Fmoc-4-(Boc-amino)-L-phenylalanine | Fmoc-4-(Boc-amino)-L-phenylalanine | Fmoc-4-(Boc-aminomethyl)-D-phenylalanine | Fmoc-4-(Boc-aminomethyl)-D-phenylalanine | Fmoc-4-(Boc-aminomethyl)-L-phenylalanine | Fmoc-4-(Boc-aminomethyl)-L-phenylalanine | Fmoc-4-(Boc-methoxy)-L-phenylalanine | Fmoc-4-(Boc-methoxy)-L-phenylalanine | Fmoc-4-(phosphonomethyl)-phenylalanine | Fmoc-4-(phosphonomethyl)-phenylalanine | Fmoc-4-(trifluoromethyl)-D-phenylalanine | Fmoc-4-(trifluoromethyl)-D-phenylalanine | Fmoc-4-(trifluoromethyl)-L-phenylalanine | Fmoc-4-(trifluoromethyl)-L-phenylalanine | Fmoc-4-[2-(Boc-amino)ethoxy]-L-phenylalanine | Fmoc-4-[2-(Boc-amino)ethoxy]-L-phenylalanine | Fmoc-4-amino-D-phenylalanine | Fmoc-4-amino-D-phenylalanine | Fmoc-4-amino-L-phenylalanine | Fmoc-4-amino-L-phenylalanine | Fmoc-4-benzoyl-D-phenylalanine | Fmoc-4-benzoyl-D-phenylalanine | Fmoc-4-benzoyl-L-phenylalanine | Fmoc-4-benzoyl-L-phenylalanine | Fmoc-4-bis(2-chloroethyl)amino-L-phenylalanine | Fmoc-4-bis(2-chloroethyl)amino-L-phenylalanine | Fmoc-4-bromo-D-phenylalanine | Fmoc-4-bromo-D-phenylalanine | Fmoc-4-bromo-L-phenylalanine | Fmoc-4-bromo-L-phenylalanine | Fmoc-4-chloro-D-phenylalanine | Fmoc-4-chloro-D-phenylalanine | Fmoc-4-chloro-L-phenylalanine | Fmoc-4-chloro-L-phenylalanine | Fmoc-4-cyano-D-phenylalanine | Fmoc-4-cyano-D-phenylalanine | Fmoc-4-cyano-L-phenylalanine | Fmoc-4-cyano-L-phenylalanine | Fmoc-4-fluoro-D-phenylalanine | Fmoc-4-fluoro-D-phenylalanine | Fmoc-4-fluoro-L-phenylalanine | Fmoc-4-fluoro-L-phenylalanine | Fmoc-4-iodo-D-phenylalanine | Fmoc-4-iodo-D-phenylalanine | Fmoc-4-iodo-L-phenylalanine | Fmoc-4-iodo-L-phenylalanine | Fmoc-4-methyl-D-phenylalanine | Fmoc-4-methyl-D-phenylalanine | Fmoc-4-methyl-L-phenylalanine | Fmoc-4-methyl-L-phenylalanine | Fmoc-4-nitro-D-phenylalanine | Fmoc-4-nitro-D-phenylalanine | Fmoc-4-nitro-L-phenylalanine | Fmoc-4-nitro-L-phenylalanine | Fmoc-5-bromo-2-methoxy-D-phenylalanine | Fmoc-5-bromo-2-methoxy-D-phenylalanine | Fmoc-5-bromo-2-methoxy-L-phenylalanine | Fmoc-5-bromo-2-methoxy-L-phenylalanine | Fmoc-7-hydroxy-(R)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid | Fmoc-7-hydroxy-(S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid | Fmoc-7-hydroxy-(S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid | Fmoc-7-hydroxy-(S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid | Fmoc-D-3,3-diphenylalanine | Fmoc-D-3,3-diphenylalanine | Fmoc-D-homophenylalanine | Fmoc-D-homophenylalanine | Fmoc-D-pentafluorophenylalanine | Fmoc-D-pentafluorophenylalanine | Fmoc-D-thyroxine | Fmoc-D-thyroxine | Fmoc-DL-m-tyrosine | Fmoc-DL-m-tyrosine | Fmoc-DL-o-tyrosine | Fmoc-DL-o-tyrosine | Fmoc-DL-thyronine | Fmoc-DL-thyronine | Fmoc-L-(2,6-di-Me)Tyr-OH | Fmoc-L-(2,6-di-Me)Tyr-OH | Fmoc-L-3,3-diphenylalanine | Fmoc-L-3,3-diphenylalanine | Fmoc-L-4(O-tButylcarboxymethyl)phe-OH | Fmoc-L-4(O-tButylcarboxymethyl)Phe-OH | Fmoc-L-homophenylalanine | Fmoc-L-homophenylalanine | Fmoc-L-pentafluorophenylalanine | Fmoc-L-pentafluorophenylalanine | Fmoc-L-thyronine | Fmoc-L-thyronine | Fmoc-L-thyroxine | Fmoc-L-thyroxine | Fmoc-O-ethyl-D-tyrosine | Fmoc-O-ethyl-D-tyrosine | Fmoc-O-ethyl-L-tyrosine | Fmoc-O-ethyl-L-tyrosine | Fmoc-O-methyl-D-tyrosine | Fmoc-O-methyl-D-tyrosine | Fmoc-O-methyl-L-tyrosine | Fmoc-O-methyl-L-tyrosine | Fmoc-Phe(4-guanidino-Boc2)-OH | Fmoc-Phe(4-guanidino-Boc2)-OH | Fmoc-Tyr[PO(OBzl)OH]-OH | Fmoc-Tyr[PO(OBzl)OH]-OH | Fmoc-Tyr[PO(OBzl)OH]-OH | Fmoc-Tyr[PO(OBzl)OH]-OH | Fmoc-Tyr[PO(OBzl)OH]-OH |
| Analogs of Proline | Boc-(2R,5S)-5-phenyl-pyrrolidine-2-carboxylic acid | Boc-(2R,5S)-5-phenyl-pyrrolidine-2-carboxylic acid | Boc-(2S, 4R)-4-benzyl-pyrrolidine-2-carboxylic acid | Boc-(2S, 4R)-4-benzyl-pyrrolidine-2-carboxylic acid | Boc-(2S,3aS,7aS)-Octahydro-1H-indole-2-carboxylic acid | Boc-(2S,3aS,7aS)-Octahydro-1H-indole-2-carboxylic acid | Boc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid | Boc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid | Boc-(2S,3S)-3-hydroxypyrrolidine-2-carboxylic acid | Boc-(2S,3S)-3-hydroxypyrrolidine-2-carboxylic acid | Boc-(2S,3S)-3-hydroxypyrrolidine-2-carboxylic acid | Boc-(2S,4R)-(-)-4-hydroxypyrrolidine-2-carboxylic acid | Boc-(2S,4R)-(-)-4-hydroxypyrrolidine-2-carboxylic acid | Boc-(2S,4S)-(-)-4-hydroxypyrrolidine-2-carboxylic acid | Boc-(2S,4S)-(-)-4-hydroxypyrrolidine-2-carboxylic acid | Boc-(2S,4S)-4-phenyl-pyrrolidine-2-carboxylic acid | Boc-(2S,4S)-4-phenyl-pyrrolidine-2-carboxylic acid | Boc-(2S,5R)-5-phenyl-pyrrolidine-2-carboxylic acid | Boc-(2S,5R)-5-phenyl-pyrrolidine-2-carboxylic acid | Boc-(4S,2RS)-2-ethylthiazolidine-4-carboxylic acid | Boc-(4S,2RS)-2-ethylthiazolidine-4-carboxylic acid | Boc-(4S,2RS)-2-methylthiazolidine-4-carboxylic acid | Boc-(4S,2RS)-2-methylthiazolidine-4-carboxylic acid | Boc-(4S,2RS)-2-phenylthiazolidine-4-carboxylic acid | Boc-(4S,2RS)-2-phenylthiazolidine-4-carboxylic acid | Boc-(R)-5,5-dimethylthiazolidine-4-carboxylic acid | Boc-(R)-5,5-dimethylthiazolidine-4-carboxylic acid | Boc-(R)-thiazolidine-2-carboxylic acid | Boc-(R)-thiazolidine-2-carboxylic acid | Boc-(R)-thiazolidine-4-carboxylic acid | Boc-(R)-thiazolidine-4-carboxylic acid | Boc-(S)-azetidine-2-carboxylic acid | Boc-(S)-azetidine-2-carboxylic acid | Boc-(S)-thiazolidine-4-carboxylic acid | Boc-(S)-thiazolidine-4-carboxylic acid | Boc-3,4-dehydro-L-proline | Boc-3,4-dehydro-L-proline | Boc-cis-4-amino-L-proline methyl ester hydrochloride salt | Boc-cis-4-amino-L-proline methyl ester hydrochloride salt | Boc-cis-4-cyano-L-proline methyl ester | Boc-cis-4-cyano-L-proline methyl ester | Boc-cis-4-Fluoro-L-proline | Boc-cis-4-Fluoro-L-proline | Boc-cis-4-Hydroxy-D-proline | Boc-cis-4-Hydroxy-D-proline | Boc-thiazolidine-2-carboxylic acid | Boc-thiazolidine-2-carboxylic acid | Boc-trans-4-amino-L-proline methyl ester hydrochloride salt | Boc-trans-4-amino-L-proline methyl ester hydrochloride salt | Boc-trans-4-cyano-L-proline methyl ester | Boc-trans-4-cyano-L-proline methyl ester | Boc-trans-4-Fluoro-L-proline | Boc-trans-4-Fluoro-L-proline | Boc-trans-4-Hydroxy-D-proline | Boc-trans-4-Hydroxy-D-proline | Fmoc-(2R,5S)-5-phenyl-pyrrolidine-2-carboxylic acid | Fmoc-(2R,5S)-5-phenyl-pyrrolidine-2-carboxylic acid | Fmoc-(2S, 4R)-4-benzyl-pyrrolidine-2-carboxylic acid | Fmoc-(2S, 4R)-4-benzyl-pyrrolidine-2-carboxylic acid | Fmoc-(2S,3aS,7aS)-Octahydro-1H-indole-2-carboxylic acid | Fmoc-(2S,3aS,7aS)-Octahydro-1H-indole-2-carboxylic acid | Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid | Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid | Fmoc-(2S,3S)-3-hydroxypyrrolidine-2-carboxylic acid | Fmoc-(2S,3S)-3-hydroxypyrrolidine-2-carboxylic acid | Fmoc-(2S,3S)-3-hydroxypyrrolidine-2-carboxylic acid | Fmoc-(2S,4R)-(-)-4-hydroxypyrrolidine-2-carboxylic acid | Fmoc-(2S,4R)-(-)-4-hydroxypyrrolidine-2-carboxylic acid | Fmoc-(2S,4R)-(-)-4-t-butoxypyrrolidine-2-carboxylic acid | Fmoc-(2S,4R)-(-)-4-t-butoxypyrrolidine-2-carboxylic acid | Fmoc-(2S,4S)-(-)-4-hydroxypyrrolidine-2-carboxylic acid | Fmoc-(2S,4S)-(-)-4-hydroxypyrrolidine-2-carboxylic acid | Fmoc-(2S,4S)-4-phenyl-pyrrolidine-2-carboxylic acid | Fmoc-(2S,4S)-4-phenyl-pyrrolidine-2-carboxylic acid | Fmoc-(2S,5R)-5-phenyl-pyrrolidine-2-carboxylic acid | Fmoc-(2S,5R)-5-phenyl-pyrrolidine-2-carboxylic acid | Fmoc-(4S,2RS)-2-ethylthiazolidine-4-carboxylic acid | Fmoc-(4S,2RS)-2-ethylthiazolidine-4-carboxylic acid | Fmoc-(4S,2RS)-2-methylthiazolidine-4-carboxylic acid | Fmoc-(4S,2RS)-2-methylthiazolidine-4-carboxylic acid | Fmoc-(4S,2RS)-2-phenylthiazolidine-4-carboxylic acid | Fmoc-(4S,2RS)-2-phenylthiazolidine-4-carboxylic acid | Fmoc-(R)-5,5-dimethylthiazolidine-4-carboxylic acid | Fmoc-(R)-5,5-dimethylthiazolidine-4-carboxylic acid | Fmoc-(R)-thiazolidine-2-carboxylic acid | Fmoc-(R)-thiazolidine-2-carboxylic acid | Fmoc-(R)-thiazolidine-4-carboxylic acid | Fmoc-(R)-thiazolidine-4-carboxylic acid | Fmoc-(S)-azetidine-2-carboxylic acid | Fmoc-(S)-azetidine-2-carboxylic acid | Fmoc-(S)-thiazolidine-4-carboxylic acid | Fmoc-(S)-thiazolidine-4-carboxylic acid | Fmoc-3,4-dehydro-L-proline | Fmoc-3,4-dehydro-L-proline | Fmoc-cis-4-Fluoro-L-proline | Fmoc-cis-4-Fluoro-L-proline | Fmoc-cis-4-Hydroxy-D-proline | Fmoc-cis-4-Hydroxy-D-proline | Fmoc-thiazolidine-2-carboxylic acid | Fmoc-thiazolidine-2-carboxylic acid | Fmoc-trans-4-Fluoro-L-proline | Fmoc-trans-4-Fluoro-L-proline | Fmoc-trans-4-Hydroxy-D-proline | Fmoc-trans-4-Hydroxy-D-proline |
| Analogs of Serine, Threonine, and Statine | Boc-(2R,3R)-3-amino-2-hydroxy-5-methylhexanoic acid | Boc-(2R,3R)-3-amino-2-hydroxy-5-methylhexanoic acid | Boc-(2R,3R)-3-amino-2-hydroxy-5-methylhexanoic acid | Boc-(2R,3S)-2-amino-3-hydroxy-4-methylpentanoic acid | Boc-(2R,3S)-2-amino-3-hydroxy-4-methylpentanoic acid | Boc-(2R,3S)-3-amino-2-hydroxy-5-methylhexanoic acid | Boc-(2R,3S)-3-amino-2-hydroxy-5-methylhexanoic acid | Boc-(2R,3S)-3-amino-2-hydroxy-5-methylhexanoic acid | Boc-(2S,3R)-3-amino-2-hydroxy-5-methylhexanoic acid | Boc-(2S,3R)-3-amino-2-hydroxy-5-methylhexanoic acid | Boc-(2S,3R)-3-amino-2-hydroxy-5-methylhexanoic acid | Boc-(2S,3RS)-2-amino-3-hydroxy-4-methylpentanoic acid | Boc-(2S,3RS)-2-amino-3-hydroxy-4-methylpentanoic acid | Boc-(2S,3S)-2-amino-3-ethoxybutanoic acid | Boc-(2S,3S)-2-amino-3-ethoxybutanoic acid | Boc-(2S,3S)-2-amino-3-methoxybutanoic acid | Boc-(2S,3S)-2-amino-3-methoxybutanoic acid | Boc-(2S,3S)-3-amino-2-hydroxy-5-methylhexanoic acid | Boc-(2S,3S)-3-amino-2-hydroxy-5-methylhexanoic acid | Boc-(2S,3S)-3-amino-2-hydroxy-5-methylhexanoic acid | Boc-(3S,4S)-4-amino-3-hydroxy-6-methylheptanoic acid | Boc-(3S,4S)-4-amino-3-hydroxy-6-methylheptanoic acid | Boc-(R)-2-amino-3-benzyloxypropionic acid | Boc-(R)-2-amino-3-benzyloxypropionic acid | Boc-(R)-2-amino-3-hydroxy-3-methylbutanoic acid | Boc-(R)-2-amino-3-hydroxy-3-methylbutanoic acid | Boc-(RS)-2-amino-3-hydroxy-3-methylbutanoic acid | Boc-(RS)-2-amino-3-hydroxy-3-methylbutanoic acid | Boc-(S)-2-amino-3-benzyloxypropionic acid | Boc-(S)-2-amino-3-benzyloxypropionic acid | Boc-(S)-2-amino-3-ethoxypropionic acid | Boc-(S)-2-amino-3-ethoxypropionic acid | Boc-(S)-2-amino-3-hydroxy-3-methylbutanoic acid | Boc-(S)-2-amino-3-hydroxy-3-methylbutanoic acid | Boc-(S)-2-amino-3-methoxypropionic acid | Boc-(S)-2-amino-3-methoxypropionic acid | Boc-2-amino-3-hydroxypentanoic acid | Boc-2-amino-3-hydroxypentanoic acid | Boc-2-amino-3-methoxybutanoic acid | Boc-2-amino-3-methoxybutanoic acid | Boc-2-amino-3-methoxypropionic acid | Boc-2-amino-3-methoxypropionic acid | Boc-2-amino-3-methoxypropionic acid | Boc-2-amino-4-benzyloxybutanoic acid | Boc-2-amino-4-benzyloxybutanoic acid | Boc-4-amino-3-hydroxybutanoic acid | Boc-4-amino-3-hydroxybutanoic acid | Boc-D-α-methylserine | Boc-D-α-methylserine | Boc-DL-2-amino-4-benzyloxybutanoic acid | Boc-DL-2-amino-4-benzyloxybutanoic acid | Boc-L-α-methylserine | Boc-L-α-methylserine | Fmoc-(2R,3R)-3-amino-2-hydroxy-5-methylhexanoic acid | Fmoc-(2R,3R)-3-amino-2-hydroxy-5-methylhexanoic acid | Fmoc-(2R,3R)-3-amino-2-hydroxy-5-methylhexanoic acid | Fmoc-(2R,3S)-2-amino-3-hydroxy-4-methylpentanoic acid | Fmoc-(2R,3S)-2-amino-3-hydroxy-4-methylpentanoic acid | Fmoc-(2R,3S)-3-amino-2-hydroxy-5-methylhexanoic acid | Fmoc-(2R,3S)-3-amino-2-hydroxy-5-methylhexanoic acid | Fmoc-(2R,3S)-3-amino-2-hydroxy-5-methylhexanoic acid | Fmoc-(2S,3R)-3-amino-2-hydroxy-5-methylhexanoic acid | Fmoc-(2S,3R)-3-amino-2-hydroxy-5-methylhexanoic acid | Fmoc-(2S,3R)-3-amino-2-hydroxy-5-methylhexanoic acid | Fmoc-(2S,3RS)-2-amino-3-hydroxy-4-methylpentanoic acid | Fmoc-(2S,3RS)-2-amino-3-hydroxy-4-methylpentanoic acid | Fmoc-(2S,3S)-2-amino-3-ethoxybutanoic acid | Fmoc-(2S,3S)-2-amino-3-ethoxybutanoic acid | Fmoc-(2S,3S)-2-amino-3-methoxybutanoic acid | Fmoc-(2S,3S)-2-amino-3-methoxybutanoic acid | Fmoc-(2S,3S)-3-amino-2-hydroxy-5-methylhexanoic acid | Fmoc-(2S,3S)-3-amino-2-hydroxy-5-methylhexanoic acid | Fmoc-(2S,3S)-3-amino-2-hydroxy-5-methylhexanoic acid | Fmoc-(3S,4S)-4-amino-3-hydroxy-6-methylheptanoic acid | Fmoc-(3S,4S)-4-amino-3-hydroxy-6-methylheptanoic acid | Fmoc-(3S,4S)-4-amino-3-hydroxy-6-methylheptanoic acid | Fmoc-(R)-2-amino-3-benzyloxypropionic acid | Fmoc-(R)-2-amino-3-benzyloxypropionic acid | Fmoc-(R)-2-amino-3-hydroxy-3-methylbutanoic acid | Fmoc-(R)-2-amino-3-hydroxy-3-methylbutanoic acid | Fmoc-(RS)-2-amino-3-hydroxy-3-methylbutanoic acid | Fmoc-(RS)-2-amino-3-hydroxy-3-methylbutanoic acid | Fmoc-(S)-2-amino-3-benzyloxypropionic acid | Fmoc-(S)-2-amino-3-benzyloxypropionic acid | Fmoc-(S)-2-amino-3-ethoxypropionic acid | Fmoc-(S)-2-amino-3-ethoxypropionic acid | Fmoc-(S)-2-amino-3-hydroxy-3-methylbutanoic acid | Fmoc-(S)-2-amino-3-hydroxy-3-methylbutanoic acid | Fmoc-(S)-2-amino-3-methoxypropionic acid | Fmoc-(S)-2-amino-3-methoxypropionic acid | Fmoc-2-amino-3-hydroxypentanoic acid | Fmoc-2-amino-3-hydroxypentanoic acid | Fmoc-2-amino-3-methoxybutanoic acid | Fmoc-2-amino-3-methoxybutanoic acid | Fmoc-2-amino-3-methoxypropionic acid | Fmoc-2-amino-3-methoxypropionic acid | Fmoc-2-amino-3-methoxypropionic acid | Fmoc-2-amino-4-trityloxybutanoic acid | Fmoc-2-amino-4-trityloxybutanoic acid | Fmoc-4-amino-3-hydroxybutanoic acid | Fmoc-4-amino-3-hydroxybutanoic acid | Fmoc-D-α-methylserine | Fmoc-D-α-methylserine | Fmoc-D-Ser[PO(OBzl)-OH]-OH | Fmoc-D-Ser[PO(OBzl)-OH]-OH | Fmoc-D-Thr[PO(OBzl)-OH]-OH | Fmoc-D-Thr[PO(OBzl)-OH]-OH | Fmoc-DL-2-amino-4-trityloxybutanoic acid | Fmoc-DL-2-amino-4-trityloxybutanoic acid | Fmoc-L-α-methylserine | Fmoc-L-α-methylserine | Fmoc-Ser[PO(OBzl)-OH]-OH | Fmoc-Ser[PO(OBzl)-OH]-OH | Fmoc-Ser[PO(OBzl)-OH]-OH | Fmoc-Ser[PO(OBzl)-OH]-OH | Fmoc-Ser[PO(OBzl)-OH]-OH | Fmoc-Ser[PO(OBzl)-OH]-OH | Fmoc-Ser[PO(OBzl)-OH]-OH | Fmoc-Thr[PO(OBzl)-OH]-OH | Fmoc-Thr[PO(OBzl)-OH]-OH | Fmoc-Thr[PO(OBzl)-OH]-OH | Fmoc-Thr[PO(OBzl)-OH]-OH | Fmoc-Thr[PO(OBzl)-OH]-OH |
| Analogs of Tryptophan | Boc-α-methyl-DL-tryptophan | Boc-α-methyl-DL-tryptophan | Boc-β-(3-benzothienyl)-D-alanine | Boc-β-(3-benzothienyl)-D-alanine | Boc-β-(3-benzothienyl)-L-alanine | Boc-β-(3-benzothienyl)-L-alanine | Boc-1-methyl-DL-tryptophan | Boc-1-methyl-DL-tryptophan | Boc-4-methyl-DL-tryptophan | Boc-4-methyl-DL-tryptophan | Boc-5-benzyloxy-DL-tryptophan | Boc-5-benzyloxy-DL-tryptophan | Boc-5-bromo-DL-tryptophan | Boc-5-bromo-DL-tryptophan | Boc-5-chloro-DL-tryptophan | Boc-5-chloro-DL-tryptophan | Boc-5-fluoro-DL-tryptophan | Boc-5-fluoro-DL-tryptophan | Boc-5-hydroxy-DL-tryptophan | Boc-5-hydroxy-DL-tryptophan | Boc-5-hydroxy-L-tryptophan | Boc-5-hydroxy-L-tryptophan | Boc-5-methoxy-DL-tryptophan | Boc-5-methoxy-DL-tryptophan | Boc-5-methoxy-L-tryptophan | Boc-5-methoxy-L-tryptophan | Boc-5-methyl-DL-tryptophan | Boc-5-methyl-DL-tryptophan | Boc-6-bromo-DL-tryptophan | Boc-6-bromo-DL-tryptophan | Boc-6-chloro-D-tryptophan | Boc-6-chloro-D-tryptophan | Boc-6-chloro-DL-tryptophan | Boc-6-chloro-DL-tryptophan | Boc-6-fluoro-DL-tryptophan | Boc-6-fluoro-DL-tryptophan | Boc-6-methyl-DL-tryptophan | Boc-6-methyl-DL-tryptophan | Boc-7-benzyloxy-DL-tryptophan | Boc-7-benzyloxy-DL-tryptophan | Boc-7-bromo-DL-tryptophan | Boc-7-bromo-DL-tryptophan | Boc-7-methyl-DL-tryptophan | Boc-7-methyl-DL-tryptophan | Boc-D-1,2,3,4-tetrahydro-norharman-3-carboxylic acid | Boc-D-1,2,3,4-tetrahydro-norharman-3-carboxylic acid | Boc-DL-6-methoxy-1,2,3,4-tetrahydronorharman-1-carboxylic acid | Boc-DL-6-methoxy-1,2,3,4-tetrahydronorharman-1-carboxylic acid | Boc-DL-7-azatryptophan | Boc-DL-7-azatryptophan | Boc-L-1,2,3,4-tetrahydro-norharman-3-carboxylic acid | Boc-L-1,2,3,4-tetrahydro-norharman-3-carboxylic acid | Fmoc-α -methyl-DL-tryptophan | Fmoc-α-methyl-DL-tryptophan | Fmoc-β-(3-benzothienyl)-D-alanine | Fmoc-β-(3-benzothienyl)-D-alanine | Fmoc-β-(3-benzothienyl)-L-alanine | Fmoc-β-(3-benzothienyl)-L-alanine | Fmoc-(R)-7-Azatryptophan | Fmoc-(R)-7-Azatryptophan | Fmoc-(R)-7-Azatryptophan | Fmoc-(S)-7-Azatryptophan | Fmoc-(S)-7-Azatryptophan | Fmoc-(S)-7-Azatryptophan | Fmoc-1-methyl-DL-tryptophan | Fmoc-1-methyl-DL-tryptophan | Fmoc-4-methyl-DL-tryptophan | Fmoc-4-methyl-DL-tryptophan | Fmoc-5-benzyloxy-DL-tryptophan | Fmoc-5-benzyloxy-DL-tryptophan | Fmoc-5-bromo-DL-tryptophan | Fmoc-5-bromo-DL-tryptophan | Fmoc-5-chloro-DL-tryptophan | Fmoc-5-chloro-DL-tryptophan | Fmoc-5-fluoro-DL-tryptophan | Fmoc-5-fluoro-DL-tryptophan | Fmoc-5-hydroxy-DL-tryptophan | Fmoc-5-hydroxy-DL-tryptophan | Fmoc-5-hydroxy-L-tryptophan | Fmoc-5-hydroxy-L-tryptophan | Fmoc-5-methoxy-2-methyl-DL-tryptophan | Fmoc-5-methoxy-2-methyl-DL-tryptophan | Fmoc-5-methoxy-DL-tryptophan | Fmoc-5-methoxy-DL-tryptophan | Fmoc-5-methoxy-L-tryptophan | Fmoc-5-methoxy-L-tryptophan | Fmoc-5-methyl-DL-tryptophan | Fmoc-5-methyl-DL-tryptophan | Fmoc-6-bromo-DL-tryptophan | Fmoc-6-bromo-DL-tryptophan | Fmoc-6-chloro-D-tryptophan | Fmoc-6-chloro-D-tryptophan | Fmoc-6-chloro-DL-tryptophan | Fmoc-6-chloro-DL-tryptophan | Fmoc-6-chloro-L-tryptophan | Fmoc-6-chloro-L-tryptophan | Fmoc-6-fluoro-DL-tryptophan | Fmoc-6-fluoro-DL-tryptophan | Fmoc-6-methyl-DL-tryptophan | Fmoc-6-methyl-DL-tryptophan | Fmoc-7-benzyloxy-DL-tryptophan | Fmoc-7-benzyloxy-DL-tryptophan | Fmoc-7-bromo-DL-tryptophan | Fmoc-7-bromo-DL-tryptophan | Fmoc-7-methyl-DL-tryptophan | Fmoc-7-methyl-DL-tryptophan | Fmoc-D-1,2,3,4-tetrahydro-norharman-3-carboxylic acid | Fmoc-D-1,2,3,4-tetrahydro-norharman-3-carboxylic acid | Fmoc-DL-6-methoxy-1,2,3,4-tetrahydronorharman-1-carboxylic acid | Fmoc-DL-6-methoxy-1,2,3,4-tetrahydronorharman-1-carboxylic acid | Fmoc-DL-7-azatryptophan | Fmoc-DL-7-azatryptophan | Fmoc-L-1,2,3,4-tetrahydro-norharman-3-carboxylic acid | Fmoc-L-1,2,3,4-tetrahydro-norharman-3-carboxylic acid |
| Aromatic Amino Acids | | Azide and Alkyne containing Amino Acids | | Building Blocks for Stapled Peptides | | Depsipeptides | | Dye-labeled Amino Acids | | Heterocyclic Amino Acids | (1-Boc-piperidin-3-yl)acetic acid | (1-Boc-piperidin-3-yl)acetic acid | (1-Fmoc-piperidin-3-yl)acetic acid | (1-Fmoc-piperidin-3-yl)acetic acid | 3-(1-Boc-piperidine-4-yl)-propionic acid | 3-(1-Boc-piperidine-4-yl)-propionic acid | 3-(1-Fmoc-piperidine-4-yl)-propionic acid | 3-(1-Fmoc-piperidine-4-yl)-propionic acid | 4-(1-Boc-piperidine-4-yl)-butanoic acid | 4-(1-Boc-piperidine-4-yl)-butanoic acid | 4-(1-Fmoc-piperidine-4-yl)-butanoic acid | 4-(1-Fmoc-piperidine-4-yl)-butanoic acid | Boc-(4-carboxymethyl)-piperidine | Boc-(4-carboxymethyl)-piperidine | Boc-(4-carboxymethyl)piperazine | Boc-(4-carboxymethyl)piperazine | Boc-(R)-(+)-piperidine-2-carboxylic acid | Boc-(R)-(+)-piperidine-2-carboxylic acid | Boc-(R)-nipecotic acid | Boc-(R)-nipecotic acid | Boc-(RS)-piperidine-2-carboxylic acid | Boc-(RS)-piperidine-2-carboxylic acid | Boc-(S)-(-)-piperidine-2-carboxylic acid | Boc-(S)-(-)-piperidine-2-carboxylic acid | Boc-(S)-azetidine-2-carboxylic acid | Boc-(S)-azetidine-2-carboxylic acid | Boc-(S)-nipecotic acid | Boc-(S)-nipecotic acid | Boc-1-amino-1,2,3,4-tetrahydro-naphthalene-1-carboxylic acid | Boc-1-amino-1,2,3,4-tetrahydro-naphthalene-1-carboxylic acid | Boc-1-aminoindan-1-carboxylic acid | Boc-1-aminoindan-1-carboxylic acid | Boc-1-pyrrolidine-3-carboxylic acid | Boc-1-pyrrolidine-3-carboxylic acid | Boc-2-amino-1,2,3,4-tetrahydro-naphthalene-2-carboxylic acid | Boc-2-amino-1,2,3,4-tetrahydro-naphthalene-2-carboxylic acid | Boc-2-carboxypiperazine | Boc-2-carboxypiperazine | Boc-3-azabicyclo[3.1.0]hexane-2-carboxylic acid | Boc-3-azabicyclo[3.1.0]hexane-2-carboxylic acid | Boc-3-carboxypiperidine | Boc-3-carboxypiperidine | Boc-4-amino-(1-carboxymethyl) piperidine | Boc-4-amino-(1-carboxymethyl) piperidine | Boc-4-phenylpiperidine-4-carboxylic acid | Boc-4-phenylpiperidine-4-carboxylic acid | Boc-azetidine-3-carboxylic acid | Boc-azetidine-3-carboxylic acid | Boc-L-indoline-2-carboxylic acid | Boc-L-indoline-2-carboxylic acid | Boc-piperidine-4-carboxylic acid | Boc-piperidine-4-carboxylic acid | Fmoc-(4-carboxymethyl)-piperidine | Fmoc-(4-carboxymethyl)-piperidine | Fmoc-(4-carboxymethyl)piperazine | Fmoc-(4-carboxymethyl)piperazine | Fmoc-(R)-(+)-piperidine-2-carboxylic acid | Fmoc-(R)-(+)-piperidine-2-carboxylic acid | Fmoc-(R)-nipecotic acid | Fmoc-(R)-nipecotic acid | Fmoc-(RS)-piperidine-2-carboxylic acid | Fmoc-(RS)-piperidine-2-carboxylic acid | Fmoc-(S)-(-)-piperidine-2-carboxylic acid | Fmoc-(S)-(-)-piperidine-2-carboxylic acid | Fmoc-(S)-azetidine-2-carboxylic acid | Fmoc-(S)-azetidine-2-carboxylic acid | Fmoc-(S)-nipecotic acid | Fmoc-(S)-nipecotic acid | Fmoc-1-amino-1,2,3,4-tetrahydro-naphthalene-1-carboxylic acid | Fmoc-1-amino-1,2,3,4-tetrahydro-naphthalene-1-carboxylic acid | Fmoc-1-aminoindan-1-carboxylic acid | Fmoc-1-aminoindan-1-carboxylic acid | Fmoc-1-pyrrolidine-3-carboxylic acid | Fmoc-1-pyrrolidine-3-carboxylic acid | Fmoc-2-amino-1,2,3,4-tetrahydro-naphthalene-2-carboxylic acid | Fmoc-2-amino-1,2,3,4-tetrahydro-naphthalene-2-carboxylic acid | Fmoc-2-aminothiazole-4-acetic acid | Fmoc-2-aminothiazole-4-acetic acid | Fmoc-2-carboxypiperazine | Fmoc-2-carboxypiperazine | Fmoc-3-azabicyclo[3.1.0]hexane-2-carboxylic acid | Fmoc-3-azabicyclo[3.1.0]hexane-2-carboxylic acid | Fmoc-3-carboxypiperidine | Fmoc-3-carboxypiperidine | Fmoc-4-(2-aminoethyl)-(1-carboxy-methyl)piperazine dihydrochloride | Fmoc-4-(2-aminoethyl)-(1-carboxy-methyl)piperazine dihydrochloride | Fmoc-4-amino-(1-carboxymethyl) piperidine | Fmoc-4-amino-(1-carboxymethyl) piperidine | Fmoc-4-phenylpiperidine-4-carboxylic acid | Fmoc-4-phenylpiperidine-4-carboxylic acid | Fmoc-azetidine-3-carboxylic acid | Fmoc-azetidine-3-carboxylic acid | Fmoc-L-indoline-2-carboxylic acid | Fmoc-L-indoline-2-carboxylic acid | Fmoc-piperidine-4-carboxylic acid | Fmoc-piperidine-4-carboxylic acid | N-(1-Boc-piperidine-4-yl)-L-proline | N-(1-Boc-piperidine-4-yl)-L-proline | N-(1-Fmoc-piperidine-4-yl)-L-proline | N-(1-Fmoc-piperidine-4-yl)-L-proline | N-1-Boc-3-aminopiperidine | N-1-Boc-3-aminopiperidine | N-Boc-3-hydroxy-1,2,3,6-tetrahydropyridine | N-Boc-3-hydroxy-1,2,3,6-tetrahydropyridine | N-Boc-3-hydroxy-1,2,3,6-tetrahydropyridine |
| N-α-Methyl Amino Acids | | PEGylated Amino Acids | | PTM Building Blocks | |
|
| AnaTag™ Protein Labeling Kits | | Antibodies | Antibodies by Target Protein | Actin Antibodies | Anti-Actin (alpha Smooth muscle specific), AMCA-labeled | Anti-Actin (alpha Smooth muscle specific), Biotinylated | Anti-Actin (alpha Smooth muscle specific), FAM-labeled | Anti-Actin (alpha Smooth muscle specific), FITC-labeled | Anti-Actin (alpha Smooth muscle specific), HiLyte Fluor™ 405-labeled | Anti-Actin (alpha Smooth muscle specific), HiLyte Fluor™ 488-labeled | Anti-Actin (alpha Smooth muscle specific), HiLyte Fluor™ 555-labeled | Anti-Actin (alpha Smooth muscle specific), HiLyte Fluor™ 594-labeled | Anti-Actin (alpha Smooth muscle specific), HiLyte Fluor™ 647-labeled | Anti-Actin (alpha Smooth muscle specific), HiLyte Fluor™ TR-labeled | Anti-Actin (alpha Smooth muscle specific), TAMRA-Labeled | Anti-Actin antibody, alpha smooth muscle, polyclonal | Anti-Actin-beta (CT), Z-Fish™ | Anti-Actin-beta (CT), Z-Fish™ | Anti-Actin-beta (NT), Z-Fish™ | Anti-Actin-beta (NT), Z-Fish™ | Anti-beta-Actin (CT) Antibody polyclonal | Anti-beta-Actin (NT) Antibody, polyclonal |
| AIF Antibodies | | Bax Antibodies | | Bcl 2 Antibodies | | Calpain Antibodies | | Caspase Antibodies | | Cathepsin Antibodies | | CD8 Antibodies | | HMGB1 Antibodies | | HSP Antibodies | | Keratin Antibodies | | MyD88 Antibodies | | p53 Antibodies | | PCNA Antibodies | | RET Antibodies | | TGF beta Antibodies | |
| Cell and Tissue Lysate | | Labeled Primary Antibodies | 54902 Anti-Mouse H-2K^b/H-2D^b (Bio) | Anti-Actin (alpha Smooth muscle specific), AMCA-labeled | Anti-Actin (alpha Smooth muscle specific), Biotinylated | Anti-Actin (alpha Smooth muscle specific), FAM-labeled | Anti-Actin (alpha Smooth muscle specific), FITC-labeled | Anti-Actin (alpha Smooth muscle specific), HiLyte Fluor™ 405-labeled | Anti-Actin (alpha Smooth muscle specific), HiLyte Fluor™ 488-labeled | Anti-Actin (alpha Smooth muscle specific), HiLyte Fluor™ 555-labeled | Anti-Actin (alpha Smooth muscle specific), HiLyte Fluor™ 594-labeled | Anti-Actin (alpha Smooth muscle specific), HiLyte Fluor™ 647-labeled | Anti-Actin (alpha Smooth muscle specific), HiLyte Fluor™ TR-labeled | Anti-Actin (alpha Smooth muscle specific), TAMRA-Labeled | Anti-Actin antibody, alpha smooth muscle, polyclonal | Anti-GST Tag, AMCA labeled | Anti-GST Tag, Biotinylated | Anti-GST Tag, FAM labeled | Anti-GST Tag, FITC labeled | Anti-GST Tag, HiLyte Fluor™ 405 labeled | Anti-GST Tag, HiLyte Fluor™ 488 labeled | Anti-GST Tag, HiLyte Fluor™ 555 labeled | Anti-GST Tag, HiLyte Fluor™ 594-labeled | Anti-GST Tag, HiLyte Fluor™ 647 labeled | Anti-GST Tag, ROX labeled | Anti-GST Tag, TAMRA labeled | Monoclonal Anti-His Tag IgG, AMCA labeled | Monoclonal Anti-His Tag IgG, Biotinylated | Monoclonal Anti-His Tag IgG, FAM labeled | Monoclonal Anti-His Tag IgG, FITC labeled | Monoclonal Anti-His Tag IgG, HiLyte Fluor™ 405-labeled | Monoclonal Anti-His Tag IgG, HiLyte Fluor™ 488 labeled | Monoclonal Anti-His Tag IgG, HiLyte Fluor™ 555 labeled | Monoclonal anti-His Tag IgG, HiLyte Fluor™ 594-labeled | Monoclonal Anti-His Tag IgG, HiLyte Fluor™ 647 labeled | Monoclonal Anti-His Tag IgG, ROX labeled | Monoclonal Anti-His Tag IgG, TAMRA labeled | Polyclonal Anti-His Tag IgG, Biotinylated | Polyclonal Anti-His Tag IgG, FITC labeled | Polyclonal Anti-His Tag IgG, HiLyte Fluor™ 405-labeled | Polyclonal Anti-His Tag IgG, HiLyte Fluor™ 488 labeled | Polyclonal Anti-His Tag IgG, HiLyte Fluor™ 555 labeled | Polyclonal Anti-His Tag IgG, HiLyte Fluor™ 594 labeled | Polyclonal Anti-His Tag IgG, HiLyte Fluor™ 647 labeled |
| Labeled Secondary Antibodies | Goat anti-mouse IgG (H+L), AMCA-labeled | Goat anti-mouse IgG (H+L), AMCA-labeled | Goat anti-mouse IgG (H+L), AP-conjugated | Goat anti-mouse IgG (H+L), Biotinylated | Goat anti-mouse IgG (H+L), Biotinylated | Goat anti-mouse IgG (H+L), FAM-labeled | Goat anti-mouse IgG (H+L), FAM-labeled | Goat anti-mouse IgG (H+L), FITC-labeled | Goat anti-mouse IgG (H+L), FITC-labeled | Goat anti-mouse IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 405-labeled | Goat anti-mouse IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 405-labeled | Goat anti-mouse IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 488-labeled | Goat anti-mouse IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 488-labeled | Goat anti-mouse IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 555-labeled | Goat anti-mouse IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 555-labeled | Goat anti-mouse IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 594-labeled | Goat anti-mouse IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 594-labeled | Goat anti-mouse IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 647-labeled | Goat anti-mouse IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 647-labeled | Goat anti-mouse IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 680-labeled | Goat anti-mouse IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 680-labeled | Goat anti-mouse IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 750-labeled | Goat anti-mouse IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 750-labeled | Goat anti-mouse IgG (H+L), HiLyte Fluor™ 405-labeled | Goat anti-mouse IgG (H+L), HiLyte Fluor™ 405-labeled | Goat anti-mouse IgG (H+L), HiLyte Fluor™ 488-labeled | Goat anti-mouse IgG (H+L), HiLyte Fluor™ 488-labeled | Goat anti-mouse IgG (H+L), HiLyte Fluor™ 555-labeled | Goat anti-mouse IgG (H+L), HiLyte Fluor™ 555-labeled | Goat anti-mouse IgG (H+L), HiLyte Fluor™ 594-labeled | Goat anti-mouse IgG (H+L), HiLyte Fluor™ 594-labeled | Goat anti-mouse IgG (H+L), HiLyte Fluor™ 647-labeled | Goat anti-mouse IgG (H+L), HiLyte Fluor™ 647-labeled | Goat anti-mouse IgG (H+L), HiLyte Fluor™ 680-labeled | Goat anti-mouse IgG (H+L), HiLyte Fluor™ 680-labeled | Goat anti-mouse IgG (H+L), HiLyte Fluor™ 750-labeled | Goat anti-mouse IgG (H+L), HiLyte Fluor™ 750-labeled | Goat anti-mouse IgG (H+L), HRP-conjugated | Goat anti-mouse IgG (H+L), TAMRA-labeled | Goat anti-mouse IgG (H+L), TAMRA-labeled | Goat anti-rabbit IgG (H+L), AMCA-labeled | Goat anti-rabbit IgG (H+L), AMCA-labeled | Goat anti-rabbit IgG (H+L), AP-conjugated | Goat anti-rabbit IgG (H+L), Biotinylated | Goat anti-rabbit IgG (H+L), Biotinylated | Goat anti-rabbit IgG (H+L), FAM-labeled | Goat anti-rabbit IgG (H+L), FAM-labeled | Goat anti-rabbit IgG (H+L), FITC-labeled | Goat anti-rabbit IgG (H+L), FITC-labeled | Goat anti-rabbit IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 405-labeled | Goat anti-rabbit IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 405-labeled | Goat anti-rabbit IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 488-labeled | Goat anti-rabbit IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 488-labeled | Goat anti-rabbit IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 555-labeled | Goat anti-rabbit IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 555-labeled | Goat anti-rabbit IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 594-labeled | Goat anti-rabbit IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 594-labeled | Goat anti-rabbit IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 647-labeled | Goat anti-rabbit IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 647-labeled | Goat anti-rabbit IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 680-labeled | Goat anti-rabbit IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 680-labeled | Goat anti-rabbit IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 750-labeled | Goat anti-rabbit IgG (H+L), highly cross-adsorbed, HiLyte Fluor™ 750-labeled | Goat anti-rabbit IgG (H+L), HiLyte Fluor™ 405-labeled | Goat anti-rabbit IgG (H+L), HiLyte Fluor™ 405-labeled | Goat anti-rabbit IgG (H+L), HiLyte Fluor™ 488-labeled | Goat anti-rabbit IgG (H+L), HiLyte Fluor™ 488-labeled | Goat anti-rabbit IgG (H+L), HiLyte Fluor™ 555-labeled | Goat anti-rabbit IgG (H+L), HiLyte Fluor™ 555-labeled | Goat anti-rabbit IgG (H+L), HiLyte Fluor™ 594-labeled | Goat anti-rabbit IgG (H+L), HiLyte Fluor™ 594-labeled | Goat anti-rabbit IgG (H+L), HiLyte Fluor™ 647-labeled | Goat anti-rabbit IgG (H+L), HiLyte Fluor™ 647-labeled | Goat anti-rabbit IgG (H+L), HiLyte Fluor™ 680-labeled | Goat anti-rabbit IgG (H+L), HiLyte Fluor™ 680-labeled | Goat anti-rabbit IgG (H+L), HiLyte Fluor™ 750-labeled | Goat anti-rabbit IgG (H+L), HiLyte Fluor™ 750-labeled | Goat anti-rabbit IgG (H+L), HRP-conjugated | Goat anti-rabbit IgG (H+L), TAMRA-labeled | Goat anti-rabbit IgG (H+L), TAMRA-labeled | HiLyte Fluor™ Labeled Secondary Antibody Sampler Kit *Goat anti-mouse and Goat anti-rabbit IgG* | HiLyte Fluor™ Labeled Secondary Antibody Sampler Kit *Goat anti-mouse and Goat anti-rabbit IgG* | HiLyte Fluor™ Labeled Secondary Antibody Sampler Kit *Goat anti-mouse and Goat anti-rabbit IgG, Highly Cross-adsorbed* | HiLyte Fluor™ Labeled Secondary Antibody Sampler Kit *Goat anti-mouse and Goat anti-rabbit IgG, Highly Cross-adsorbed* | HiLyte Fluor™ Labeled Secondary Antibody Sampler Kit *Rabbit anti-mouse and rabbit anti-goat IgG* | HiLyte Fluor™ Labeled Secondary Antibody Sampler Kit *Rabbit anti-mouse and rabbit anti-goat IgG* | Rabbit anti-chicken IgY (H+L), AMCA-labeled | Rabbit anti-chicken IgY (H+L), AMCA-labeled | Rabbit anti-chicken IgY (H+L), AP-conjugated | Rabbit anti-Chicken IgY (H+L), Biotinylated | Rabbit anti-Chicken IgY (H+L), Biotinylated | Rabbit anti-chicken IgY (H+L), FAM-labeled | Rabbit anti-chicken IgY (H+L), FAM-labeled | Rabbit anti-chicken IgY (H+L), FITC-labeled | Rabbit anti-chicken IgY (H+L), FITC-labeled | Rabbit anti-chicken IgY (H+L), HiLyte Fluor™ 405-labeled | Rabbit anti-chicken IgY (H+L), HiLyte Fluor™ 405-labeled | Rabbit anti-chicken IgY (H+L), HiLyte Fluor™ 488-labeled | Rabbit anti-chicken IgY (H+L), HiLyte Fluor™ 488-labeled | Rabbit anti-chicken IgY (H+L), HiLyte Fluor™ 555-labeled | Rabbit anti-chicken IgY (H+L), HiLyte Fluor™ 555-labeled | Rabbit anti-chicken IgY (H+L), HiLyte Fluor™ 594-labeled | Rabbit anti-chicken IgY (H+L), HiLyte Fluor™ 594-labeled | Rabbit anti-chicken IgY (H+L), HiLyte Fluor™ 647-labeled | Rabbit anti-chicken IgY (H+L), HiLyte Fluor™ 647-labeled | Rabbit anti-chicken IgY (H+L), HiLyte Fluor™ 680-labeled | Rabbit anti-chicken IgY (H+L), HiLyte Fluor™ 680-labeled | Rabbit anti-chicken IgY (H+L), HiLyte Fluor™ 750-labeled | Rabbit anti-chicken IgY (H+L), HiLyte Fluor™ 750-labeled | Rabbit anti-Chicken IgY (H+L), HRP-Conjugated | Rabbit anti-chicken IgY (H+L), TAMRA-labeled | Rabbit anti-chicken IgY (H+L), TAMRA-labeled | Rabbit anti-goat IgG (H+L), AMCA-labeled | Rabbit anti-goat IgG (H+L), AMCA-labeled | Rabbit anti-goat IgG (H+L), AP-conjugated | Rabbit anti-goat IgG (H+L), Biotinylated | Rabbit anti-goat IgG (H+L), Biotinylated | Rabbit anti-goat IgG (H+L), FAM-labeled | Rabbit anti-goat IgG (H+L), FAM-labeled | Rabbit anti-goat IgG (H+L), FITC-labeled | Rabbit anti-goat IgG (H+L), FITC-labeled | Rabbit anti-goat IgG (H+L), HiLyte Fluor™ 405-labeled | Rabbit anti-goat IgG (H+L), HiLyte Fluor™ 405-labeled | Rabbit anti-goat IgG (H+L), HiLyte Fluor™ 488-labeled | Rabbit anti-goat IgG (H+L), HiLyte Fluor™ 488-labeled | Rabbit anti-goat IgG (H+L), HiLyte Fluor™ 555-labeled | Rabbit anti-goat IgG (H+L), HiLyte Fluor™ 555-labeled | Rabbit anti-goat IgG (H+L), HiLyte Fluor™ 594-labeled | Rabbit anti-goat IgG (H+L), HiLyte Fluor™ 594-labeled | Rabbit anti-goat IgG (H+L), HiLyte Fluor™ 647-labeled | Rabbit anti-goat IgG (H+L), HiLyte Fluor™ 647-labeled | Rabbit anti-goat IgG (H+L), HiLyte Fluor™ 680-labeled | Rabbit anti-goat IgG (H+L), HiLyte Fluor™ 680-labeled | Rabbit anti-goat IgG (H+L), HiLyte Fluor™ 750-labeled | Rabbit anti-goat IgG (H+L), HiLyte Fluor™ 750-labeled | Rabbit anti-goat IgG (H+L), HRP-Conjugated | Rabbit anti-goat IgG (H+L), TAMRA-labeled | Rabbit anti-goat IgG (H+L), TAMRA-labeled | Rabbit anti-mouse IgG (H+L), AMCA-labeled | Rabbit anti-mouse IgG (H+L), AMCA-labeled | Rabbit anti-mouse IgG (H+L), AP-conjugated | Rabbit anti-mouse IgG (H+L), Biotinylated | Rabbit anti-mouse IgG (H+L), Biotinylated | Rabbit anti-mouse IgG (H+L), FAM-labeled | Rabbit anti-mouse IgG (H+L), FAM-labeled | Rabbit anti-mouse IgG (H+L), FITC-labeled | Rabbit anti-mouse IgG (H+L), FITC-labeled | Rabbit anti-mouse IgG (H+L), HiLyte Fluor™ 405-labeled | Rabbit anti-mouse IgG (H+L), HiLyte Fluor™ 405-labeled | Rabbit anti-mouse IgG (H+L), HiLyte Fluor™ 488-labeled | Rabbit anti-mouse IgG (H+L), HiLyte Fluor™ 488-labeled | Rabbit anti-mouse IgG (H+L), HiLyte Fluor™ 555-labeled | Rabbit anti-mouse IgG (H+L), HiLyte Fluor™ 555-labeled | Rabbit anti-mouse IgG (H+L), HiLyte Fluor™ 594-labeled | Rabbit anti-mouse IgG (H+L), HiLyte Fluor™ 594-labeled | Rabbit anti-mouse IgG (H+L), HiLyte Fluor™ 647-labeled | Rabbit anti-mouse IgG (H+L), HiLyte Fluor™ 647-labeled | Rabbit anti-mouse IgG (H+L), HiLyte Fluor™ 680-labeled | Rabbit anti-mouse IgG (H+L), HiLyte Fluor™ 680-labeled | Rabbit anti-mouse IgG (H+L), HiLyte Fluor™ 750-labeled | Rabbit anti-mouse IgG (H+L), HiLyte Fluor™ 750-labeled | Rabbit anti-mouse IgG (H+L), HRP-conjugated | Rabbit anti-mouse IgG (H+L), TAMRA-labeled |
| Primary Antibodies | Adhesion / Extracellular Matrix | | Alzheimer's Disease | Anti Tau Antibody (GlcNAc Ser400), Rabbit Polyclonal | Anti Tau Antibody (Ser400), Rabbit Polyclonal | Anti-α-Synuclein (paired 87) | Anti-α-Synuclein (pSer 87) | Anti-α-Synuclein (pSer 87) | Anti-β-Amyloid (1-40) | Anti-β-Amyloid (1-40), mouse monoclonal | Anti-β-Amyloid (1-42), mouse monoclonal | Anti-β-Amyloid (NT), human | Anti-14-3-3 zeta | Anti-APP (pThr743) Antibody, polyclonal | Anti-APP (pThr743) Antibody, polyclonal | Anti-APP (Thr743) Antibody, polyclonal | Anti-Tau | Anti-Tau (194-214) | Anti-Tau (194-214) | Anti-Tau (209-226) | Anti-Tau (209-226) | Anti-Tau (393-411) | Anti-Tau (393-411) | Anti-Tau (401-426) | Anti-Tau (401-426) | Anti-Tau (paired181, 184) Blocking Peptide | Anti-Tau (paired198, 199, 202, 205) Blocking Peptide | Anti-Tau (paired212, 214, 217) Blocking Peptide | Anti-Tau (paired231, 235) Blocking Peptide | Anti-Tau (paired237) Blocking Peptide | Anti-Tau (paired262) Blocking Peptide | Anti-Tau (paired356) Blocking Peptide | Anti-Tau (paired396, 400, 404) Blocking Peptide | Anti-Tau (pSer184) Blocking Peptide | Anti-Tau (pSer184), human | Anti-Tau (pSer184), human | Anti-Tau (pSer195) Blocking Peptide | Anti-Tau (pSer195), human | Anti-Tau (pSer195), human | Anti-Tau (pSer198) | Anti-Tau (pSer198) | Anti-Tau (pSer198) Blocking Peptide | Anti-Tau (pSer199, 202) Blocking Peptide | Anti-Tau (pSer199/202) | Anti-Tau (pSer199/202) | Anti-Tau (pSer202) | Anti-Tau (pSer202) | Anti-Tau (pSer202) Blocking Peptide | Anti-Tau (pSer214) | Anti-Tau (pSer214) | Anti-Tau (pSer214) Blocking Peptide | Anti-Tau (pSer235) | Anti-Tau (pSer235) | Anti-Tau (pSer235) Blocking Peptide | Anti-Tau (pSer237) | Anti-Tau (pSer237) | Anti-Tau (pSer237) Blocking Peptide | Anti-Tau (pSer238) | Anti-Tau (pSer238) | Anti-Tau (pSer238) Blocking Peptide | Anti-Tau (pSer262) | Anti-Tau (pSer262) | Anti-Tau (pSer262) Blocking Peptide | Anti-Tau (pSer356) | Anti-Tau (pSer356) | Anti-Tau (pSer356) Blocking Peptide | Anti-Tau (pSer396) | Anti-Tau (pSer396) | Anti-Tau (pSer396) Blocking Peptide | Anti-Tau (pSer400) | Anti-Tau (pSer400) | Anti-Tau (pSer404) | Anti-Tau (pSer404) | Anti-Tau (pSer404) Blocking Peptide | Anti-Tau (pSer409) | Anti-Tau (pSer409) | Anti-Tau (pSer409) Blocking peptide | Anti-Tau (pSer412) | Anti-Tau (pSer412) | Anti-Tau (pSer412) Blocking peptide | Anti-Tau (pSer413) | Anti-Tau (pSer413) | Anti-Tau (pSer413) Blocking Peptide | Anti-Tau (pThr181) | Anti-Tau (pThr181) | Anti-Tau (pThr181) Blocking Peptide | Anti-Tau (pThr205) | Anti-Tau (pThr205) | Anti-Tau (pThr205) Blocking Peptide | Anti-Tau (pThr212) | Anti-Tau (pThr212) | Anti-Tau (pThr212) Blocking Peptide | Anti-Tau (pThr217) | Anti-Tau (pThr217) | Anti-Tau (pThr217) Blocking Peptide | Anti-Tau (pThr231) | Anti-Tau (pThr231) | Anti-Tau (pThr231) Blocking Peptide | Anti-Tau (Ser195) | Anti-Tau (Ser195) | Anti-Tau (Ser202) | Anti-Tau (Ser202) | Anti-Tau (Ser235) | Anti-Tau (Ser235) | Anti-Tau (Ser237) | Anti-Tau (Ser237) | Anti-Tau (Ser262) | Anti-Tau (Ser262) | Anti-Tau (Ser356) | Anti-Tau (Ser356) | Anti-Tau (Ser404) | Anti-Tau (Ser404) | Anti-Tau (Thr181/Ser184) | Anti-Tau (Thr181/Ser184) | Anti-Tau (Thr231) | Anti-Tau (Thr231) |
| Apoptosis / Autophagy | *Anti-Keratin-18 (Asp237), human | *Anti-Keratin-19 (Asp237), human | Anti-AIF (ED2) | Anti-AIM / API6 (NT) | Anti-AIM / API6 (CT) | Anti-APG7 (CT) | Anti-BAX antibody polyclonal | Anti-Bcl-2 (pThr129) | Anti-Bcl-2 (pThr129) | Anti-Bcl-G (CT) | Anti-Beclin-1 (NT) | Anti-Bif /endophilin B1 | Anti-Caspase 3 (p12) | Anti-Caspase 3 (p17) | Anti-Caspase-4 (NT) | Anti-Caspase-5 (IN) | Anti-Caspase-8L | Anti-CIDE-B (IN) | Anti-CRMP1 (CT) | Anti-Cytochrome C, human (polyclonal) | Anti-DcR1 (IN), human | Anti-DcR2 (IN) | Anti-DEFCAP (CT) | Anti-DR5 | Anti-DR5 (IN), human | Anti-DRAM (NT) | Anti-Fas-ligand | Anti-Granzyme B | Anti-LAMP-1 | Anti-LAMP-2 | Anti-LFG | Anti-Noxa | Anti-NOXA (NT), human | Anti-p53 (CT) Antibody | Anti-p53 (paired18/23), mouse | Anti-p53 (paired23), mouse | Anti-p53 (pSer18), mouse | Anti-p53 (pSer18/23), mouse | Anti-p53 (pSer23), mouse | Anti-p63 | Anti-PARP | Anti-PD1 (CT) | Anti-PDL-1 | Anti-PUMA (CT) | Anti-PUMA (NT) | Anti-SCO1 | Anti-SCO2 | Anti-TIGAR (IN1) | Anti-TRAIL (NT), human |
| Autoimmunity | | Blocking Peptides | Anti-Akt1 (pSer473) blocking Peptide | Anti-IL-23 blocking peptide | Anti-SOCS-3 (IN) blocking peptide | Anti-Tau (paired181, 184) Blocking Peptide | Anti-Tau (paired198, 199, 202, 205) Blocking Peptide | Anti-Tau (paired212, 214, 217) Blocking Peptide | Anti-Tau (paired231, 235) Blocking Peptide | Anti-Tau (paired237) Blocking Peptide | Anti-Tau (paired262) Blocking Peptide | Anti-Tau (paired356) Blocking Peptide | Anti-Tau (paired396, 400, 404) Blocking Peptide | Anti-Tau (pSer184) Blocking Peptide | Anti-Tau (pSer195) Blocking Peptide | Anti-Tau (pSer198) Blocking Peptide | Anti-Tau (pSer199, 202) Blocking Peptide | Anti-Tau (pSer202) Blocking Peptide | Anti-Tau (pSer214) Blocking Peptide | Anti-Tau (pSer235) Blocking Peptide | Anti-Tau (pSer237) Blocking Peptide | Anti-Tau (pSer238) Blocking Peptide | Anti-Tau (pSer262) Blocking Peptide | Anti-Tau (pSer356) Blocking Peptide | Anti-Tau (pSer396) Blocking Peptide | Anti-Tau (pSer404) Blocking Peptide | Anti-Tau (pSer409) Blocking peptide | Anti-Tau (pSer412) Blocking peptide | Anti-Tau (pSer413) Blocking Peptide | Anti-Tau (pThr181) Blocking Peptide | Anti-Tau (pThr205) Blocking Peptide | Anti-Tau (pThr212) Blocking Peptide | Anti-Tau (pThr217) Blocking Peptide | Anti-Tau (pThr231) Blocking Peptide | Anti-Tp53 (IN) blocking peptide, Z-Fish™ |
| Cancer | | Cardiovascular | | Cell Cycle Control | | Cell Surface Marker | Anti-CD11b, Mouse | Anti-CD146 | Anti-CD19, Human | Anti-CD23 (IN), human | Anti-CD24, Human | Anti-CD24, Mouse | Anti-CD24, Mouse (Bio) | Anti-CD3, Human | Anti-CD3-epsilon (IN), human | Anti-CD3-epsilon antibody | Anti-CD31 (polyclonal) | Anti-CD34, Mouse | Anti-CD3e, Mouse | Anti-CD4, human (monoclonal) (SP35) | Anti-CD4, mouse (Bio) (RM4-5) | Anti-CD4, mouse (RM4-5) | Anti-CD40 | Anti-CD45R, Mouse | Anti-CD79a | Anti-CD79b (NT), human | Anti-CD79b, mouse | Anti-CD8 | Anti-human CD36 Antibody, monoclonal | Anti-human CD44 Antibody, monoclonal |
| Cell Surface Molecule | | Chaperone | | Chemical Compound | | Chemokine | | Chromatin and Nuclear Signaling | | Cytokine | | Cytoskeleton | *Anti-Keratin-18 (Asp237), human | *Anti-Keratin-19 (Asp237), human | Anti-Actin (alpha Smooth muscle specific), AMCA-labeled | Anti-Actin (alpha Smooth muscle specific), Biotinylated | Anti-Actin (alpha Smooth muscle specific), FAM-labeled | Anti-Actin (alpha Smooth muscle specific), FITC-labeled | Anti-Actin (alpha Smooth muscle specific), HiLyte Fluor™ 488-labeled | Anti-Actin (alpha Smooth muscle specific), HiLyte Fluor™ 555-labeled | Anti-Actin (alpha Smooth muscle specific), HiLyte Fluor™ 594-labeled | Anti-Actin (alpha Smooth muscle specific), HiLyte Fluor™ 647-labeled | Anti-Actin (alpha Smooth muscle specific), HiLyte Fluor™ TR-labeled | Anti-Actin (alpha Smooth muscle specific), TAMRA-Labeled | Anti-Actin antibody, alpha smooth muscle, polyclonal | Anti-beta-Actin (CT) Antibody polyclonal | Anti-beta-Actin (NT) Antibody, polyclonal | Anti-Fascin | Anti-human Keratin-18 (IN-2) | Anti-human Keratin-19 (IN) | Anti-Keratin-10 (CT), human Antibody polyclonal | Anti-Keratin-10 (IN), human Antibody polyclonal | Anti-Keratin-13 (CT) Antibody, mouse | Anti-Keratin-13-alpha (CT), human Antibody polyclonal | Anti-Keratin-14 (IN) , human Antibody polyclonal | Anti-LSP1 (pSer252) | Anti-LSP1 (pSer252) | Anti-LSP1 (Ser252) | Anti-MAP1-LC3 α (NT) | Anti-MAP1-LC3 α/β (IN), polyclonal | Anti-MAP1-LC3 β (NT) | Anti-MAP2ab antibody, monoclonal | Anti-Nestin antibody, polyclonal | Anti-NMHC II-A (CT) | Anti-NMHC II-B (CT-1) | Anti-NMHC II-B (CT-2) | Anti-NMHC II-C (CT), human |
| DNA Damage Repair | | Enzyme | | Glucose / Energy Metabolism | | Hematopoietic | | Hormone / Growth Factor | | Immunoglobulin | | Inflammation / Innate Immunity | Anti-AIM / API6 (NT) | Anti-AIM / API6 (CT) | Anti-Caspase-1 (CT) antibody, polyclonal | Anti-Caspase-1(IN) Antibody, polyclonal | Anti-CCR5 (CT) | Anti-CD23 (CT), mouse | Anti-CIS-1 (IN) | Anti-ICEBERG (CT) | Anti-IL-23 (NT) | Anti-IRAK1 (pThr 209) | Anti-IRAK1 (pThr 209) | Anti-IRAK1 (pThr 387) | Anti-IRAK1 (pThr 387) | Anti-IRAK1 (pThr387) Antibody (2D6), mouse monoclonal, Biotinylated | Anti-IRAK1 (pThr387) Antibody (Clone 2D6), mouse monoclonal | Anti-IRAK1 (pThr387) Antibody (Clone 2D6), mouse monoclonal | Anti-IRAK1 (pThr387) Antibody (Clone 2D6), mouse monoclonal, Biotinylated | Anti-IRAK1 (Thr209) | Anti-IRAK1 (Thr387) | Anti-L-Plastin | Anti-LL-37, human | Anti-MDA5 (CT) | Anti-TACE (CT) | Anti-TLR Sampler Set | Anti-TLR2 (NT) | Anti-TLR3 (CT) | Anti-TLR6 (IN) | Anti-TLR8 (IN) | Anti-TLR9 (CT) | Anti-TLR9 (IN) |
| Ion Channel | | Kinase / Phosphatase | | Leucocyte markers | | Neuroscience | Anti- Proteolipid Protein (PLP139-151) | Anti-α-Synuclein (paired 87) | Anti-α-Synuclein (pSer 87) | Anti-α-Synuclein (pSer 87) | Anti-β-Amyloid (1-40) | Anti-β-Amyloid (1-40), mouse monoclonal | Anti-β-Amyloid (1-42), mouse monoclonal | Anti-β-Amyloid (NT), human | Anti-14-3-3 zeta | Anti-APP (pThr743) Antibody, polyclonal | Anti-APP (pThr743) Antibody, polyclonal | Anti-APP (Thr743) Antibody, polyclonal | Anti-CCK-8 | Anti-CRMP1 (CT) | Anti-GAD65 | Anti-GAD67 | Anti-GluR1 | Anti-GluR6/7 | Anti-LFG | Anti-MBP1-11 | Anti-mGluR1 | Anti-mGluR5 | Anti-Neurotrypsin | Anti-P2Y12, human | Anti-PGP9.5 | Anti-PLP (178-191) | Anti-PSEN-1(NT),human | Anti-PSEN-1(NT),mouse | Anti-PSEN-2(NT) | Anti-S100A4 | Anti-synuclein (pan)(IN) | Anti-T-cadherin (NT) | Anti-Tau | Anti-Tau (194-214) | Anti-Tau (194-214) | Anti-Tau (209-226) | Anti-Tau (209-226) | Anti-Tau (393-411) | Anti-Tau (393-411) | Anti-Tau (401-426) | Anti-Tau (401-426) | Anti-Tau (pSer184), human | Anti-Tau (pSer184), human | Anti-Tau (pSer195), human | Anti-Tau (pSer195), human | Anti-Tau (pSer198) | Anti-Tau (pSer198) | Anti-Tau (pSer199/202) | Anti-Tau (pSer199/202) | Anti-Tau (pSer202) | Anti-Tau (pSer202) | Anti-Tau (pSer214) | Anti-Tau (pSer214) | Anti-Tau (pSer235) | Anti-Tau (pSer235) | Anti-Tau (pSer237) | Anti-Tau (pSer237) | Anti-Tau (pSer238) | Anti-Tau (pSer238) | Anti-Tau (pSer262) | Anti-Tau (pSer262) | Anti-Tau (pSer356) | Anti-Tau (pSer356) | Anti-Tau (pSer396) | Anti-Tau (pSer396) | Anti-Tau (pSer400) | Anti-Tau (pSer400) | Anti-Tau (pSer404) | Anti-Tau (pSer404) | Anti-Tau (pSer409) | Anti-Tau (pSer409) | Anti-Tau (pSer412) | Anti-Tau (pSer412) | Anti-Tau (pSer413) | Anti-Tau (pSer413) | Anti-Tau (pThr181) | Anti-Tau (pThr181) | Anti-Tau (pThr205) | Anti-Tau (pThr205) | Anti-Tau (pThr212) | Anti-Tau (pThr212) | Anti-Tau (pThr217) | Anti-Tau (pThr217) | Anti-Tau (pThr231) | Anti-Tau (pThr231) | Anti-Tau (Ser195) | Anti-Tau (Ser195) | Anti-Tau (Ser202) | Anti-Tau (Ser202) | Anti-Tau (Ser235) | Anti-Tau (Ser235) | Anti-Tau (Ser237) | Anti-Tau (Ser237) | Anti-Tau (Ser262) | Anti-Tau (Ser262) | Anti-Tau (Ser356) | Anti-Tau (Ser356) | Anti-Tau (Ser404) | Anti-Tau (Ser404) | Anti-Tau (Thr181/Ser184) | Anti-Tau (Thr181/Ser184) | Anti-Tau (Thr231) | Anti-Tau (Thr231) |
| Nuclear Antigen | | Parasite | | Protease / Protease Inhibitor | | Protein Acetylation | | Protein Methylation | | Protein Phosphorylation | Anti-α-Synuclein (paired 87) | Anti-α-Synuclein (pSer 87) | Anti-α-Synuclein (pSer 87) | Anti-AKT (paired308) | Anti-AKT (Ser473) | Anti-AKT/PKB (pSer473) | Anti-AKT/PKB (pThr308) | Anti-Akt/PKB [pS473] | Anti-Akt/PKB [pT308] | Anti-Androgen Receptor (pSer216) | Anti-Androgen Receptor (pSer216) | Anti-APP (pThr743) Antibody, polyclonal | Anti-APP (pThr743) Antibody, polyclonal | Anti-ATF2 (paired69/71) | Anti-ATF2/7 (pT69/71) | Anti-ATF2/7 (pThr69/71) | Anti-c-Cbl (paired 700) | Anti-Catenin-β (pSer675) | Anti-Catenin-β (pSer675) | Anti-Catenin-beta (paired675) | Anti-CSF-1R/CD115 (pTyr723) | Anti-CSF-1R/CD115 (pTyr723) | Anti-EGFR (pTyr1016) | Anti-EGFR (pTyr869) | Anti-EGFR (pTyr869) | Anti-EGFR (pY1016) | Anti-EGFR (TK domain) | Anti-eNOS (pSer116), bovine | Anti-eNOS (pSer116), bovine | Anti-ErbB-2 (Her-2) (paired 1112) | Anti-ErbB-2 (Her-2) (paired 1222) | Anti-ErbB-2 (Her-2) (pTyr1112) | Anti-ErbB-2 (Her-2) (pTyr1222) | Anti-ErbB-2 (Her-2) (pTyr1248) | Anti-ErbB-2 (Her-2) (pTyr1248) | Anti-ErbB-2 (Her-2) (pTyr877) | Anti-ErbB-2 (Her-2) (Tyr1248) | Anti-ErbB-2 (Her-2) (Tyr877) | Anti-ErbB-2 (pTyr1112) | Anti-ErbB-2 (pTyr877) | Anti-ErbB-2(Her-2) (pTyr1222) | Anti-Estrogen Receptor-α (pSer167) | Anti-Estrogen Receptor-α (pSer167) | Anti-IRAK1 (pThr 209) | Anti-IRAK1 (pThr 209) | Anti-IRAK1 (pThr 387) | Anti-IRAK1 (pThr 387) | Anti-IRAK1 (Thr209) | Anti-IRAK1 (Thr387) | Anti-IRS-1 (Paired312) | Anti-IRS-1 (pSer312) | Anti-IRS-1 (pSer312) | Anti-IRS-2 (pSer731) | Anti-IRS-2 (pSer731), phospho-specific | Anti-IRS-2 (Ser731) | Anti-JNK (paired 183/185) | Anti-JNK (pThr183/pTyr185) | Anti-JUN (paired 63) | Anti-JUN (paired 73) | Anti-JUN (pSer63) | Anti-JUN (pSer73) | Anti-JUN (pSer73) | Anti-LSP1 (pSer252) | Anti-LSP1 (pSer252) | Anti-LSP1 (Ser252) | Anti-MEK5 (pSer311/Thr315) | Anti-MEK5 (pSer311/Thr315) | Anti-MEK5/MAPKK5 (paired 311/315) | Anti-NFκB p65(pSer276) | Anti-NFκB p65(pSer276) | Anti-NFkB (p65; RELA)(Ser276) | Anti-NOS (Paired116) | Anti-p120 Catenin (paired228) | Anti-p120 Catenin (pTyr228) | Anti-p120 Catenin (pTyr228) | Anti-p120 Catenin (pTyr280) | Anti-p120 Catenin (pTyr280) | Anti-p120 Catenin (pTyr96) | Anti-p120 Catenin (pTyr96) | Anti-p53 (paired18/23), mouse | Anti-p53 (paired23), mouse | Anti-p53 (paired37) Antibody | Anti-p53 (paired392) Antibody | Anti-p53 (paired6) Antibody | Anti-p53 (paired9) Antibody | Anti-p53 (pSer15) Antibody polyclonal | Anti-p53 (pSer15) Antibody polyclonal | Anti-p53 (pSer18), mouse | Anti-p53 (pSer18/23), mouse | Anti-p53 (pSer20) Antibody | Anti-p53 (pSer20) Antibody | Anti-p53 (pSer23), mouse | Anti-p53 (pSer37) Antibody | Anti-p53 (pSer37) Antibody | Anti-p53 (pSer392) Antibody | Anti-p53 (pSer392) Antibody | Anti-p53 (pSer46) Antibody | Anti-p53 (pSer46) Antibody | Anti-p53 (pSer6) Antibody | Anti-p53 (pSer6) Antibody | Anti-p53 (pSer9) Antibody | Anti-p53 (pSer9) Antibody | Anti-p53 (Ser15) Antibody | Anti-p53 (Ser18) Antibody, mouse | Anti-p53 (Ser20) Antibody | Anti-p53 (Ser46) Antibody | Anti-p70S6K | Anti-Phospho-Ser/Thr/Tyr | Anti-PKD kinase (paired744/748) | Anti-PKD kinase (pSer744/748) | Anti-Rho-Kinase (pThr396), phospho-specific | Anti-Rho-Kinase (pThr396), phospho-specific | Anti-SOX9 (pSer181) | Anti-SOX9 (pSer181) | Anti-SOX9 (Ser181) | Anti-STAT3 (pSer 727) | Anti-STAT3 (pSer 727) | Anti-STAT3 (pTyr 705) | Anti-STAT3 (pTyr 705) | Anti-STAT3 (Ser727) | Anti-STAT3 (Thr705) | Anti-STAT5 (pTyr694) | Anti-STAT5 (pTyr694) | Anti-STAT5 (Tyr694) | Anti-STAT6 (pTyr 641) | Anti-STAT6 (pTyr 641) | Anti-Tau (194-214) | Anti-Tau (194-214) | Anti-Tau (209-226) | Anti-Tau (209-226) | Anti-Tau (393-411) | Anti-Tau (393-411) | Anti-Tau (401-426) | Anti-Tau (401-426) | Anti-Tau (pSer184), human | Anti-Tau (pSer184), human | Anti-Tau (pSer195), human | Anti-Tau (pSer195), human | Anti-Tau (pSer198) | Anti-Tau (pSer198) | Anti-Tau (pSer199/202) | Anti-Tau (pSer199/202) | Anti-Tau (pSer202) | Anti-Tau (pSer202) | Anti-Tau (pSer214) | Anti-Tau (pSer214) | Anti-Tau (pSer235) | Anti-Tau (pSer235) | Anti-Tau (pSer237) | Anti-Tau (pSer237) | Anti-Tau (pSer238) | Anti-Tau (pSer238) | Anti-Tau (pSer262) | Anti-Tau (pSer262) | Anti-Tau (pSer356) | Anti-Tau (pSer356) | Anti-Tau (pSer396) | Anti-Tau (pSer396) | Anti-Tau (pSer400) | Anti-Tau (pSer400) | Anti-Tau (pSer404) | Anti-Tau (pSer404) | Anti-Tau (pSer409) | Anti-Tau (pSer409) | Anti-Tau (pSer412) | Anti-Tau (pSer412) | Anti-Tau (pSer413) | Anti-Tau (pSer413) | Anti-Tau (pThr181) | Anti-Tau (pThr181) | Anti-Tau (pThr205) | Anti-Tau (pThr205) | Anti-Tau (pThr212) | Anti-Tau (pThr212) | Anti-Tau (pThr217) | Anti-Tau (pThr217) | Anti-Tau (pThr231) | Anti-Tau (pThr231) | Anti-Tau (Ser195) | Anti-Tau (Ser195) | Anti-Tau (Ser202) | Anti-Tau (Ser202) | Anti-Tau (Ser235) | Anti-Tau (Ser235) | Anti-Tau (Ser237) | Anti-Tau (Ser237) | Anti-Tau (Ser262) | Anti-Tau (Ser262) | Anti-Tau (Ser356) | Anti-Tau (Ser356) | Anti-Tau (Ser404) | Anti-Tau (Ser404) | Anti-Tau (Thr181/Ser184) | Anti-Tau (Thr181/Ser184) | Anti-Tau (Thr231) | Anti-Tau (Thr231) |
| Protein Tag | Anti-DsRed | Anti-DYKDDDDK Tag | Anti-E Tag | Anti-GFP (1A5), mouse monoclonal | Anti-GFP Tag | Anti-GFP Tag | Anti-GFP Tag | Anti-GFP Tag (6A2B3), mouse monoclonal | Anti-GFP Tag (CT) | Anti-GFP Tag (IN) | Anti-GFP Tag (NT) | Anti-GFP-Tag (1B9), mouse monoclonal | Anti-GFP-Tag, Chicken IgY | Anti-GST Tag | Anti-GST Tag (2G6B9), monoclonal | Anti-GST Tag, AMCA labeled | Anti-GST Tag, Biotinylated | Anti-GST Tag, FAM labeled | Anti-GST Tag, FITC labeled | Anti-GST Tag, HiLyte Fluor™ 488 labeled | Anti-GST Tag, HiLyte Fluor™ 594-labeled | Anti-GST Tag, ROX labeled | Anti-GST Tag, TAMRA labeled | Anti-His Tag | Anti-His-tag | Anti-His-tag | Anti-His-tag | Anti-HSV Tag | Anti-Myc Tag, mouse monoclonal | Anti-S Tag | Anti-VSV Tag | Monoclonal Anti-His Tag IgG, AMCA labeled | Monoclonal Anti-His Tag IgG, Biotinylated | Monoclonal Anti-His Tag IgG, FAM labeled | Monoclonal Anti-His Tag IgG, FITC labeled | Monoclonal Anti-His Tag IgG, HiLyte Fluor™ 488 labeled | Monoclonal Anti-His Tag IgG, HiLyte Fluor™ 555 labeled | Monoclonal anti-His Tag IgG, HiLyte Fluor™ 594-labeled | Monoclonal Anti-His Tag IgG, HiLyte Fluor™ 647 labeled | Monoclonal Anti-His Tag IgG, ROX labeled | Monoclonal Anti-His Tag IgG, TAMRA labeled | Polyclonal Anti-His Tag IgG, Biotinylated | Polyclonal Anti-His Tag IgG, FITC labeled | Polyclonal Anti-His Tag IgG, HiLyte Fluor™ 488 labeled | Polyclonal Anti-His Tag IgG, HiLyte Fluor™ 555 labeled | Polyclonal Anti-His Tag IgG, HiLyte Fluor™ 647 labeled |
| Protein Transport | | Protein Ubiquitination | | Receptor / Co-receptor | | Signal Transduction | Anti-14-3-3 zeta | Anti-AKT (paired308) | Anti-AKT (Ser473) | Anti-Akt pan (CT) | Anti-AKT pan (IN) | Anti-AKT pan (NT) | Anti-AKT/PKB (pSer473) | Anti-AKT/PKB (pThr308) | Anti-Akt/PKB [pS473] | Anti-Akt/PKB [pT308] | Anti-AKT2 (CT) | Anti-AKT3 (IN) | Anti-ATF2 (paired69/71) | Anti-ATF2/7 (pT69/71) | Anti-ATF2/7 (pThr69/71) | Anti-beta-Actin (CT) Antibody polyclonal | Anti-beta-Actin (NT) Antibody, polyclonal | Anti-Calcium Sensing Receptor (CaSR) | Anti-Calpain (IN) Antibody, polyclonal | Anti-Carma-1, human | Anti-Carma-1, mouse | Anti-Carma-2, human | Anti-Carma-2, mouse | Anti-Carma-3, human | Anti-Carma-3, mouse | Anti-CD11b, Mouse | Anti-CD146 | Anti-CD19, Human | Anti-CD23 (IN), human | Anti-CD24, Human | Anti-CD24, Mouse | Anti-CD24, Mouse (Bio) | Anti-CD3, Human | Anti-CD3-epsilon antibody | Anti-CD31 (polyclonal) | Anti-CD34, Mouse | Anti-CD3e, Mouse | Anti-CD4, mouse (Bio) (RM4-5) | Anti-CD4, mouse (RM4-5) | Anti-CD40 | Anti-CD45R, Mouse | Anti-CD79a | Anti-CD79b (NT), human | Anti-CD79b, mouse | Anti-CD8 | Anti-CIS-1 (IN) | Anti-CSF-1R/CD115 (pTyr723) | Anti-CSF-1R/CD115 (pTyr723) | Anti-CX3CR1 (IN), human | Anti-eNOS | Anti-eNOS (pSer116), bovine | Anti-eNOS (pSer116), bovine | Anti-ErbB-2 (Her-2) (paired 1112) | Anti-ErbB-2 (Her-2) (paired 1222) | Anti-ErbB-2 (Her-2) (pTyr1112) | Anti-ErbB-2 (Her-2) (pTyr1222) | Anti-ErbB-2 (Her-2) (pTyr1248) | Anti-ErbB-2 (Her-2) (pTyr1248) | Anti-ErbB-2 (Her-2) (pTyr877) | Anti-ErbB-2 (Her-2) (Tyr1248) | Anti-ErbB-2 (Her-2) (Tyr877) | Anti-ErbB-2 (pTyr1112) | Anti-ErbB-2 (pTyr877) | Anti-ErbB-2(Her-2) (pTyr1222) | Anti-Fascin | Anti-HSP70 Antibody, monoclonal | Anti-HSP70 Antibody, polyclonal | Anti-IKAP (CT) | Anti-iNOS | Anti-IRAK-3 (CT), human | Anti-IRAK-3 (CT), mouse | Anti-IRS-1 (Paired312) | Anti-IRS-1 (pSer312) | Anti-IRS-1 (pSer312) | Anti-IRS-2 (pSer731) | Anti-IRS-2 (pSer731), phospho-specific | Anti-IRS-2 (Ser731) | Anti-JNK (NT-1), Human | Anti-JNK (paired 183/185) | Anti-JNK (pThr183/pTyr185) | Anti-JUN (CT) | Anti-MDA5 (CT) | Anti-MEK5 (pSer311/Thr315) | Anti-MEK5 (pSer311/Thr315) | Anti-MEK5/MAPKK5 (paired 311/315) | Anti-MELK (IN), human | Anti-NCK2 | Anti-NFκB p65 (IN) | Anti-NFκB p65(pSer276) | Anti-NFκB p65(pSer276) | Anti-NFkB (p65; RELA)(Ser276) | Anti-NOS (Paired116) | Anti-ORAI1 (IN), human | Anti-PKC-theta (IN) | Anti-PKD kinase (paired744/748) | Anti-PKD kinase (pSer744/748) | Anti-PKD-1 kinase (CT), human | Anti-PKD-2 Kinase (CT), human | Anti-PKD-3 kinase (CT) | Anti-PKD-pan (IN-2) | Anti-Rho (IN) | Anti-Rho-Kinase (pThr396), phospho-specific | Anti-Rho-Kinase (pThr396), phospho-specific | Anti-RIG-I (IN) | Anti-SMAD4 / DPC4 | Anti-SOCS-2 (IN) | Anti-SOCS-3 (IN), mouse | Anti-STAT3 (pSer 727) | Anti-STAT3 (pSer 727) | Anti-STAT3 (pTyr 705) | Anti-STAT3 (pTyr 705) | Anti-STAT3 (Ser727) | Anti-STAT3 (Thr705) | Anti-STAT5 (pTyr694) | Anti-STAT5 (pTyr694) | Anti-STAT5 (Tyr694) | Anti-STAT6 (IN) | Anti-STAT6 (NT) | Anti-STAT6 (pTyr 641) | Anti-STAT6 (pTyr 641) | Anti-TGF-beta Receptor1 | ERK1/2 (pT202/pY204) | ERK1/2 (Thr202/Tyr204) |
| Target Protein | | Transcriptional Regulation | | Translational Regulation | | Transmembrane Protein | | Virus / Bacteria | | Z-Fish™ (Zebrafish) | Alphabetical Listing of Zebrafish Antibodies | Anti- Ltk (IN), Z-Fish™ | Anti-Acin-1a (IN), Z-Fish™ | Anti-Actin-beta (CT), Z-Fish™ | Anti-Actin-beta (NT), Z-Fish™ | Anti-AICDA (CT), Z-Fish™ | Anti-Aldh-1a2 (IN), Z-Fish™ | Anti-Alpi (IN), Z-Fish™ | Anti-Alpi (NT), Z-Fish™ | Anti-Angptl-4 (IN), Z-Fish™ | Anti-Arx (IN), Z-Fish™ | Anti-Ascl-1a (CT), Z-Fish™ | Anti-Atoh-1a (CT), Z-Fish™ | Anti-Atoh-1a (NT), Z-Fish™ | Anti-ATP-1a1 (NT), Z-Fish™ | Anti-Bad (CT), Z-Fish™ | Anti-Bad (IN), Z-Fish™ | Anti-Bax-a (NT), Z-Fish™ | Anti-Bax-b (NT), Z-Fish™ | Anti-Bbc-3 (IN), Z-Fish™ | Anti-Bcl-2 (NT), Z-Fish™ | Anti-Bcl-xl (IN), Z-Fish™ | Anti-Bcl2l10 (NT), Z-Fish™ | Anti-Bik (IN), Z-Fish™ | Anti-Bmp-2b (IN), Z-Fish™ | Anti-Bmp-2b (NT), Z-Fish™ | Anti-Bmp-4 (IN), Z-Fish™ | Anti-Bok-2 (NT), Z-Fish™ | Anti-Bok-a (NT), Z-Fish™ | Anti-Bon (IN), Z-Fish™ | Anti-Bon (NT), Z-Fish™ | Anti-Caspase 8l2 (IN), Z-Fish™ | Anti-Caspase-2 (IN), Z-Fish™ | Anti-Caspase-2 (NT), Z-Fish™ | Anti-Caspase-3a (p12) (CT), Z-Fish™ | Anti-Caspase-3a (p17) (NT) antibody, Z-Fish™ polyclonal | Anti-Caspase-3b (p12) (CT), Z-Fish™ | Anti-Caspase-3b (p17) (NT), Z-Fish™ | Anti-Caspase-8 (IN), Z-Fish™ | Anti-Caspase-9 (IN-1) (p37), Z-Fish™ | Anti-Caspase-9 (IN-2) (p37), Z-Fish™ | Anti-Caspase-9 (IN-3) (p10), Z-Fish™ | Anti-Caspase-a (IN), Z-Fish™ | Anti-Caspase-b (IN), Z-Fish™ | Anti-Catenin-b1/2 (NT), Z-Fish™ | Anti-Catenin-b1/2 (paired674), Z-Fish™ | Anti-Catenin-b1/2 (pSer674), Z-Fish™ | Anti-CD4 (NT), Z-Fish™ | Anti-CD8-a (CT), Z-Fish™ | Anti-CD8-a (IN), Z-Fish™ | Anti-Cdh-1 (IN), Z-Fish™ | Anti-Cdh-1 (IN-2), Z-Fish™ | Anti-Cdh-2 (IN), Z-Fish™ | Anti-Cdh-4 (IN), Z-Fish™ | Anti-Cdh-5 (IN), Z-Fish™ | Anti-CDK-1 (IN), Z-Fish™ | Anti-CDK-2 (CT), Z-Fish™ | Anti-CDK-2 (IN), Z-Fish™ | Anti-CDK-5 (CT), Z-Fish™ | Anti-CDK-5 (NT), Z-Fish™ | Anti-CDK-7 (CT), Z-Fish™ | Anti-CDK-7 (NT), Z-Fish™ | Anti-Cdkn-1b (CT), Z-Fish™ | Anti-CDKN-1b (IN-1), Z-Fish™ | Anti-Cdkn-1c (IN), Z-Fish™ | Anti-CDX-4 (CT), Z-Fish™ | Anti-Celsr-1a (IN-1), Z-Fish™ | Anti-Celsr-1a (IN-2), Z-Fish™ | Anti-Celsr-1b (IN-1), Z-Fish™ | Anti-Celsr-1b (NT), Z-Fish™ | Anti-Cflar (IN), Z-Fish™ | Anti-ChAT (CT), Z-Fish™ | Anti-Chd (IN), Z-Fish™ | Anti-Chek-2 (CT), Z-Fish™ | Anti-Cmyb (NT), Z-Fish™ | Anti-Col-1a1a (IN), Z-Fish™ | Anti-Col-1a2 (IN), Z-Fish™ | Anti-Col-2a1a (IN), Z-Fish™ | Anti-Cp (IN), Z-Fish™ | Anti-Crestin (IN), Z-Fish™ | Anti-Csf-1b (CT), Z-Fish™ | Anti-Csf-1r (IN-1), Z-Fish™ | Anti-Csf-1r (IN-2), Z-Fish™ | Anti-Csf-3r (IN), Z-Fish™ | Anti-Ctnn-a (CT), Z-Fish™ | Anti-Ctnn-b1 (IN), Z-Fish™ | Anti-Ctnn-b2 (IN), Z-Fish™ | Anti-Ctssb-2 (IN), Z-Fish™ | Anti-Cxcl-12a (IN), Z-Fish™ | Anti-CXCR-3.2 (IN), Z-Fish™ | Anti-Cybb (IN), Z-Fish™ | Anti-Cyclin-A2 (CT), Z-Fish™ | Anti-Cyclin-A2 (IN), Z-Fish™ | Anti-Cyclin-D1 (CT), Z-Fish™ | Anti-Cyclin-D1 (NT), Z-Fish™ | Anti-Cyclin-E1 (CT), Z-Fish™ | Anti-Cyclin-E1 (NT), Z-Fish™ | Anti-Cyclin-E2 (CT), Z-Fish™ | Anti-Cyclin-E2 (NT), Z-Fish™ | Anti-Cyclin-G1 (CT), Z-Fish™ | Anti-Cyclin-H (CT), Z-Fish™ | Anti-Cyclin-H (NT), Z-Fish™ | Anti-Cyp-19a1a (CT-2), Z-Fish™ | Anti-Cyp-19a1a (IN), Z-Fish™ | Anti-Cyp-19a1b (CT), Z-Fish™ | Anti-Cyp-26a1 (IN), Z-Fish™ | Anti-Cyp-26a1 (NT), Z-Fish™ | Anti-Cyp19a1a (CT), Z-Fish™ | Anti-Daxx (IN), Z-Fish™ | Anti-Dcc (IN), Z-Fish™ | Anti-Dct (IN), Z-Fish™ | Anti-DFF-a (CT), Z-Fish™ | Anti-DFF-b (IN), Z-Fish™ | Anti-Dl-D (IN), Z-Fish™ | Anti-Dla-A (IN), Z-Fish™ | Anti-Dla-B (CT), Z-Fish™ | Anti-Dla-B (IN), Z-Fish™ | Anti-Dla-C (IN), Z-Fish™ | Anti-Dll-4 (IN), Z-Fish™ | Anti-Drl (CT), Z-Fish™ | Anti-Dvl-2 (IN), Z-Fish™ | Anti-Dvl-3 (IN), Z-Fish™ | Anti-Dzip-1 (IN-1), Z-Fish™ | Anti-Dzip-1 (IN-2), Z-Fish™ | Anti-EF-1a (IN), Z-Fish™ | Anti-EfnB-2a (IN), Z-Fish™ | Anti-EGF (IN), Z-Fish™ | Anti-EGFR (CT), Z-Fish™ | Anti-Egr-2b (IN-1), Z-Fish™ | Anti-Egr-2b (IN-2), Z-Fish™ | Anti-EphA4a (IN), Z-Fish™ | Anti-EphA4b (IN), Z-Fish™ | Anti-EphB-4a (IN), Z-Fish™ | Anti-ErbB-2 (CT), Z-Fish™ | Anti-FADD (IN), Z-Fish™ | Anti-Fanc-c (NT), Z-Fish™ | Anti-Fanc-d1 (IN), Z-Fish™ | Anti-Fanc-d1 (NT), Z-Fish™ | Anti-Fanc-d2 (CT), Z-Fish™ | Anti-Fanc-d2 (CT-2), Z-Fish™ | Anti-Fanc-d2 (IN), Z-Fish™ | Anti-Fanc-l (IN) , Z-Fish™ | Anti-Fanc-l (NT), Z-Fish™ | Anti-Fas (IN), Z-Fish™ | Anti-Faslg (NT), Z-Fish™ | Anti-FGF-3 (CT), Z-Fish™ | Anti-FGF-8a (CT), Z-Fish™ | Anti-Fgfr-1 (CT), Z-Fish™ | Anti-Fgfr-2 (IN), Z-Fish™ | Anti-Fgfr-3 (CT), Z-Fish™ | Anti-Fgfr-4 (IN), Z-Fish™ | Anti-Fibronectin-1 (NT), Z-Fish™ | Anti-Figf (CT), Z-Fish™ | Anti-Figf (NT), Z-Fish™ | Anti-Flh (CT), Z-Fish™ | Anti-Fli-1a (CT), Z-Fish™ | Anti-Flt-1 (Vegfr-1) (IN), Z-Fish™ | Anti-Flt-1 (Vegfr-1) (IN-2), Z-Fish™ | Anti-Flt-4 (IN-1), Z-Fish™ | Anti-Fox-A3 (IN), Z-Fish™ | Anti-Fox-H1 (CT), Z-Fish™ | Anti-Fox-H1 (IN-1), Z-Fish™ | Anti-Fzd-3 (CT), Z-Fish™ | Anti-Fzd-3l (CT), Z-Fish™ | Anti-Fzd-7a (CT), Z-Fish™ | Anti-Fzd-7b (CT), Z-Fish™ | Anti-Fzd-8a (IN), Z-Fish™ | Anti-Fzd-8b (IN), Z-Fish™ | Anti-Fzd-8c (IN), Z-Fish™ | Anti-Gad-1 (IN), Z-Fish™ | Anti-Gad-2 (IN), Z-Fish™ | Anti-Gap-43 (NT), Z-Fish™ | Anti-GAP-43 (paired42) , Z-Fish™ | Anti-GAP-43 (pSer42), Z-Fish™ | Anti-GAPDH (IN), Z-Fish™ | Anti-GAPDH (NT), Z-Fish™ | Anti-Gata-1a (IN), Z-Fish™ | Anti-Gata-2a (CT), Z-Fish™ | Anti-Gata-3 (IN), Z-Fish™ | Anti-Gata-4 (CT), Z-Fish™ | Anti-Gata-5 (CT), Z-Fish™ | Anti-Gata-6 (IN), Z-Fish™ | Anti-GFAP (CT), Z-Fish™ | Anti-GFAP (IN), Z-Fish™ | Anti-Gfi-1.1/1.2 (CT), Z-Fish™ | Anti-Gfi-1.2 (IN), Z-Fish™ | Anti-Gga-1 (NT), Z-Fish™ | Anti-Ghrelin (IN), Z-Fish™ | Anti-Gli-1 (IN-1), Z-Fish™ | Anti-Gli-1 (IN-2), Z-Fish™ | Anti-Gli-2a (IN), Z-Fish™ | Anti-Gli-3 (IN), Z-Fish™ | Anti-Gorasp-1 (CT), Z-Fish™ | Anti-Gorasp-1 (IN), Z-Fish™ | Anti-Gorasp-2 (CT), Z-Fish™ | Anti-Gorasp-2 (NT), Z-Fish™ | Anti-Gpc-4 (IN), Z-Fish™ | Anti-Gsc (CT), Z-Fish™ | Anti-Gsk-3a (CT), Z-Fish™ | Anti-GSK-3b (CT), Z-Fish™ | Anti-Gsk-3b (NT), Z-Fish™ | Anti-GSK3a (NT), Z-Fish™ | Anti-Hand-2 (IN), Z-Fish™ | Anti-Hbbe-1.1 (NT), Z-Fish™ | Anti-Hdac-1 (IN), Z-Fish™ | Anti-HDR (IN), Z-Fish™ | Anti-Her 4.1/4.2 (IN-1), Z-Fish™ | Anti-Her-1 (IN), Z-Fish™ | Anti-Her-4.1/4.2 (IN-2), Z-Fish™ | Anti-Her-5 (IN), Z-Fish™ | Anti-Her-7 (IN-1), Z-Fish™ | Anti-Her-7 (IN-2), Z-Fish™ | Anti-Hhex (CT), Z-Fish™ | Anti-Hhip (IN), Z-Fish™ | Anti-Hlxb9l-a (IN), Z-Fish™ | Anti-Hnf-1ba (IN-1), Z-Fish™ | Anti-Hnf-1ba (IN-2), Z-Fish™ | Anti-HSP90-a (CT), Z-Fish™ | Anti-HSP90-a (IN), Z-Fish™ | Anti-Iclp1 (CT), Z-Fish™ | Anti-Igh-z (IN-1), Z-Fish™ | Anti-Igh-z (IN-2), Z-Fish™ | Anti-Ikzf-1 (IN), Z-Fish™ | Anti-Ikzf-1 (NT), Z-Fish™ | Anti-Insm-1a (IN), Z-Fish™ | Anti-Insm-1b (IN), Z-Fish™ | Anti-Isl-1 (IN-1), Z-Fish™ | Anti-Isl-2a (IN), Z-Fish™ | Anti-Isl-2b (IN-1), Z-Fish™ | Anti-Isl-l (IN-3) , Z-Fish™ | Anti-Isl-l (IN-4) , Z-Fish™ | Anti-ItgA-2b (IN), Z-Fish™ | Anti-Itgb-1a (IN-1), Z-Fish™ | Anti-Itgb-1a (IN-2), Z-Fish™ | Anti-Itgb-1b (NT), Z-Fish™ | Anti-Jag-1a (CT), Z-Fish™ | Anti-Jag-1b (CT), Z-Fish™ | Anti-Jag-2 (IN), Z-Fish™ | Anti-Kdrl (IN-1), Z-Fish™ | Anti-Kdrl (IN-2), Z-Fish™ | Anti-Keratin-18 (IN-1) Antibody, Z-Fish™ | Anti-Kit-a (IN), Z-Fish™ | Anti-Kit-a (NT), Z-Fish™ | Anti-Krt-8 (NT), Z-Fish™ | Anti-Lcp-1 (IN), Z-Fish™ | Anti-Lmo-2 (NT), Z-Fish™ | Anti-Lysozyme (IN), Z-Fish™ | Anti-MAP LC3-alpha/beta (IN), Z-Fish™ | Anti-MAPK- 8 (IN), Z-Fish™ | Anti-MAPK-1 (CT), Z-Fish™ | Anti-MAPK-14a (CT), Z-Fish™ | Anti-MAPK-3 (CT), Z-Fish™ | Anti-MAPK-8 (CT), Z-Fish™ | Anti-Max (CT), Z-Fish™ | Anti-MBP (IN), Z-Fish™ | Anti-Mcl-1a (IN), Z-Fish™ | Anti-Mcl-1b (IN), Z-Fish™ | Anti-Mdm-2 (IN), Z-Fish™ | Anti-Mef2-pan (IN), Z-Fish™ | Anti-Mfap-4 (M-ficolin-like) (IN), Z-Fish™ | Anti-MHC II-a (IN-1), Z-Fish™ | Anti-MHC II-a (IN-2), Z-Fish™ | Anti-Mib (NT), Z-Fish™ | Anti-Mib-2 (IN), Z-Fish™ | Anti-Mitf-a (IN), Z-Fish™ | Anti-Mitf-b (IN), Z-Fish™ | Anti-MMP-11a (Catalytic domain), Z-Fish™ | Anti-MMP-11a (hinge), Z-Fish™ | Anti-MMP-11a (IN), Z-Fish™ | Anti-MMP-11b (Catalytic domain), Z-Fish™ | Anti-MMP-11b (hinge), Z-Fish™ | Anti-MMP-11b (hinge), Z-Fish™ | Anti-MMP-11b (NT), Z-Fish™ | Anti-MMP-13a (hinge), Z-Fish™ | Anti-MMP-14a (hinge), Z-Fish™ | Anti-MMP-14b (hinge), Z-Fish™ | Anti-MMP-14b (hinge), Z-Fish™ | Anti-MMP-16a (hinge), Z-Fish™ | Anti-MMP-17 (hinge), Z-Fish™ | Anti-MMP-18 (hinge), Z-Fish™ | Anti-MMP-18 (IN), Z-Fish™ | Anti-MMP-21 (IN-2), Z-Fish™ | Anti-MMP-24 (hinge), Z-Fish™ | Anti-MMP-28 (hinge), Z-Fish™ | Anti-MMP-9 (hinge), Z-Fish™ | Anti-Mnx-1 (CT), Z-Fish™ | Anti-MPEG-1 (CT), Z-Fish™ | Anti-Mpp-5a (IN), Z-Fish™ | Anti-Mpx (NT), Z-Fish™ | Anti-Myc-a/b (IN), Z-Fish™ | Anti-Myc-n (CT), Z-Fish™ | Anti-MyD88 (CT), Z-Fish™ | Anti-Myf-5 (IN), Z-Fish™ | Anti-Myh-6 (CT), Z-Fish™ | Anti-Myh9a (CT), Z-Fish™ | Anti-MyoD-1 (IN), Z-Fish™ | Anti-Ncam-1 (IN), Z-Fish™ | Anti-Ncf-1 (IN), Z-Fish™ | Anti-Ncf-1(CT), Z-Fish™ | Anti-Nes (CT), Z-Fish™ | Anti-NeuroD (CT), Z-Fish™ | Anti-Neurog-1 (IN), Z-Fish™ | Anti-Neurog-3 (IN), Z-Fish™ | Anti-NFKB-2 (IN), Z-Fish™ | Anti-Nfkbi-ab (NT), Z-Fish™ | Anti-Nfkbi-alpha-A (NT), Z-Fish™ | Anti-Nfkbi-alpha-B (NT-2), Z-Fish™ | Anti-Nhsl-1a/1b (CT), Z-Fish™ | Anti-Nhsl-1a/1b (IN-2), Z-Fish™ | Anti-Nkx-2.1a (IN), Z-Fish™ | Anti-Nkx-2.2a (IN-1), Z-Fish™ | Anti-Nkx-2.2a (IN-2), Z-Fish™ | Anti-Nkx-2.3 (CT), Z-Fish™ | Anti-Nkx-2.5 (CT), Z-Fish™ | Anti-Notch-1a (IN), Z-Fish™ | Anti-Notch-1b (IN), Z-Fish™ | Anti-Notch-2 (IN), Z-Fish™ | Anti-Notch-3 (IN), Z-Fish™ | Anti-Ntn-1a (IN), Z-Fish™ | Anti-Ntn-1a (IN-2), Z-Fish™ | Anti-Ntn-1b (IN), Z-Fish™ | Anti-Olig-2 (CT), Z-Fish™ | Anti-Onecut-1 (IN-1), Z-Fish™ | Anti-Onecut-1 (IN-2), Z-Fish™ | Anti-p53 (CT), Z-Fish™ Antibody | Anti-Pard-3 (CT) , Z-Fish™ | Anti-Pard-6a (CT), Z-Fish™ | Anti-Pax-2a (IN -1), Z-Fish™ | Anti-Pax-2a/2b (IN-2), Z-Fish™ | Anti-Pax-3a (IN), Z-Fish™ | Anti-Pax-6a (CT), Z-Fish™ | Anti-Pax-6a (NT), Z-Fish™ | Anti-Pax-6b (CT), Z-Fish™ | Anti-Pax-6b (NT), Z-Fish™ | Anti-Pax-8 (IN), Z-Fish™ | Anti-PCNA (IN), Z-Fish™ | Anti-PCNA (NT), Z-Fish™ | Anti-PDCD-8 (CT), Z-Fish™ | Anti-PDCD-8 (NT), Z-Fish™ | Anti-Pdx-1 (CT), Z-Fish™ | Anti-Pdx-1 (IN), Z-Fish™ | Anti-Pea-3 (CT), Z-Fish™ | Anti-Pou5f1 (CT), Z-Fish™ | Anti-Pou5f1 (IN), Z-Fish™ | Anti-Prdm-1a (IN), Z-Fish™ | Anti-Prickle-1a (CT), Z-Fish™ | Anti-Prickle-1b (IN), Z-Fish™ | Anti-Prickle-2 (IN), Z-Fish™ | Anti-Prkci (IN), Z-Fish™ | Anti-Prkci (NT), Z-Fish™ | Anti-Prom-1a (IN), Z-Fish™ | Anti-Ptc-1 (CT), Z-Fish™ | Anti-Ptc-1 (NT), Z-Fish™ | Anti-Ptc-2 (CT), Z-Fish™ | Anti-Ptc-2 (NT), Z-Fish™ | Anti-Ptf-1a (IN-1), Z-Fish™ | Anti-Ptf-1a (IN-2), Z-Fish™ | Anti-Ptprc (CT), Z-Fish™ | Anti-Ptprc (NT), Z-Fish™ | Anti-Rad-51 (NT), Z-Fish™ | Anti-Rag-1 (IN-1), Z-Fish™ | Anti-Rag-1 (IN-2), Z-Fish™ | Anti-Rag-1 (IN-3), Z-Fish™ | Anti-Rag-2 (CT), Z-Fish™ | Anti-Rag-2 (IN), Z-Fish™ | Anti-RB-1 (CT), Z-Fish™ | Anti-Rel (IN), Z-Fish™ | Anti-Rel-a (NT), Z-Fish™ | Anti-Ret-1 (CT), Z-Fish™ | Anti-Ret-1 (IN), Z-Fish™ | Anti-Ret-1 (IN-2), Z-Fish™ | Anti-ROCK-1 (CT), Z-Fish™ | Anti-ROCK-2a (CT), Z-Fish™ | Anti-Runx-1 (IN), Z-Fish™ | Anti-Runx-pan (IN), Z-Fish™ | Anti-Ryr-1a (IN) , Z-Fish™ | Anti-Ryr-1b (IN), Z-Fish™ | Anti-Ryr-2a (IN), Z-Fish™ | Anti-Ryr-2a (IN-2), Z-Fish™ | Anti-Ryr-2b (IN), Z-Fish™ | Anti-Ryr-3 (IN), Z-Fish™ | Anti-Ryr-3 (IN-2), Z-Fish™ | Anti-Ryr-pan (IN), Z-Fish™ | Anti-SARM-1 (CT), Z-Fish™ | Anti-Scrib (CT), Z-Fish™ | Anti-Scrib (IN), Z-Fish™ | Anti-Scube-2 (CT), Z-Fish™ | Anti-Shha (IN), Z-Fish™ | Anti-Smo (IN), Z-Fish™ | Anti-Snai-1a/1b (IN-2), Z-Fish™ | Anti-Snai-1b (IN-1), Z-Fish™ | Anti-Sox-10 (CT), Z-Fish™ | Anti-SOX-10 (IN), Z-Fish™ | Anti-Sox-11a (NT), Z-Fish™ | Anti-Sox-11b (NT) , Z-Fish™ | Anti-Sox-17 (IN), Z-Fish™ | Anti-Sox-19a (CT), Z-Fish™ | Anti-Sox-19a (IN), Z-Fish™ | Anti-Sox-32 (CT), Z-Fish™ | Anti-Sox-9a (IN-1), Z-Fish™ | Anti-Sox-9a (IN-2), Z-Fish™ | Anti-Sox-9a (paired183), Z-Fish™ | Anti-Sox-9a (pSer183), Z-Fish™ | Anti-Sox-pan-2 (IN), Z-Fish™ | Anti-Spaw (IN), Z-Fish™ | Anti-Spi-1 (CT), Z-Fish™ | Anti-Spi-1 (IN), Z-Fish™ | Anti-Stat-3 (CT), Z-Fish™ | Anti-Stat-3 (IN), Z-Fish™ | Anti-Stat-3 (paired), Z-Fish™ | Anti-Stat-3 (pTyr708), Z-Fish™ | Anti-Sufu (CT), Z-Fish™ | Anti-Sufu (IN), Z-Fish™ | Anti-TAF-3 (IN), Z-Fish™ | Anti-Tal-1 (CT), Z-Fish™ | Anti-Tal-1 (IN), Z-Fish™ | Anti-Tbx-5 (CT), Z-Fish™ | Anti-Tbx-5 (NT), Z-Fish™ | Anti-Tcf-21 (CT), Z-Fish™ | Anti-TCR-Alpha (NT), Z-Fish™ | Anti-TCR-Gamma (IN), Z-Fish™ | Anti-Tfap-2a (CT), Z-Fish™ | Anti-Tfap-2a (IN-1), Z-Fish™ | Anti-Tfap-2a (IN-2), Z-Fish™ | Anti-Tfe-3a (NT), Z-Fish™ | Anti-Tfr-1a (IN), Z-Fish™ | Anti-Tfr-1b (NT), Z-Fish™ | Anti-Tfr-2 (IN), Z-Fish™ | Anti-TGF-b1 (IN), Z-Fish™ | Anti-TGF-b2 (IN-1), Z-Fish™ | Anti-TGF-b2 (IN-1), Z-Fish™ | Anti-TGF-b2 (IN-2), Z-Fish™ | Anti-TGF-b3 (IN), Z-Fish™ | Anti-TICAM-1 (CT), Z-Fish™ | Anti-TICAM-1 (IN), Z-Fish™ | Anti-TIMP-2a (CT), Z-Fish™ | Anti-TIMP-2b (CT), Z-Fish™ | Anti-TIMP-3 (IN), Z-Fish™ | Anti-TIMP-4 (CT), Z-Fish™ | Anti-TLR-3 (CT), Z-Fish™ | Anti-TNF-a (IN), Z-Fish™ | Anti-TNF-b (IN), Z-Fish™ | Anti-Tnfrsf-1a (IN-1), Z-Fish™ | Anti-Tnfrsf-1a (IN-2), Z-Fish™ | Anti-Tnfrsf-21 (IN), Z-Fish™ | Anti-TNFRSF-a (IN), Z-Fish™ | Anti-TNFS10l3 (IN), Z-Fish™ | Anti-Tp53 (IN), Z-Fish™ | Anti-TRADD (IN), Z-Fish™ | Anti-TRADD (NT), Z-Fish™ | Anti-TRAIL-3 (NT-1), Z-Fish™ | Anti-Trim -33 (IN), Z-Fish™ | Anti-Trim-33 (IN-2), Z-Fish™ | Anti-Tubulin-beta (NT), Z-Fish™ | Anti-Vangl-2 (CT), Z-Fish™ | Anti-Vangl-2 (NT), Z-Fish™ | Anti-Vegf-Aa (CT), Z-Fish™ | Anti-Vegf-Ab (CT), Z-Fish™ | Anti-Vegf-c (CT), Z-Fish™ | Anti-Vegf-c (IN), Z-Fish™ | Anti-Vsx-2 (IN), Z-Fish™ | Anti-Wnt-1 (CT), Z-Fish™ | Anti-Wnt-11 (IN), Z-Fish™ | Anti-Wnt-5a (IN), Z-Fish™ | Anti-Wnt-5b (IN), Z-Fish™ | Anti-Wnt-8a (CT), Z-Fish™ | Anti-Wnt-8b (CT), Z-Fish™ | Anti-Xiap (IN), Z-Fish™ | Anti-Xiap (NT), Z-Fish™ | Z-Fish™ Embryonic Lysate (24 hpf) | Z-Fish™ Embryonic Lysate (48 hpf) | Z-Fish™ Embryonic Lysate (72 hpf) | Z-Fish™ Lysate (5 dpf) |
| Antigen Presentation | | Apoptosis and Autophagy | Anti-Acin-1a (IN), Z-Fish™ | Anti-Acin-1a (IN), Z-Fish™ | Anti-Bad (CT), Z-Fish™ | Anti-Bad (IN), Z-Fish™ | Anti-Bad (IN), Z-Fish™ | Anti-Bax-a (NT), Z-Fish™ | Anti-Bax-a (NT), Z-Fish™ | Anti-Bax-b (NT), Z-Fish™ | Anti-Bax-b (NT), Z-Fish™ | Anti-Bbc-3 (IN), Z-Fish™ | Anti-Bcl-2 (NT), Z-Fish™ | Anti-Bcl-2 (NT), Z-Fish™ | Anti-Bcl-xl (IN), Z-Fish™ | Anti-Bcl-xl (IN), Z-Fish™ | Anti-Bcl2l10 (NT), Z-Fish™ | Anti-Bcl2l10 (NT), Z-Fish™ | Anti-Bik (IN), Z-Fish™ | Anti-Bok-2 (NT), Z-Fish™ | Anti-Bok-a (NT), Z-Fish™ | Anti-Caspase 8l2 (IN), Z-Fish™ | Anti-Caspase-2 (IN), Z-Fish™ | Anti-Caspase-2 (IN), Z-Fish™ | Anti-Caspase-2 (NT), Z-Fish™ | Anti-Caspase-2 (NT), Z-Fish™ | Anti-Caspase-3a (p12) (CT), Z-Fish™ | Anti-Caspase-3a (p12) (CT), Z-Fish™ | Anti-Caspase-3a (p17) (NT) antibody, Z-Fish™ polyclonal | Anti-Caspase-3a (p17) (NT) antibody, Z-Fish™ polyclonal | Anti-Caspase-3b (p12) (CT), Z-Fish™ | Anti-Caspase-3b (p12) (CT), Z-Fish™ | Anti-Caspase-3b (p17) (NT), Z-Fish™ | Anti-Caspase-8 (IN), Z-Fish™ | Anti-Caspase-8 (IN), Z-Fish™ | Anti-Caspase-9 (IN-1) (p37), Z-Fish™ | Anti-Caspase-9 (IN-2) (p37), Z-Fish™ | Anti-Caspase-9 (IN-3) (p10), Z-Fish™ | Anti-Caspase-9 (IN-3) (p10), Z-Fish™ | Anti-Caspase-9 (p37) (IN-1), Z-Fish™ | Anti-Caspase-9 (p37) (IN-2), Z-Fish™ | Anti-Caspase-a (IN), Z-Fish™ | Anti-Caspase-a (IN), Z-Fish™ | Anti-Caspase-b (IN), Z-Fish™ | Anti-Caspase-b (IN), Z-Fish™ | Anti-Cflar (IN), Z-Fish™ | Anti-Daxx (IN), Z-Fish™ | Anti-Daxx (IN), Z-Fish™ | Anti-DFF-a (CT), Z-Fish™ | Anti-DFF-a (CT), Z-Fish™ | Anti-DFF-b (IN), Z-Fish™ | Anti-DFF-b (IN), Z-Fish™ | Anti-FADD (IN), Z-Fish™ | Anti-FADD (IN), Z-Fish™ | Anti-Fas (IN), Z-Fish™ | Anti-Fas (IN), Z-Fish™ | Anti-Faslg (NT), Z-Fish™ | Anti-Faslg (NT), Z-Fish™ | Anti-HDR (IN), Z-Fish™ | Anti-HDR (IN), Z-Fish™ | Anti-Mcl-1a (IN), Z-Fish™ | Anti-Mcl-1a (IN), Z-Fish™ | Anti-Mcl-1b (IN), Z-Fish™ | Anti-Mcl-1b (IN), Z-Fish™ | Anti-Mdm-2 (IN), Z-Fish™ | Anti-Mdm-2 (IN), Z-Fish™ | Anti-Nes (CT), Z-Fish™ | Anti-PDCD-8 (CT), Z-Fish™ | Anti-PDCD-8 (NT), Z-Fish™ | Anti-TICAM-1 (CT), Z-Fish™ | Anti-TICAM-1 (IN), Z-Fish™ | Anti-TICAM-1 (IN), Z-Fish™ | Anti-TNF-a (IN), Z-Fish™ | Anti-TNF-a (IN), Z-Fish™ | Anti-Tnfrsf-21 (IN), Z-Fish™ | Anti-Tnfrsf-21 (IN), Z-Fish™ | Anti-TNFRSF-a (IN), Z-Fish™ | Anti-TNFRSF-a (IN), Z-Fish™ | Anti-TNFS10l3 (IN), Z-Fish™ | Anti-TNFS10l3 (IN), Z-Fish™ | Anti-TRADD (IN), Z-Fish™ | Anti-TRADD (IN), Z-Fish™ | Anti-TRADD (NT), Z-Fish™ | Anti-TRAIL-3 (NT-1), Z-Fish™ | Anti-Xiap (IN), Z-Fish™ | Anti-Xiap (NT), Z-Fish™ |
| Binding and Transportation | Anti-Cp (IN), Z-Fish™ | Anti-Cp (IN), Z-Fish™ | Anti-Insm-1a (IN), Z-Fish™ | Anti-Insm-1b (IN), Z-Fish™ | Anti-Insm-1b (IN), Z-Fish™ | Anti-Ryr-1a (IN) , Z-Fish™ | Anti-Ryr-1a (IN), Z-Fish™ | Anti-Ryr-1b (IN), Z-Fish™ | Anti-Ryr-1b (IN), Z-Fish™ | Anti-Ryr-2a (IN), Z-Fish™ | Anti-Ryr-2a (IN-2), Z-Fish™ | Anti-Ryr-2b (IN), Z-Fish™ | Anti-Ryr-3 (IN), Z-Fish™ | Anti-Ryr-3 (IN-2), Z-Fish™ | Anti-Ryr-pan (IN), Z-Fish™ |
| Blocking Peptides | Anti- Ltk (IN) blocking peptide, Z-Fish™ | Anti- MAPK- 8 (IN) blocking peptide, Z-Fish™ | Anti- Myh-6 (CT) blocking peptide, Z-Fish™ | Anti- Pax-6b (CT) blocking peptide, Z-Fish™ | Anti-Acin-1a (IN) blocking Peptide, Z-Fish™ | Anti-Actin-beta (CT) blocking Peptide, Z-Fish™ | Anti-Actin-beta (NT) blocking Peptide, Z-Fish™ | Anti-Aldh-1a2 (IN) blocking peptide, Z-Fish™ | Anti-Alpi (IN) blocking peptide, Z-Fish™ | Anti-Alpi (NT) blocking peptide, Z-Fish™ | Anti-Angptl-4 (IN) blocking peptide, Z-Fish™ | Anti-Arx (IN) blocking peptide, Z-Fish™ | Anti-Ascl-1a (CT), Z-Fish™ | Anti-Atoh-1a (CT) blocking peptide, Z-Fish™ | Anti-Atoh-1a (NT) blocking peptide, Z-Fish™ | Anti-ATP-1a1 (NT), Z-Fish™ | Anti-Bad (CT) blocking Peptide, Z-Fish™ | Anti-Bad (IN) blocking Peptide, Z-Fish™ | Anti-Bax-a (NT) blocking Peptide, Z-Fish™ | Anti-Bax-b (NT) blocking peptide, Z-Fish™ | Anti-Bbc-3 (IN) blocking peptide, Z-Fish™ | Anti-Bcl-2 (NT) blocking peptide, Z-Fish™ | Anti-Bcl-xl (IN) blocking peptide, Z-Fish™ | Anti-Bcl2l10 (NT) blocking Peptide, Z-Fish™ | Anti-beta-catenin (NT) blocking Peptide, Z-Fish™ | Anti-Bik (IN) blocking peptide, Z-Fish™ | Anti-Bmp-2b (IN) blocking peptide, Z-Fish™ | Anti-Bmp-2b (NT) blocking peptide, Z-Fish™ | Anti-Bmp-4 (IN) blocking peptide, Z-Fish™ | Anti-Bok-a (NT) blocking Peptide, Z-Fish™ | Anti-Bon (IN) blocking peptide, Z-Fish™ | Anti-Bon (NT) blocking peptide, Z-Fish™ | Anti-Caspase 8l2 (IN), Z-Fish™ | Anti-caspase-2 (IN) blocking Peptide, Z-Fish™ | Anti-caspase-2 (NT) blocking Peptide, Z-Fish™ | Anti-caspase-3a (NT) blocking Peptide, Z-Fish™ | Anti-Caspase-3a (p12) (CT) blocking Peptide, Z-Fish™ | Anti-Caspase-3b (p12) (CT) blocking Peptide, Z-Fish™ | Anti-Caspase-3b (p17) (NT) blocking Peptide, Z-Fish™ | Anti-Caspase-8 (IN) blocking peptide, Z-Fish™ | Anti-Caspase-9 (IN1) (p37) blocking Peptide, Z-Fish™ | Anti-Caspase-9 (IN2) (p37) blocking Peptide, Z-Fish™ | Anti-Caspase-9 (IN3) (p10) blocking Peptide, Z-Fish™ | Anti-caspase-a (IN) blocking Peptide, Z-Fish™ | Anti-Caspase-b (IN) blocking peptide, Z-Fish™ | Anti-Catanin-b1/2 (pSer674) blocking peptide, Z-Fish™ | Anti-Catenin-beta 1,2 (paired 674) blocking Peptide, Z-Fish™ | Anti-CD4 (NT) blocking peptide, Z-Fish™ | Anti-CD4-2 (IN-1) blocking peptide, Z-Fish™ | Anti-CD8-a (CT) blocking peptide, Z-Fish™ | Anti-CD8-a (IN) blocking peptide, Z-Fish™ | Anti-Cdh-1 (IN) blocking peptide, Z-Fish™ | Anti-Cdh-1 (IN-2) blocking peptide, Z-Fish™ | Anti-Cdh-2 (IN) blocking peptide, Z-Fish™ | Anti-Cdh-4 (IN) blocking peptide, Z-Fish™ | Anti-Cdh-5 (IN) blocking peptide, Z-Fish™ | Anti-Cdk-1(IN) blocking peptide, Z-Fish™ | Anti-CDK-2 (CT) blocking Peptide, Z-Fish™ | Anti-CDK-2 (IN) blocking peptide, Z-Fish™ | Anti-CDK-5 (CT) blocking Peptide, Z-Fish™ | Anti-CDK-5 (NT) blocking Peptide, Z-Fish™ | Anti-CDK-7 (CT) blocking peptide, Z-Fish™ | Anti-CDK-7 (NT) blocking Peptide, Z-Fish™ | Anti-Cdkn-1b (CT) blocking peptide, Z-Fish™ | Anti-CDKN-1b (IN-1) blocking peptide, Z-Fish™ | Anti-Cdkn-1c (IN) blocking peptide, Z-Fish™ | Anti-Cdx-4 (CT) blocking Peptide, Z-Fish™ | Anti-Celsr-1a (IN-1) blocking peptide, Z-Fish™ | Anti-Celsr-1a (IN-2) blocking peptide, Z-Fish™ | Anti-Celsr-1b (IN-1) blocking peptide, Z-Fish™ | Anti-Celsr-1b (NT) blocking peptide, Z-Fish™ | Anti-Cflar (IN) blocking Peptide, Z-Fish™ | Anti-ChAT (CT) blocking peptide, Z-Fish™ | Anti-Chd (IN) blocking peptide, Z-Fish™ | Anti-Chek-2 (CT) blocking peptide, Z-Fish™ | Anti-Cmyb (NT) blocking peptide, Z-Fish™ | Anti-Col-1a1a (IN) blocking peptide, Z-Fish™ | Anti-Col-1a2 (IN) blocking peptide, Z-Fish™ | Anti-Col-2a1a (IN) blocking peptide, Z-Fish™ | Anti-Cp (IN) blocking peptide, Z-Fish™ | Anti-Crestin (IN) blocking peptide, Z-Fish™ | Anti-Csf-1b (CT) blocking peptide, Z-Fish™ | Anti-Csf-1r (IN-1) blocking peptide, Z-Fish™ | Anti-Csf-1r (IN-2) blocking peptide, Z-Fish™ | Anti-Csf-3r (IN) blocking peptide, Z-Fish™ | Anti-Ctnn-a (CT) blocking peptide, Z-Fish™ | Anti-Ctnn-b1 (IN) blocking peptide, Z-Fish™ | Anti-Ctnn-b2 (IN) blocking peptide, Z-Fish™ | Anti-Ctssb-2 (IN) blocking peptide, Z-Fish™ | Anti-Cxcl-12a (IN) blocking peptide, Z-Fish™ | Anti-CXCR-3.2 (IN) blocking peptide, Z-Fish™ | Anti-Cybb (IN), Z-Fish™ | Anti-Cyclin E1 (NT) blocking peptide, Z-Fish™ | Anti-Cyclin E2 (NT) blocking peptide, Z-Fish™ | Anti-Cyclin-A2 (CT) blocking Peptide, Z-Fish™ | Anti-Cyclin-A2 (IN) blocking Peptide, Z-Fish™ | Anti-Cyclin-D1 (CT) blocking peptide, Z-Fish™ | Anti-Cyclin-D1 (NT) blocking peptide, Z-Fish™ | Anti-Cyclin-E1 (CT) blocking peptide, Z-Fish™ | Anti-Cyclin-E2 (CT), Z-Fish™ | Anti-Cyclin-G1 (CT) blocking peptide, Z-Fish™ | Anti-Cyclin-H (CT) blocking peptide, Z-Fish™ | Anti-Cyclin-H (NT) blocking Peptide, Z-Fish™ | Anti-Cyp-19a1a (CT-2) blocking peptide, Z-Fish™ | Anti-Cyp-19a1a (IN) blocking peptide, Z-Fish™ | Anti-Cyp-19a1b (CT) blocking peptide, Z-Fish™ | Anti-Cyp-26a1 (IN) blocking peptide, Z-Fish™ | Anti-Cyp-26a1 (NT) blocking peptide, Z-Fish™ | Anti-Cyp19a1a (CT) blocking Peptide, Z-Fish™ | Anti-Daxx (IN) blocking Peptide, Z-Fish™ | Anti-Dcc (IN) blocking peptide, Z-Fish™ | Anti-Dct (IN) blocking peptide, Z-Fish™ | Anti-DFF-a (CT) blocking Peptide, Z-Fish™ | Anti-DFF-b (IN) blocking Peptide, Z-Fish™ | Anti-Dl-D (IN) blocking peptide, Z-Fish™ | Anti-Dla-A (IN) blocking peptide, Z-Fish™ | Anti-Dla-B (CT) blocking peptide, Z-Fish™ | Anti-Dla-B (IN) blocking peptide, Z-Fish™ | Anti-Dla-C (IN) blocking peptide, Z-Fish™ | Anti-Dll-4 (IN) blocking peptide, Z-Fish™ | Anti-Drl (CT) blocking peptide, Z-Fish™ | Anti-DsRed blocking peptide, Z-Fish™ | Anti-Dvl-2 (IN) blocking peptide, Z-Fish™ | Anti-Dvl-3 (IN) blocking peptide, Z-Fish™ | Anti-Dzip-1 (IN-1) blocking peptide, Z-Fish™ | Anti-Dzip-1 (IN-2) blocking peptide, Z-Fish™ | Anti-Ef-1a (IN) blocking peptide, Z-Fish™ | Anti-EfnB-2a (IN) blocking peptide, Z-Fish™ | Anti-EGF (IN) blocking Peptide, Z-Fish™ | Anti-EGFR (CT) blocking Peptide, Z-Fish™ | Anti-Egr-2b (IN-1) blocking peptide, Z-Fish™ | Anti-Egr-2b (IN2) blocking Peptide, Z-Fish™ | Anti-EphA4a (IN) blocking peptide, Z-Fish™ | Anti-EphA4b (IN) blocking peptide, Z-Fish™ | Anti-EphB-4a (IN) blocking peptide, Z-Fish™ | Anti-ErbB-2 (CT) blocking peptide, Z-Fish™ | Anti-FADD (IN) blocking Peptide, Z-Fish™ | Anti-Fanc-c (NT) blocking peptide, Z-Fish™ | Anti-Fanc-d1 (IN) blocking peptide, Z-Fish™ | Anti-Fanc-d1 (NT) blocking peptide, Z-Fish™ | Anti-Fanc-d2 (CT) blocking peptide, Z-Fish™ | Anti-Fanc-d2 (CT-2) blocking peptide, Z-Fish™ | Anti-Fanc-d2 (IN) blocking peptide, Z-Fish™ | Anti-Fanc-l (IN) blocking peptide, Z-Fish™ | Anti-Fanc-l (NT) blocking peptide, Z-Fish™ | Anti-Fas (IN) blocking Peptide, Z-Fish™ | Anti-FasL (NT) blocking Peptide, Z-Fish™ | Anti-FGF-3 (CT) blocking peptide, Z-Fish™ | Anti-FGF-8a (CT) blocking peptide, Z-Fish™ | Anti-Fgfr-1 (CT) blocking peptide, Z-Fish™ | Anti-Fgfr-2 (IN) blocking peptide, Z-Fish™ | Anti-Fgfr-3 (CT) blocking peptide, Z-Fish™ | Anti-Fgfr-4 (IN) blocking peptide, Z-Fish™ | Anti-Fibronectin-1 (NT) blocking peptide, Z-Fish™ | Anti-Figf (CT) blocking peptide, Z-Fish™ | Anti-Figf (NT) blocking peptide, Z-Fish™ | Anti-Flh (CT) blocking Peptide, Z-Fish™ | Anti-Fli-1a (CT) blocking peptide, Z-Fish™ | Anti-Flt-1 (Vegfr-1) (IN) blocking peptide, Z-Fish™ | Anti-Flt-1(Vegfr-1) (IN-2) blocking peptide, Z-Fish™ | Anti-Flt-4 (IN-1) blocking peptide, Z-Fish™ | Anti-Fox-A3 (IN), Z-Fish™ | Anti-Fox-H1 (CT) blocking peptide, Z-Fish™ | Anti-Fox-H1 (IN-1) blocking peptide, Z-Fish™ | Anti-Fzd-3 (CT) blocking peptide, Z-Fish™ | Anti-Fzd-3l (CT) blocking peptide, Z-Fish™ | Anti-Fzd-7a (CT) blocking peptide, Z-Fish™ | Anti-Fzd-7b (CT) blocking peptide, Z-Fish™ | Anti-Fzd-8a (IN) blocking peptide, Z-Fish™ | Anti-Fzd-8b (IN) blocking peptide, Z-Fish™ | Anti-Fzd-8c (IN) blocking peptide, Z-Fish™ | Anti-Gad-1 (IN) blocking peptide, Z-Fish™ | Anti-Gad-2 (IN) blocking peptide, Z-Fish™ | |
|
|
|
|
| | | |